8031 lines
310 KiB
JavaScript
8031 lines
310 KiB
JavaScript
|
/*!
|
|||
|
* Materialize v0.98.0 (http://materializecss.com)
|
|||
|
* Copyright 2014-2015 Materialize
|
|||
|
* MIT License (https://raw.githubusercontent.com/Dogfalo/materialize/master/LICENSE)
|
|||
|
*/
|
|||
|
// Check for jQuery.
|
|||
|
if (typeof(jQuery) === 'undefined') {
|
|||
|
var jQuery;
|
|||
|
// Check if require is a defined function.
|
|||
|
if (typeof(require) === 'function') {
|
|||
|
jQuery = $ = require('jquery');
|
|||
|
// Else use the dollar sign alias.
|
|||
|
} else {
|
|||
|
jQuery = $;
|
|||
|
}
|
|||
|
}
|
|||
|
;/*
|
|||
|
* jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
|
|||
|
*
|
|||
|
* Uses the built in easing capabilities added In jQuery 1.1
|
|||
|
* to offer multiple easing options
|
|||
|
*
|
|||
|
* TERMS OF USE - jQuery Easing
|
|||
|
*
|
|||
|
* Open source under the BSD License.
|
|||
|
*
|
|||
|
* Copyright © 2008 George McGinley Smith
|
|||
|
* All rights reserved.
|
|||
|
*
|
|||
|
* Redistribution and use in source and binary forms, with or without modification,
|
|||
|
* are permitted provided that the following conditions are met:
|
|||
|
*
|
|||
|
* Redistributions of source code must retain the above copyright notice, this list of
|
|||
|
* conditions and the following disclaimer.
|
|||
|
* Redistributions in binary form must reproduce the above copyright notice, this list
|
|||
|
* of conditions and the following disclaimer in the documentation and/or other materials
|
|||
|
* provided with the distribution.
|
|||
|
*
|
|||
|
* Neither the name of the author nor the names of contributors may be used to endorse
|
|||
|
* or promote products derived from this software without specific prior written permission.
|
|||
|
*
|
|||
|
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
|||
|
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
|||
|
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
|||
|
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
|||
|
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
|||
|
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
|||
|
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
|||
|
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
|||
|
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
|||
|
*
|
|||
|
*/
|
|||
|
|
|||
|
// t: current time, b: begInnIng value, c: change In value, d: duration
|
|||
|
jQuery.easing['jswing'] = jQuery.easing['swing'];
|
|||
|
|
|||
|
jQuery.extend( jQuery.easing,
|
|||
|
{
|
|||
|
def: 'easeOutQuad',
|
|||
|
swing: function (x, t, b, c, d) {
|
|||
|
//alert(jQuery.easing.default);
|
|||
|
return jQuery.easing[jQuery.easing.def](x, t, b, c, d);
|
|||
|
},
|
|||
|
easeInQuad: function (x, t, b, c, d) {
|
|||
|
return c*(t/=d)*t + b;
|
|||
|
},
|
|||
|
easeOutQuad: function (x, t, b, c, d) {
|
|||
|
return -c *(t/=d)*(t-2) + b;
|
|||
|
},
|
|||
|
easeInOutQuad: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return c/2*t*t + b;
|
|||
|
return -c/2 * ((--t)*(t-2) - 1) + b;
|
|||
|
},
|
|||
|
easeInCubic: function (x, t, b, c, d) {
|
|||
|
return c*(t/=d)*t*t + b;
|
|||
|
},
|
|||
|
easeOutCubic: function (x, t, b, c, d) {
|
|||
|
return c*((t=t/d-1)*t*t + 1) + b;
|
|||
|
},
|
|||
|
easeInOutCubic: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return c/2*t*t*t + b;
|
|||
|
return c/2*((t-=2)*t*t + 2) + b;
|
|||
|
},
|
|||
|
easeInQuart: function (x, t, b, c, d) {
|
|||
|
return c*(t/=d)*t*t*t + b;
|
|||
|
},
|
|||
|
easeOutQuart: function (x, t, b, c, d) {
|
|||
|
return -c * ((t=t/d-1)*t*t*t - 1) + b;
|
|||
|
},
|
|||
|
easeInOutQuart: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
|
|||
|
return -c/2 * ((t-=2)*t*t*t - 2) + b;
|
|||
|
},
|
|||
|
easeInQuint: function (x, t, b, c, d) {
|
|||
|
return c*(t/=d)*t*t*t*t + b;
|
|||
|
},
|
|||
|
easeOutQuint: function (x, t, b, c, d) {
|
|||
|
return c*((t=t/d-1)*t*t*t*t + 1) + b;
|
|||
|
},
|
|||
|
easeInOutQuint: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
|
|||
|
return c/2*((t-=2)*t*t*t*t + 2) + b;
|
|||
|
},
|
|||
|
easeInSine: function (x, t, b, c, d) {
|
|||
|
return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
|
|||
|
},
|
|||
|
easeOutSine: function (x, t, b, c, d) {
|
|||
|
return c * Math.sin(t/d * (Math.PI/2)) + b;
|
|||
|
},
|
|||
|
easeInOutSine: function (x, t, b, c, d) {
|
|||
|
return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
|
|||
|
},
|
|||
|
easeInExpo: function (x, t, b, c, d) {
|
|||
|
return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
|
|||
|
},
|
|||
|
easeOutExpo: function (x, t, b, c, d) {
|
|||
|
return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
|
|||
|
},
|
|||
|
easeInOutExpo: function (x, t, b, c, d) {
|
|||
|
if (t==0) return b;
|
|||
|
if (t==d) return b+c;
|
|||
|
if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
|
|||
|
return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
|
|||
|
},
|
|||
|
easeInCirc: function (x, t, b, c, d) {
|
|||
|
return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
|
|||
|
},
|
|||
|
easeOutCirc: function (x, t, b, c, d) {
|
|||
|
return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
|
|||
|
},
|
|||
|
easeInOutCirc: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
|
|||
|
return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
|
|||
|
},
|
|||
|
easeInElastic: function (x, t, b, c, d) {
|
|||
|
var s=1.70158;var p=0;var a=c;
|
|||
|
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
|||
|
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
|||
|
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
|||
|
return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
|||
|
},
|
|||
|
easeOutElastic: function (x, t, b, c, d) {
|
|||
|
var s=1.70158;var p=0;var a=c;
|
|||
|
if (t==0) return b; if ((t/=d)==1) return b+c; if (!p) p=d*.3;
|
|||
|
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
|||
|
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
|||
|
return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
|
|||
|
},
|
|||
|
easeInOutElastic: function (x, t, b, c, d) {
|
|||
|
var s=1.70158;var p=0;var a=c;
|
|||
|
if (t==0) return b; if ((t/=d/2)==2) return b+c; if (!p) p=d*(.3*1.5);
|
|||
|
if (a < Math.abs(c)) { a=c; var s=p/4; }
|
|||
|
else var s = p/(2*Math.PI) * Math.asin (c/a);
|
|||
|
if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
|
|||
|
return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
|
|||
|
},
|
|||
|
easeInBack: function (x, t, b, c, d, s) {
|
|||
|
if (s == undefined) s = 1.70158;
|
|||
|
return c*(t/=d)*t*((s+1)*t - s) + b;
|
|||
|
},
|
|||
|
easeOutBack: function (x, t, b, c, d, s) {
|
|||
|
if (s == undefined) s = 1.70158;
|
|||
|
return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
|
|||
|
},
|
|||
|
easeInOutBack: function (x, t, b, c, d, s) {
|
|||
|
if (s == undefined) s = 1.70158;
|
|||
|
if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
|
|||
|
return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
|
|||
|
},
|
|||
|
easeInBounce: function (x, t, b, c, d) {
|
|||
|
return c - jQuery.easing.easeOutBounce (x, d-t, 0, c, d) + b;
|
|||
|
},
|
|||
|
easeOutBounce: function (x, t, b, c, d) {
|
|||
|
if ((t/=d) < (1/2.75)) {
|
|||
|
return c*(7.5625*t*t) + b;
|
|||
|
} else if (t < (2/2.75)) {
|
|||
|
return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
|
|||
|
} else if (t < (2.5/2.75)) {
|
|||
|
return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
|
|||
|
} else {
|
|||
|
return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
|
|||
|
}
|
|||
|
},
|
|||
|
easeInOutBounce: function (x, t, b, c, d) {
|
|||
|
if (t < d/2) return jQuery.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
|
|||
|
return jQuery.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
/*
|
|||
|
*
|
|||
|
* TERMS OF USE - EASING EQUATIONS
|
|||
|
*
|
|||
|
* Open source under the BSD License.
|
|||
|
*
|
|||
|
* Copyright © 2001 Robert Penner
|
|||
|
* All rights reserved.
|
|||
|
*
|
|||
|
* Redistribution and use in source and binary forms, with or without modification,
|
|||
|
* are permitted provided that the following conditions are met:
|
|||
|
*
|
|||
|
* Redistributions of source code must retain the above copyright notice, this list of
|
|||
|
* conditions and the following disclaimer.
|
|||
|
* Redistributions in binary form must reproduce the above copyright notice, this list
|
|||
|
* of conditions and the following disclaimer in the documentation and/or other materials
|
|||
|
* provided with the distribution.
|
|||
|
*
|
|||
|
* Neither the name of the author nor the names of contributors may be used to endorse
|
|||
|
* or promote products derived from this software without specific prior written permission.
|
|||
|
*
|
|||
|
* THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
|
|||
|
* EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
|
|||
|
* MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
|
|||
|
* COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
|
|||
|
* EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
|
|||
|
* GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
|
|||
|
* AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
|
|||
|
* NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
|
|||
|
* OF THE POSSIBILITY OF SUCH DAMAGE.
|
|||
|
*
|
|||
|
*/;// Custom Easing
|
|||
|
jQuery.extend( jQuery.easing,
|
|||
|
{
|
|||
|
easeInOutMaterial: function (x, t, b, c, d) {
|
|||
|
if ((t/=d/2) < 1) return c/2*t*t + b;
|
|||
|
return c/4*((t-=2)*t*t + 2) + b;
|
|||
|
}
|
|||
|
});;/*! VelocityJS.org (1.2.3). (C) 2014 Julian Shapiro. MIT @license: en.wikipedia.org/wiki/MIT_License */
|
|||
|
/*! VelocityJS.org jQuery Shim (1.0.1). (C) 2014 The jQuery Foundation. MIT @license: en.wikipedia.org/wiki/MIT_License. */
|
|||
|
/*! Note that this has been modified by Materialize to confirm that Velocity is not already being imported. */
|
|||
|
jQuery.Velocity?console.log("Velocity is already loaded. You may be needlessly importing Velocity again; note that Materialize includes Velocity."):(!function(e){function t(e){var t=e.length,a=r.type(e);return"function"===a||r.isWindow(e)?!1:1===e.nodeType&&t?!0:"array"===a||0===t||"number"==typeof t&&t>0&&t-1 in e}if(!e.jQuery){var r=function(e,t){return new r.fn.init(e,t)};r.isWindow=function(e){return null!=e&&e==e.window},r.type=function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[i.call(e)]||"object":typeof e},r.isArray=Array.isArray||function(e){return"array"===r.type(e)},r.isPlainObject=function(e){var t;if(!e||"object"!==r.type(e)||e.nodeType||r.isWindow(e))return!1;try{if(e.constructor&&!o.call(e,"constructor")&&!o.call(e.constructor.prototype,"isPrototypeOf"))return!1}catch(a){return!1}for(t in e);return void 0===t||o.call(e,t)},r.each=function(e,r,a){var n,o=0,i=e.length,s=t(e);if(a){if(s)for(;i>o&&(n=r.apply(e[o],a),n!==!1);o++);else for(o in e)if(n=r.apply(e[o],a),n===!1)break}else if(s)for(;i>o&&(n=r.call(e[o],o,e[o]),n!==!1);o++);else for(o in e)if(n=r.call(e[o],o,e[o]),n===!1)break;return e},r.data=function(e,t,n){if(void 0===n){var o=e[r.expando],i=o&&a[o];if(void 0===t)return i;if(i&&t in i)return i[t]}else if(void 0!==t){var o=e[r.expando]||(e[r.expando]=++r.uuid);return a[o]=a[o]||{},a[o][t]=n,n}},r.removeData=function(e,t){var n=e[r.expando],o=n&&a[n];o&&r.each(t,function(e,t){delete o[t]})},r.extend=function(){var e,t,a,n,o,i,s=arguments[0]||{},l=1,u=arguments.length,c=!1;for("boolean"==typeof s&&(c=s,s=arguments[l]||{},l++),"object"!=typeof s&&"function"!==r.type(s)&&(s={}),l===u&&(s=this,l--);u>l;l++)if(null!=(o=arguments[l]))for(n in o)e=s[n],a=o[n],s!==a&&(c&&a&&(r.isPlainObject(a)||(t=r.isArray(a)))?(t?(t=!1,i=e&&r.isArray(e)?e:[]):i=e&&r.isPlainObject(e)?e:{},s[n]=r.extend(c,i,a)):void 0!==a&&(s[n]=a));return s},r.queue=function(e,a,n){function o(e,r){var a=r||[];return null!=e&&(t(Object(e))?!function(e,t){for(var r=+t.length,a=0,n=e.length;r>a;)e[n++]=t[a++];if(r!==r)for(;void 0!==t[a];)e[n++]=t[a++];return e.length=n,e}(a,"string"==typeof e?[e]:e):[].push.call(a,e)),a}if(e){a=(a||"fx")+"queue";var i=r.data(e,a);return n?(!i||r.isArray(n)?i=r.data(e,a,o(n)):i.push(n),i):i||[]}},r.dequeue=function(e,t){r.each(e.nodeType?[e]:e,function(e,a){t=t||"fx";var n=r.queue(a,t),o=n.shift();"inprogress"===o&&(o=n.shift()),o&&("fx"===t&&n.unshift("inprogress"),o.call(a,function(){r.dequeue(a,t)}))})},r.fn=r.prototype={init:function(e){if(e.nodeType)return this[0]=e,this;throw new Error("Not a DOM node.")},offset:function(){var t=this[0].getBoundingClientRect?this[0].getBoundingClientRect():{top:0,left:0};return{top:t.top+(e.pageYOffset||document.scrollTop||0)-(document.clientTop||0),left:t.left+(e.pageXOffset||document.scrollLeft||0)-(document.clientLeft||0)}},position:function(){function e(){for(var e=this.offsetParent||document;e&&"html"===!e.nodeType.toLowerCase&&"static"===e.style.position;)e=e.offsetParent;return e||document}var t=this[0],e=e.apply(t),a=this.offset(),n=/^(?:body|html)$/i.test(e.nodeName)?{top:0,left:0}:r(e).offset();return a.top-=parseFloat(t.style.marginTop)||0,a.left-=parseFloat(t.style.marginLeft)||0,e.style&&(n.top+=parseFloat(e.style.borderTopWidth)||0,n.left+=parseFloat(e.style.borderLeftWidth)||0),{top:a.top-n.top,left:a.left-n.left}}};var a={};r.expando="velocity"+(new Date).getTime(),r.uuid=0;for(var n={},o=n.hasOwnProperty,i=n.toString,s="Boolean Number String Function Array Date RegExp Object Error".split(" "),l=0;l<s.length;l++)n["[object "+s[l]+"]"]=s[l].toLowerCase();r.fn.init.prototype=r.fn,e.Velocity={Utilities:r}}}(window),function(e){"object"==typeof module&&"object"==typeof module.exports?module.exports=e():"function"==typeof define&&define.amd?define(e):e()}(function(){return function(e,t,r,a){function n(e){for(var t=-1,r=e?e.length:0,a=[];++t<r;){var n=e[t];n&&a.push(n)}return a}function o(e){return m.isWrapped(e)?e=[].slice.call(e):m.isNode(e)&&(e=[e]),e}function i(e){var t=f.data(e,"velocity");return null===t?a:t}function s(e){return fun
|
|||
|
m.isFunction(t)&&t(null,!0)}),f.queue(a,m.isString(v)?v:"",[])),"stop"===y?(i(a)&&i(a).tweensContainer&&o!==!1&&f.each(i(a).tweensContainer,function(e,t){t.endValue=t.currentValue}),F.push(e)):"finish"===y&&(t[2].duration=1))}):!0})}),"stop"===y&&(f.each(F,function(e,t){p(t,!0)}),k.promise&&k.resolver(g)),e();default:if(!f.isPlainObject(y)||m.isEmptyObject(y)){if(m.isString(y)&&b.Redirects[y]){var j=f.extend({},v),E=j.duration,H=j.delay||0;return j.backwards===!0&&(g=f.extend(!0,[],g).reverse()),f.each(g,function(e,t){parseFloat(j.stagger)?j.delay=H+parseFloat(j.stagger)*e:m.isFunction(j.stagger)&&(j.delay=H+j.stagger.call(t,e,w)),j.drag&&(j.duration=parseFloat(E)||(/^(callout|transition)/.test(y)?1e3:h),j.duration=Math.max(j.duration*(j.backwards?1-e/w:(e+1)/w),.75*j.duration,200)),b.Redirects[y].call(t,t,j||{},e,w,g,k.promise?k:a)}),e()}var N="Velocity: First argument ("+y+") was not a property map, a known action, or a registered redirect. Aborting.";return k.promise?k.rejecter(new Error(N)):console.log(N),e()}A="start"}var L={lastParent:null,lastPosition:null,lastFontSize:null,lastPercentToPxWidth:null,lastPercentToPxHeight:null,lastEmToPx:null,remToPx:null,vwToPx:null,vhToPx:null},R=[];f.each(g,function(e,t){m.isNode(t)&&n.call(t)});var z,j=f.extend({},b.defaults,v);if(j.loop=parseInt(j.loop),z=2*j.loop-1,j.loop)for(var O=0;z>O;O++){var q={delay:j.delay,progress:j.progress};O===z-1&&(q.display=j.display,q.visibility=j.visibility,q.complete=j.complete),P(g,"reverse",q)}return e()}};b=f.extend(P,b),b.animate=P;var w=t.requestAnimationFrame||g;return b.State.isMobile||r.hidden===a||r.addEventListener("visibilitychange",function(){r.hidden?(w=function(e){return setTimeout(function(){e(!0)},16)},c()):w=t.requestAnimationFrame||g}),e.Velocity=b,e!==t&&(e.fn.velocity=P,e.fn.velocity.defaults=b.defaults),f.each(["Down","Up"],function(e,t){b.Redirects["slide"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u=l.begin,c=l.complete,p={height:"",marginTop:"",marginBottom:"",paddingTop:"",paddingBottom:""},d={};l.display===a&&(l.display="Down"===t?"inline"===b.CSS.Values.getDisplayType(e)?"inline-block":"block":"none"),l.begin=function(){u&&u.call(i,i);for(var r in p){d[r]=e.style[r];var a=b.CSS.getPropertyValue(e,r);p[r]="Down"===t?[a,0]:[0,a]}d.overflow=e.style.overflow,e.style.overflow="hidden"},l.complete=function(){for(var t in d)e.style[t]=d[t];c&&c.call(i,i),s&&s.resolver(i)},b(e,p,l)}}),f.each(["In","Out"],function(e,t){b.Redirects["fade"+t]=function(e,r,n,o,i,s){var l=f.extend({},r),u={opacity:"In"===t?1:0},c=l.complete;l.complete=n!==o-1?l.begin=null:function(){c&&c.call(i,i),s&&s.resolver(i)},l.display===a&&(l.display="In"===t?"auto":"none"),b(this,u,l)}}),b}(window.jQuery||window.Zepto||window,window,document)}));
|
|||
|
;!function(a,b,c,d){"use strict";function k(a,b,c){return setTimeout(q(a,c),b)}function l(a,b,c){return Array.isArray(a)?(m(a,c[b],c),!0):!1}function m(a,b,c){var e;if(a)if(a.forEach)a.forEach(b,c);else if(a.length!==d)for(e=0;e<a.length;)b.call(c,a[e],e,a),e++;else for(e in a)a.hasOwnProperty(e)&&b.call(c,a[e],e,a)}function n(a,b,c){for(var e=Object.keys(b),f=0;f<e.length;)(!c||c&&a[e[f]]===d)&&(a[e[f]]=b[e[f]]),f++;return a}function o(a,b){return n(a,b,!0)}function p(a,b,c){var e,d=b.prototype;e=a.prototype=Object.create(d),e.constructor=a,e._super=d,c&&n(e,c)}function q(a,b){return function(){return a.apply(b,arguments)}}function r(a,b){return typeof a==g?a.apply(b?b[0]||d:d,b):a}function s(a,b){return a===d?b:a}function t(a,b,c){m(x(b),function(b){a.addEventListener(b,c,!1)})}function u(a,b,c){m(x(b),function(b){a.removeEventListener(b,c,!1)})}function v(a,b){for(;a;){if(a==b)return!0;a=a.parentNode}return!1}function w(a,b){return a.indexOf(b)>-1}function x(a){return a.trim().split(/\s+/g)}function y(a,b,c){if(a.indexOf&&!c)return a.indexOf(b);for(var d=0;d<a.length;){if(c&&a[d][c]==b||!c&&a[d]===b)return d;d++}return-1}function z(a){return Array.prototype.slice.call(a,0)}function A(a,b,c){for(var d=[],e=[],f=0;f<a.length;){var g=b?a[f][b]:a[f];y(e,g)<0&&d.push(a[f]),e[f]=g,f++}return c&&(d=b?d.sort(function(a,c){return a[b]>c[b]}):d.sort()),d}function B(a,b){for(var c,f,g=b[0].toUpperCase()+b.slice(1),h=0;h<e.length;){if(c=e[h],f=c?c+g:b,f in a)return f;h++}return d}function D(){return C++}function E(a){var b=a.ownerDocument;return b.defaultView||b.parentWindow}function ab(a,b){var c=this;this.manager=a,this.callback=b,this.element=a.element,this.target=a.options.inputTarget,this.domHandler=function(b){r(a.options.enable,[a])&&c.handler(b)},this.init()}function bb(a){var b,c=a.options.inputClass;return b=c?c:H?wb:I?Eb:G?Gb:rb,new b(a,cb)}function cb(a,b,c){var d=c.pointers.length,e=c.changedPointers.length,f=b&O&&0===d-e,g=b&(Q|R)&&0===d-e;c.isFirst=!!f,c.isFinal=!!g,f&&(a.session={}),c.eventType=b,db(a,c),a.emit("hammer.input",c),a.recognize(c),a.session.prevInput=c}function db(a,b){var c=a.session,d=b.pointers,e=d.length;c.firstInput||(c.firstInput=gb(b)),e>1&&!c.firstMultiple?c.firstMultiple=gb(b):1===e&&(c.firstMultiple=!1);var f=c.firstInput,g=c.firstMultiple,h=g?g.center:f.center,i=b.center=hb(d);b.timeStamp=j(),b.deltaTime=b.timeStamp-f.timeStamp,b.angle=lb(h,i),b.distance=kb(h,i),eb(c,b),b.offsetDirection=jb(b.deltaX,b.deltaY),b.scale=g?nb(g.pointers,d):1,b.rotation=g?mb(g.pointers,d):0,fb(c,b);var k=a.element;v(b.srcEvent.target,k)&&(k=b.srcEvent.target),b.target=k}function eb(a,b){var c=b.center,d=a.offsetDelta||{},e=a.prevDelta||{},f=a.prevInput||{};(b.eventType===O||f.eventType===Q)&&(e=a.prevDelta={x:f.deltaX||0,y:f.deltaY||0},d=a.offsetDelta={x:c.x,y:c.y}),b.deltaX=e.x+(c.x-d.x),b.deltaY=e.y+(c.y-d.y)}function fb(a,b){var f,g,h,j,c=a.lastInterval||b,e=b.timeStamp-c.timeStamp;if(b.eventType!=R&&(e>N||c.velocity===d)){var k=c.deltaX-b.deltaX,l=c.deltaY-b.deltaY,m=ib(e,k,l);g=m.x,h=m.y,f=i(m.x)>i(m.y)?m.x:m.y,j=jb(k,l),a.lastInterval=b}else f=c.velocity,g=c.velocityX,h=c.velocityY,j=c.direction;b.velocity=f,b.velocityX=g,b.velocityY=h,b.direction=j}function gb(a){for(var b=[],c=0;c<a.pointers.length;)b[c]={clientX:h(a.pointers[c].clientX),clientY:h(a.pointers[c].clientY)},c++;return{timeStamp:j(),pointers:b,center:hb(b),deltaX:a.deltaX,deltaY:a.deltaY}}function hb(a){var b=a.length;if(1===b)return{x:h(a[0].clientX),y:h(a[0].clientY)};for(var c=0,d=0,e=0;b>e;)c+=a[e].clientX,d+=a[e].clientY,e++;return{x:h(c/b),y:h(d/b)}}function ib(a,b,c){return{x:b/a||0,y:c/a||0}}function jb(a,b){return a===b?S:i(a)>=i(b)?a>0?T:U:b>0?V:W}function kb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return Math.sqrt(d*d+e*e)}function lb(a,b,c){c||(c=$);var d=b[c[0]]-a[c[0]],e=b[c[1]]-a[c[1]];return 180*Math.atan2(e,d)/Math.PI}function mb(a,b){return lb(b[1],b[0],_)-lb(a[1],a[0],_)}function nb(a,b){return kb(b[0],b[1],_)/kb(a[0],a[1],_)}function rb(){this.evEl=pb,this.evWin=qb,this.allow=!0,this.pressed=!1,ab.apply(t
|
|||
|
if (typeof define === 'function' && define.amd) {
|
|||
|
define(['jquery', 'hammerjs'], factory);
|
|||
|
} else if (typeof exports === 'object') {
|
|||
|
factory(require('jquery'), require('hammerjs'));
|
|||
|
} else {
|
|||
|
factory(jQuery, Hammer);
|
|||
|
}
|
|||
|
}(function($, Hammer) {
|
|||
|
function hammerify(el, options) {
|
|||
|
var $el = $(el);
|
|||
|
if(!$el.data("hammer")) {
|
|||
|
$el.data("hammer", new Hammer($el[0], options));
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
$.fn.hammer = function(options) {
|
|||
|
return this.each(function() {
|
|||
|
hammerify(this, options);
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
// extend the emit method to also trigger jQuery events
|
|||
|
Hammer.Manager.prototype.emit = (function(originalEmit) {
|
|||
|
return function(type, data) {
|
|||
|
originalEmit.call(this, type, data);
|
|||
|
$(this.element).trigger({
|
|||
|
type: type,
|
|||
|
gesture: data
|
|||
|
});
|
|||
|
};
|
|||
|
})(Hammer.Manager.prototype.emit);
|
|||
|
}));
|
|||
|
;// Required for Meteor package, the use of window prevents export by Meteor
|
|||
|
(function(window){
|
|||
|
if(window.Package){
|
|||
|
Materialize = {};
|
|||
|
} else {
|
|||
|
window.Materialize = {};
|
|||
|
}
|
|||
|
})(window);
|
|||
|
|
|||
|
|
|||
|
/*
|
|||
|
* raf.js
|
|||
|
* https://github.com/ngryman/raf.js
|
|||
|
*
|
|||
|
* original requestAnimationFrame polyfill by Erik Möller
|
|||
|
* inspired from paul_irish gist and post
|
|||
|
*
|
|||
|
* Copyright (c) 2013 ngryman
|
|||
|
* Licensed under the MIT license.
|
|||
|
*/
|
|||
|
(function(window) {
|
|||
|
var lastTime = 0,
|
|||
|
vendors = ['webkit', 'moz'],
|
|||
|
requestAnimationFrame = window.requestAnimationFrame,
|
|||
|
cancelAnimationFrame = window.cancelAnimationFrame,
|
|||
|
i = vendors.length;
|
|||
|
|
|||
|
// try to un-prefix existing raf
|
|||
|
while (--i >= 0 && !requestAnimationFrame) {
|
|||
|
requestAnimationFrame = window[vendors[i] + 'RequestAnimationFrame'];
|
|||
|
cancelAnimationFrame = window[vendors[i] + 'CancelRequestAnimationFrame'];
|
|||
|
}
|
|||
|
|
|||
|
// polyfill with setTimeout fallback
|
|||
|
// heavily inspired from @darius gist mod: https://gist.github.com/paulirish/1579671#comment-837945
|
|||
|
if (!requestAnimationFrame || !cancelAnimationFrame) {
|
|||
|
requestAnimationFrame = function(callback) {
|
|||
|
var now = +Date.now(),
|
|||
|
nextTime = Math.max(lastTime + 16, now);
|
|||
|
return setTimeout(function() {
|
|||
|
callback(lastTime = nextTime);
|
|||
|
}, nextTime - now);
|
|||
|
};
|
|||
|
|
|||
|
cancelAnimationFrame = clearTimeout;
|
|||
|
}
|
|||
|
|
|||
|
// export to window
|
|||
|
window.requestAnimationFrame = requestAnimationFrame;
|
|||
|
window.cancelAnimationFrame = cancelAnimationFrame;
|
|||
|
}(window));
|
|||
|
|
|||
|
|
|||
|
// Unique ID
|
|||
|
Materialize.guid = (function() {
|
|||
|
function s4() {
|
|||
|
return Math.floor((1 + Math.random()) * 0x10000)
|
|||
|
.toString(16)
|
|||
|
.substring(1);
|
|||
|
}
|
|||
|
return function() {
|
|||
|
return s4() + s4() + '-' + s4() + '-' + s4() + '-' +
|
|||
|
s4() + '-' + s4() + s4() + s4();
|
|||
|
};
|
|||
|
})();
|
|||
|
|
|||
|
/**
|
|||
|
* Escapes hash from special characters
|
|||
|
* @param {string} hash String returned from this.hash
|
|||
|
* @returns {string}
|
|||
|
*/
|
|||
|
Materialize.escapeHash = function(hash) {
|
|||
|
return hash.replace( /(:|\.|\[|\]|,|=)/g, "\\$1" );
|
|||
|
};
|
|||
|
|
|||
|
Materialize.elementOrParentIsFixed = function(element) {
|
|||
|
var $element = $(element);
|
|||
|
var $checkElements = $element.add($element.parents());
|
|||
|
var isFixed = false;
|
|||
|
$checkElements.each(function(){
|
|||
|
if ($(this).css("position") === "fixed") {
|
|||
|
isFixed = true;
|
|||
|
return false;
|
|||
|
}
|
|||
|
});
|
|||
|
return isFixed;
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Get time in ms
|
|||
|
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
|||
|
* @type {function}
|
|||
|
* @return {number}
|
|||
|
*/
|
|||
|
var getTime = (Date.now || function () {
|
|||
|
return new Date().getTime();
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Returns a function, that, when invoked, will only be triggered at most once
|
|||
|
* during a given window of time. Normally, the throttled function will run
|
|||
|
* as much as it can, without ever going more than once per `wait` duration;
|
|||
|
* but if you'd like to disable the execution on the leading edge, pass
|
|||
|
* `{leading: false}`. To disable execution on the trailing edge, ditto.
|
|||
|
* @license https://raw.github.com/jashkenas/underscore/master/LICENSE
|
|||
|
* @param {function} func
|
|||
|
* @param {number} wait
|
|||
|
* @param {Object=} options
|
|||
|
* @returns {Function}
|
|||
|
*/
|
|||
|
Materialize.throttle = function(func, wait, options) {
|
|||
|
var context, args, result;
|
|||
|
var timeout = null;
|
|||
|
var previous = 0;
|
|||
|
options || (options = {});
|
|||
|
var later = function () {
|
|||
|
previous = options.leading === false ? 0 : getTime();
|
|||
|
timeout = null;
|
|||
|
result = func.apply(context, args);
|
|||
|
context = args = null;
|
|||
|
};
|
|||
|
return function () {
|
|||
|
var now = getTime();
|
|||
|
if (!previous && options.leading === false) previous = now;
|
|||
|
var remaining = wait - (now - previous);
|
|||
|
context = this;
|
|||
|
args = arguments;
|
|||
|
if (remaining <= 0) {
|
|||
|
clearTimeout(timeout);
|
|||
|
timeout = null;
|
|||
|
previous = now;
|
|||
|
result = func.apply(context, args);
|
|||
|
context = args = null;
|
|||
|
} else if (!timeout && options.trailing !== false) {
|
|||
|
timeout = setTimeout(later, remaining);
|
|||
|
}
|
|||
|
return result;
|
|||
|
};
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
// Velocity has conflicts when loaded with jQuery, this will check for it
|
|||
|
// First, check if in noConflict mode
|
|||
|
var Vel;
|
|||
|
if (jQuery) {
|
|||
|
Vel = jQuery.Velocity;
|
|||
|
} else if ($) {
|
|||
|
Vel = $.Velocity;
|
|||
|
} else {
|
|||
|
Vel = Velocity;
|
|||
|
}
|
|||
|
;(function ($) {
|
|||
|
$.fn.collapsible = function(options) {
|
|||
|
var defaults = {
|
|||
|
accordion: undefined,
|
|||
|
onOpen: undefined,
|
|||
|
onClose: undefined
|
|||
|
};
|
|||
|
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
|
|||
|
var $this = $(this);
|
|||
|
|
|||
|
var $panel_headers = $(this).find('> li > .collapsible-header');
|
|||
|
|
|||
|
var collapsible_type = $this.data("collapsible");
|
|||
|
|
|||
|
// Turn off any existing event handlers
|
|||
|
$this.off('click.collapse', '> li > .collapsible-header');
|
|||
|
$panel_headers.off('click.collapse');
|
|||
|
|
|||
|
|
|||
|
/****************
|
|||
|
Helper Functions
|
|||
|
****************/
|
|||
|
|
|||
|
// Accordion Open
|
|||
|
function accordionOpen(object) {
|
|||
|
$panel_headers = $this.find('> li > .collapsible-header');
|
|||
|
if (object.hasClass('active')) {
|
|||
|
object.parent().addClass('active');
|
|||
|
}
|
|||
|
else {
|
|||
|
object.parent().removeClass('active');
|
|||
|
}
|
|||
|
if (object.parent().hasClass('active')){
|
|||
|
object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
|
|||
|
}
|
|||
|
else{
|
|||
|
object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
|
|||
|
}
|
|||
|
|
|||
|
$panel_headers.not(object).removeClass('active').parent().removeClass('active');
|
|||
|
|
|||
|
// Close previously open accordion elements.
|
|||
|
$panel_headers.not(object).parent().children('.collapsible-body').stop(true,false).each(function() {
|
|||
|
if ($(this).is(':visible')) {
|
|||
|
$(this).slideUp({
|
|||
|
duration: 350,
|
|||
|
easing: "easeOutQuart",
|
|||
|
queue: false,
|
|||
|
complete:
|
|||
|
function() {
|
|||
|
$(this).css('height', '');
|
|||
|
execCallbacks($(this).siblings('.collapsible-header'));
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
// Expandable Open
|
|||
|
function expandableOpen(object) {
|
|||
|
if (object.hasClass('active')) {
|
|||
|
object.parent().addClass('active');
|
|||
|
}
|
|||
|
else {
|
|||
|
object.parent().removeClass('active');
|
|||
|
}
|
|||
|
if (object.parent().hasClass('active')){
|
|||
|
object.siblings('.collapsible-body').stop(true,false).slideDown({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
|
|||
|
}
|
|||
|
else {
|
|||
|
object.siblings('.collapsible-body').stop(true,false).slideUp({ duration: 350, easing: "easeOutQuart", queue: false, complete: function() {$(this).css('height', '');}});
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Open collapsible. object: .collapsible-header
|
|||
|
function collapsibleOpen(object) {
|
|||
|
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
|
|||
|
accordionOpen(object);
|
|||
|
} else { // Handle Expandables
|
|||
|
expandableOpen(object);
|
|||
|
}
|
|||
|
|
|||
|
execCallbacks(object);
|
|||
|
}
|
|||
|
|
|||
|
// Handle callbacks
|
|||
|
function execCallbacks(object) {
|
|||
|
if (object.hasClass('active')) {
|
|||
|
if (typeof(options.onOpen) === "function") {
|
|||
|
options.onOpen.call(this, object.parent());
|
|||
|
}
|
|||
|
} else {
|
|||
|
if (typeof(options.onClose) === "function") {
|
|||
|
options.onClose.call(this, object.parent());
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Check if object is children of panel header
|
|||
|
* @param {Object} object Jquery object
|
|||
|
* @return {Boolean} true if it is children
|
|||
|
*/
|
|||
|
function isChildrenOfPanelHeader(object) {
|
|||
|
|
|||
|
var panelHeader = getPanelHeader(object);
|
|||
|
|
|||
|
return panelHeader.length > 0;
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Get panel header from a children element
|
|||
|
* @param {Object} object Jquery object
|
|||
|
* @return {Object} panel header object
|
|||
|
*/
|
|||
|
function getPanelHeader(object) {
|
|||
|
|
|||
|
return object.closest('li > .collapsible-header');
|
|||
|
}
|
|||
|
|
|||
|
/***** End Helper Functions *****/
|
|||
|
|
|||
|
|
|||
|
|
|||
|
// Add click handler to only direct collapsible header children
|
|||
|
$this.on('click.collapse', '> li > .collapsible-header', function(e) {
|
|||
|
var element = $(e.target);
|
|||
|
|
|||
|
if (isChildrenOfPanelHeader(element)) {
|
|||
|
element = getPanelHeader(element);
|
|||
|
}
|
|||
|
|
|||
|
element.toggleClass('active');
|
|||
|
|
|||
|
collapsibleOpen(element);
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
// Open first active
|
|||
|
if (options.accordion || collapsible_type === "accordion" || collapsible_type === undefined) { // Handle Accordion
|
|||
|
collapsibleOpen($panel_headers.filter('.active').first());
|
|||
|
|
|||
|
} else { // Handle Expandables
|
|||
|
$panel_headers.filter('.active').each(function() {
|
|||
|
collapsibleOpen($(this));
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('.collapsible').collapsible();
|
|||
|
});
|
|||
|
}( jQuery ));;(function ($) {
|
|||
|
|
|||
|
// Add posibility to scroll to selected option
|
|||
|
// usefull for select for example
|
|||
|
$.fn.scrollTo = function(elem) {
|
|||
|
$(this).scrollTop($(this).scrollTop() - $(this).offset().top + $(elem).offset().top);
|
|||
|
return this;
|
|||
|
};
|
|||
|
|
|||
|
$.fn.dropdown = function (options) {
|
|||
|
var defaults = {
|
|||
|
inDuration: 300,
|
|||
|
outDuration: 225,
|
|||
|
constrainWidth: true, // Constrains width of dropdown to the activator
|
|||
|
hover: false,
|
|||
|
gutter: 0, // Spacing from edge
|
|||
|
belowOrigin: false,
|
|||
|
alignment: 'left',
|
|||
|
stopPropagation: false
|
|||
|
};
|
|||
|
|
|||
|
// Open dropdown.
|
|||
|
if (options === "open") {
|
|||
|
this.each(function() {
|
|||
|
$(this).trigger('open');
|
|||
|
});
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
// Close dropdown.
|
|||
|
if (options === "close") {
|
|||
|
this.each(function() {
|
|||
|
$(this).trigger('close');
|
|||
|
});
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
this.each(function(){
|
|||
|
var origin = $(this);
|
|||
|
var curr_options = $.extend({}, defaults, options);
|
|||
|
var isFocused = false;
|
|||
|
|
|||
|
// Dropdown menu
|
|||
|
var activates = $("#"+ origin.attr('data-activates'));
|
|||
|
|
|||
|
function updateOptions() {
|
|||
|
if (origin.data('induration') !== undefined)
|
|||
|
curr_options.inDuration = origin.data('induration');
|
|||
|
if (origin.data('outduration') !== undefined)
|
|||
|
curr_options.outDuration = origin.data('outduration');
|
|||
|
if (origin.data('constrainwidth') !== undefined)
|
|||
|
curr_options.constrainWidth = origin.data('constrainwidth');
|
|||
|
if (origin.data('hover') !== undefined)
|
|||
|
curr_options.hover = origin.data('hover');
|
|||
|
if (origin.data('gutter') !== undefined)
|
|||
|
curr_options.gutter = origin.data('gutter');
|
|||
|
if (origin.data('beloworigin') !== undefined)
|
|||
|
curr_options.belowOrigin = origin.data('beloworigin');
|
|||
|
if (origin.data('alignment') !== undefined)
|
|||
|
curr_options.alignment = origin.data('alignment');
|
|||
|
if (origin.data('stoppropagation') !== undefined)
|
|||
|
curr_options.stopPropagation = origin.data('stoppropagation');
|
|||
|
}
|
|||
|
|
|||
|
updateOptions();
|
|||
|
|
|||
|
// Attach dropdown to its activator
|
|||
|
origin.after(activates);
|
|||
|
|
|||
|
/*
|
|||
|
Helper function to position and resize dropdown.
|
|||
|
Used in hover and click handler.
|
|||
|
*/
|
|||
|
function placeDropdown(eventType) {
|
|||
|
// Check for simultaneous focus and click events.
|
|||
|
if (eventType === 'focus') {
|
|||
|
isFocused = true;
|
|||
|
}
|
|||
|
|
|||
|
// Check html data attributes
|
|||
|
updateOptions();
|
|||
|
|
|||
|
// Set Dropdown state
|
|||
|
activates.addClass('active');
|
|||
|
origin.addClass('active');
|
|||
|
|
|||
|
// Constrain width
|
|||
|
if (curr_options.constrainWidth === true) {
|
|||
|
activates.css('width', origin.outerWidth());
|
|||
|
|
|||
|
} else {
|
|||
|
activates.css('white-space', 'nowrap');
|
|||
|
}
|
|||
|
|
|||
|
// Offscreen detection
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var originHeight = origin.innerHeight();
|
|||
|
var offsetLeft = origin.offset().left;
|
|||
|
var offsetTop = origin.offset().top - $(window).scrollTop();
|
|||
|
var currAlignment = curr_options.alignment;
|
|||
|
var gutterSpacing = 0;
|
|||
|
var leftPosition = 0;
|
|||
|
|
|||
|
// Below Origin
|
|||
|
var verticalOffset = 0;
|
|||
|
if (curr_options.belowOrigin === true) {
|
|||
|
verticalOffset = originHeight;
|
|||
|
}
|
|||
|
|
|||
|
// Check for scrolling positioned container.
|
|||
|
var scrollYOffset = 0;
|
|||
|
var scrollXOffset = 0;
|
|||
|
var wrapper = origin.parent();
|
|||
|
if (!wrapper.is('body')) {
|
|||
|
if (wrapper[0].scrollHeight > wrapper[0].clientHeight) {
|
|||
|
scrollYOffset = wrapper[0].scrollTop;
|
|||
|
}
|
|||
|
if (wrapper[0].scrollWidth > wrapper[0].clientWidth) {
|
|||
|
scrollXOffset = wrapper[0].scrollLeft;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
if (offsetLeft + activates.innerWidth() > $(window).width()) {
|
|||
|
// Dropdown goes past screen on right, force right alignment
|
|||
|
currAlignment = 'right';
|
|||
|
|
|||
|
} else if (offsetLeft - activates.innerWidth() + origin.innerWidth() < 0) {
|
|||
|
// Dropdown goes past screen on left, force left alignment
|
|||
|
currAlignment = 'left';
|
|||
|
}
|
|||
|
// Vertical bottom offscreen detection
|
|||
|
if (offsetTop + activates.innerHeight() > windowHeight) {
|
|||
|
// If going upwards still goes offscreen, just crop height of dropdown.
|
|||
|
if (offsetTop + originHeight - activates.innerHeight() < 0) {
|
|||
|
var adjustedHeight = windowHeight - offsetTop - verticalOffset;
|
|||
|
activates.css('max-height', adjustedHeight);
|
|||
|
} else {
|
|||
|
// Flow upwards.
|
|||
|
if (!verticalOffset) {
|
|||
|
verticalOffset += originHeight;
|
|||
|
}
|
|||
|
verticalOffset -= activates.innerHeight();
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Handle edge alignment
|
|||
|
if (currAlignment === 'left') {
|
|||
|
gutterSpacing = curr_options.gutter;
|
|||
|
leftPosition = origin.position().left + gutterSpacing;
|
|||
|
}
|
|||
|
else if (currAlignment === 'right') {
|
|||
|
var offsetRight = origin.position().left + origin.outerWidth() - activates.outerWidth();
|
|||
|
gutterSpacing = -curr_options.gutter;
|
|||
|
leftPosition = offsetRight + gutterSpacing;
|
|||
|
}
|
|||
|
|
|||
|
// Position dropdown
|
|||
|
activates.css({
|
|||
|
position: 'absolute',
|
|||
|
top: origin.position().top + verticalOffset + scrollYOffset,
|
|||
|
left: leftPosition + scrollXOffset
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
// Show dropdown
|
|||
|
activates.stop(true, true).css('opacity', 0)
|
|||
|
.slideDown({
|
|||
|
queue: false,
|
|||
|
duration: curr_options.inDuration,
|
|||
|
easing: 'easeOutCubic',
|
|||
|
complete: function() {
|
|||
|
$(this).css('height', '');
|
|||
|
}
|
|||
|
})
|
|||
|
.animate( {opacity: 1}, {queue: false, duration: curr_options.inDuration, easing: 'easeOutSine'});
|
|||
|
|
|||
|
// Add click close handler to document
|
|||
|
$(document).bind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'), function (e) {
|
|||
|
if (!activates.is(e.target) && !origin.is(e.target) && (!origin.find(e.target).length) ) {
|
|||
|
hideDropdown();
|
|||
|
$(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
function hideDropdown() {
|
|||
|
// Check for simultaneous focus and click events.
|
|||
|
isFocused = false;
|
|||
|
activates.fadeOut(curr_options.outDuration);
|
|||
|
activates.removeClass('active');
|
|||
|
origin.removeClass('active');
|
|||
|
$(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
|
|||
|
setTimeout(function() { activates.css('max-height', ''); }, curr_options.outDuration);
|
|||
|
}
|
|||
|
|
|||
|
// Hover
|
|||
|
if (curr_options.hover) {
|
|||
|
var open = false;
|
|||
|
origin.unbind('click.' + origin.attr('id'));
|
|||
|
// Hover handler to show dropdown
|
|||
|
origin.on('mouseenter', function(e){ // Mouse over
|
|||
|
if (open === false) {
|
|||
|
placeDropdown();
|
|||
|
open = true;
|
|||
|
}
|
|||
|
});
|
|||
|
origin.on('mouseleave', function(e){
|
|||
|
// If hover on origin then to something other than dropdown content, then close
|
|||
|
var toEl = e.toElement || e.relatedTarget; // added browser compatibility for target element
|
|||
|
if(!$(toEl).closest('.dropdown-content').is(activates)) {
|
|||
|
activates.stop(true, true);
|
|||
|
hideDropdown();
|
|||
|
open = false;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
activates.on('mouseleave', function(e){ // Mouse out
|
|||
|
var toEl = e.toElement || e.relatedTarget;
|
|||
|
if(!$(toEl).closest('.dropdown-button').is(origin)) {
|
|||
|
activates.stop(true, true);
|
|||
|
hideDropdown();
|
|||
|
open = false;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Click
|
|||
|
} else {
|
|||
|
// Click handler to show dropdown
|
|||
|
origin.unbind('click.' + origin.attr('id'));
|
|||
|
origin.bind('click.'+origin.attr('id'), function(e){
|
|||
|
if (!isFocused) {
|
|||
|
if ( origin[0] == e.currentTarget &&
|
|||
|
!origin.hasClass('active') &&
|
|||
|
($(e.target).closest('.dropdown-content').length === 0)) {
|
|||
|
e.preventDefault(); // Prevents button click from moving window
|
|||
|
if (curr_options.stopPropagation) {
|
|||
|
e.stopPropagation();
|
|||
|
}
|
|||
|
placeDropdown('click');
|
|||
|
}
|
|||
|
// If origin is clicked and menu is open, close menu
|
|||
|
else if (origin.hasClass('active')) {
|
|||
|
hideDropdown();
|
|||
|
$(document).unbind('click.'+ activates.attr('id') + ' touchstart.' + activates.attr('id'));
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
} // End else
|
|||
|
|
|||
|
// Listen to open and close event - useful for select component
|
|||
|
origin.on('open', function(e, eventType) {
|
|||
|
placeDropdown(eventType);
|
|||
|
});
|
|||
|
origin.on('close', hideDropdown);
|
|||
|
|
|||
|
|
|||
|
});
|
|||
|
}; // End dropdown plugin
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('.dropdown-button').dropdown();
|
|||
|
});
|
|||
|
}( jQuery ));
|
|||
|
;(function($) {
|
|||
|
var _stack = 0,
|
|||
|
_lastID = 0,
|
|||
|
_generateID = function() {
|
|||
|
_lastID++;
|
|||
|
return 'materialize-modal-overlay-' + _lastID;
|
|||
|
};
|
|||
|
|
|||
|
var methods = {
|
|||
|
init : function(options) {
|
|||
|
var defaults = {
|
|||
|
opacity: 0.5,
|
|||
|
inDuration: 350,
|
|||
|
outDuration: 250,
|
|||
|
ready: undefined,
|
|||
|
complete: undefined,
|
|||
|
dismissible: true,
|
|||
|
startingTop: '4%',
|
|||
|
endingTop: '10%'
|
|||
|
};
|
|||
|
|
|||
|
// Override defaults
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
var $modal = $(this);
|
|||
|
var modal_id = $(this).attr("id") || '#' + $(this).data('target');
|
|||
|
|
|||
|
var closeModal = function() {
|
|||
|
var overlayID = $modal.data('overlay-id');
|
|||
|
var $overlay = $('#' + overlayID);
|
|||
|
$modal.removeClass('open');
|
|||
|
|
|||
|
// Enable scrolling
|
|||
|
$('body').css({
|
|||
|
overflow: '',
|
|||
|
width: ''
|
|||
|
});
|
|||
|
|
|||
|
$modal.find('.modal-close').off('click.close');
|
|||
|
$(document).off('keyup.modal' + overlayID);
|
|||
|
|
|||
|
$overlay.velocity( { opacity: 0}, {duration: options.outDuration, queue: false, ease: "easeOutQuart"});
|
|||
|
|
|||
|
|
|||
|
// Define Bottom Sheet animation
|
|||
|
var exitVelocityOptions = {
|
|||
|
duration: options.outDuration,
|
|||
|
queue: false,
|
|||
|
ease: "easeOutCubic",
|
|||
|
// Handle modal ready callback
|
|||
|
complete: function() {
|
|||
|
$(this).css({display:"none"});
|
|||
|
|
|||
|
// Call complete callback
|
|||
|
if (typeof(options.complete) === "function") {
|
|||
|
options.complete.call(this, $modal);
|
|||
|
}
|
|||
|
$overlay.remove();
|
|||
|
_stack--;
|
|||
|
}
|
|||
|
};
|
|||
|
if ($modal.hasClass('bottom-sheet')) {
|
|||
|
$modal.velocity({bottom: "-100%", opacity: 0}, exitVelocityOptions);
|
|||
|
}
|
|||
|
else {
|
|||
|
$modal.velocity(
|
|||
|
{ top: options.startingTop, opacity: 0, scaleX: 0.7},
|
|||
|
exitVelocityOptions
|
|||
|
);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
var openModal = function($trigger) {
|
|||
|
var $body = $('body');
|
|||
|
var oldWidth = $body.innerWidth();
|
|||
|
$body.css('overflow', 'hidden');
|
|||
|
$body.width(oldWidth);
|
|||
|
|
|||
|
if ($modal.hasClass('open')) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var overlayID = _generateID();
|
|||
|
var $overlay = $('<div class="modal-overlay"></div>');
|
|||
|
lStack = (++_stack);
|
|||
|
|
|||
|
// Store a reference of the overlay
|
|||
|
$overlay.attr('id', overlayID).css('z-index', 1000 + lStack * 2);
|
|||
|
$modal.data('overlay-id', overlayID).css('z-index', 1000 + lStack * 2 + 1);
|
|||
|
$modal.addClass('open');
|
|||
|
|
|||
|
$("body").append($overlay);
|
|||
|
|
|||
|
if (options.dismissible) {
|
|||
|
$overlay.click(function() {
|
|||
|
closeModal();
|
|||
|
});
|
|||
|
// Return on ESC
|
|||
|
$(document).on('keyup.modal' + overlayID, function(e) {
|
|||
|
if (e.keyCode === 27) { // ESC key
|
|||
|
closeModal();
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
$modal.find(".modal-close").on('click.close', function(e) {
|
|||
|
closeModal();
|
|||
|
});
|
|||
|
|
|||
|
$overlay.css({ display : "block", opacity : 0 });
|
|||
|
|
|||
|
$modal.css({
|
|||
|
display : "block",
|
|||
|
opacity: 0
|
|||
|
});
|
|||
|
|
|||
|
$overlay.velocity({opacity: options.opacity}, {duration: options.inDuration, queue: false, ease: "easeOutCubic"});
|
|||
|
$modal.data('associated-overlay', $overlay[0]);
|
|||
|
|
|||
|
// Define Bottom Sheet animation
|
|||
|
var enterVelocityOptions = {
|
|||
|
duration: options.inDuration,
|
|||
|
queue: false,
|
|||
|
ease: "easeOutCubic",
|
|||
|
// Handle modal ready callback
|
|||
|
complete: function() {
|
|||
|
if (typeof(options.ready) === "function") {
|
|||
|
options.ready.call(this, $modal, $trigger);
|
|||
|
}
|
|||
|
}
|
|||
|
};
|
|||
|
if ($modal.hasClass('bottom-sheet')) {
|
|||
|
$modal.velocity({bottom: "0", opacity: 1}, enterVelocityOptions);
|
|||
|
}
|
|||
|
else {
|
|||
|
$.Velocity.hook($modal, "scaleX", 0.7);
|
|||
|
$modal.css({ top: options.startingTop });
|
|||
|
$modal.velocity({top: options.endingTop, opacity: 1, scaleX: '1'}, enterVelocityOptions);
|
|||
|
}
|
|||
|
|
|||
|
};
|
|||
|
|
|||
|
// Reset handlers
|
|||
|
$(document).off('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]');
|
|||
|
$(this).off('openModal');
|
|||
|
$(this).off('closeModal');
|
|||
|
|
|||
|
// Close Handlers
|
|||
|
$(document).on('click.modalTrigger', 'a[href="#' + modal_id + '"], [data-target="' + modal_id + '"]', function(e) {
|
|||
|
options.startingTop = ($(this).offset().top - $(window).scrollTop()) /1.15;
|
|||
|
openModal($(this));
|
|||
|
e.preventDefault();
|
|||
|
}); // done set on click
|
|||
|
|
|||
|
$(this).on('openModal', function() {
|
|||
|
var modal_id = $(this).attr("href") || '#' + $(this).data('target');
|
|||
|
openModal();
|
|||
|
});
|
|||
|
|
|||
|
$(this).on('closeModal', function() {
|
|||
|
closeModal();
|
|||
|
});
|
|||
|
}); // done return
|
|||
|
},
|
|||
|
open : function() {
|
|||
|
$(this).trigger('openModal');
|
|||
|
},
|
|||
|
close : function() {
|
|||
|
$(this).trigger('closeModal');
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
$.fn.modal = function(methodOrOptions) {
|
|||
|
if ( methods[methodOrOptions] ) {
|
|||
|
return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
|||
|
} else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
|
|||
|
// Default to "init"
|
|||
|
return methods.init.apply( this, arguments );
|
|||
|
} else {
|
|||
|
$.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.modal' );
|
|||
|
}
|
|||
|
};
|
|||
|
})(jQuery);
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
$.fn.materialbox = function () {
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
|
|||
|
if ($(this).hasClass('initialized')) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
$(this).addClass('initialized');
|
|||
|
|
|||
|
var overlayActive = false;
|
|||
|
var doneAnimating = true;
|
|||
|
var inDuration = 275;
|
|||
|
var outDuration = 200;
|
|||
|
var origin = $(this);
|
|||
|
var placeholder = $('<div></div>').addClass('material-placeholder');
|
|||
|
var originalWidth = 0;
|
|||
|
var originalHeight = 0;
|
|||
|
var ancestorsChanged;
|
|||
|
var ancestor;
|
|||
|
origin.wrap(placeholder);
|
|||
|
|
|||
|
|
|||
|
origin.on('click', function(){
|
|||
|
var placeholder = origin.parent('.material-placeholder');
|
|||
|
var windowWidth = window.innerWidth;
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var originalWidth = origin.width();
|
|||
|
var originalHeight = origin.height();
|
|||
|
|
|||
|
|
|||
|
// If already modal, return to original
|
|||
|
if (doneAnimating === false) {
|
|||
|
returnToOriginal();
|
|||
|
return false;
|
|||
|
}
|
|||
|
else if (overlayActive && doneAnimating===true) {
|
|||
|
returnToOriginal();
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Set states
|
|||
|
doneAnimating = false;
|
|||
|
origin.addClass('active');
|
|||
|
overlayActive = true;
|
|||
|
|
|||
|
// Set positioning for placeholder
|
|||
|
placeholder.css({
|
|||
|
width: placeholder[0].getBoundingClientRect().width,
|
|||
|
height: placeholder[0].getBoundingClientRect().height,
|
|||
|
position: 'relative',
|
|||
|
top: 0,
|
|||
|
left: 0
|
|||
|
});
|
|||
|
|
|||
|
// Find ancestor with overflow: hidden; and remove it
|
|||
|
ancestorsChanged = undefined;
|
|||
|
ancestor = placeholder[0].parentNode;
|
|||
|
var count = 0;
|
|||
|
while (ancestor !== null && !$(ancestor).is(document)) {
|
|||
|
var curr = $(ancestor);
|
|||
|
if (curr.css('overflow') !== 'visible') {
|
|||
|
curr.css('overflow', 'visible');
|
|||
|
if (ancestorsChanged === undefined) {
|
|||
|
ancestorsChanged = curr;
|
|||
|
}
|
|||
|
else {
|
|||
|
ancestorsChanged = ancestorsChanged.add(curr);
|
|||
|
}
|
|||
|
}
|
|||
|
ancestor = ancestor.parentNode;
|
|||
|
}
|
|||
|
|
|||
|
// Set css on origin
|
|||
|
origin.css({
|
|||
|
position: 'absolute',
|
|||
|
'z-index': 1000,
|
|||
|
'will-change': 'left, top, width, height'
|
|||
|
})
|
|||
|
.data('width', originalWidth)
|
|||
|
.data('height', originalHeight);
|
|||
|
|
|||
|
// Add overlay
|
|||
|
var overlay = $('<div id="materialbox-overlay"></div>')
|
|||
|
.css({
|
|||
|
opacity: 0
|
|||
|
})
|
|||
|
.click(function(){
|
|||
|
if (doneAnimating === true)
|
|||
|
returnToOriginal();
|
|||
|
});
|
|||
|
|
|||
|
// Put before in origin image to preserve z-index layering.
|
|||
|
origin.before(overlay);
|
|||
|
|
|||
|
// Set dimensions if needed
|
|||
|
var overlayOffset = overlay[0].getBoundingClientRect();
|
|||
|
overlay.css({
|
|||
|
width: windowWidth,
|
|||
|
height: windowHeight,
|
|||
|
left: -1 * overlayOffset.left,
|
|||
|
top: -1 * overlayOffset.top
|
|||
|
})
|
|||
|
|
|||
|
// Animate Overlay
|
|||
|
overlay.velocity({opacity: 1},
|
|||
|
{duration: inDuration, queue: false, easing: 'easeOutQuad'} );
|
|||
|
|
|||
|
// Add and animate caption if it exists
|
|||
|
if (origin.data('caption') !== "") {
|
|||
|
var $photo_caption = $('<div class="materialbox-caption"></div>');
|
|||
|
$photo_caption.text(origin.data('caption'));
|
|||
|
$('body').append($photo_caption);
|
|||
|
$photo_caption.css({ "display": "inline" });
|
|||
|
$photo_caption.velocity({opacity: 1}, {duration: inDuration, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
// Resize Image
|
|||
|
var ratio = 0;
|
|||
|
var widthPercent = originalWidth / windowWidth;
|
|||
|
var heightPercent = originalHeight / windowHeight;
|
|||
|
var newWidth = 0;
|
|||
|
var newHeight = 0;
|
|||
|
|
|||
|
if (widthPercent > heightPercent) {
|
|||
|
ratio = originalHeight / originalWidth;
|
|||
|
newWidth = windowWidth * 0.9;
|
|||
|
newHeight = windowWidth * 0.9 * ratio;
|
|||
|
}
|
|||
|
else {
|
|||
|
ratio = originalWidth / originalHeight;
|
|||
|
newWidth = (windowHeight * 0.9) * ratio;
|
|||
|
newHeight = windowHeight * 0.9;
|
|||
|
}
|
|||
|
|
|||
|
// Animate image + set z-index
|
|||
|
if(origin.hasClass('responsive-img')) {
|
|||
|
origin.velocity({'max-width': newWidth, 'width': originalWidth}, {duration: 0, queue: false,
|
|||
|
complete: function(){
|
|||
|
origin.css({left: 0, top: 0})
|
|||
|
.velocity(
|
|||
|
{
|
|||
|
height: newHeight,
|
|||
|
width: newWidth,
|
|||
|
left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
|
|||
|
top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
|
|||
|
},
|
|||
|
{
|
|||
|
duration: inDuration,
|
|||
|
queue: false,
|
|||
|
easing: 'easeOutQuad',
|
|||
|
complete: function(){doneAnimating = true;}
|
|||
|
}
|
|||
|
);
|
|||
|
} // End Complete
|
|||
|
}); // End Velocity
|
|||
|
}
|
|||
|
else {
|
|||
|
origin.css('left', 0)
|
|||
|
.css('top', 0)
|
|||
|
.velocity(
|
|||
|
{
|
|||
|
height: newHeight,
|
|||
|
width: newWidth,
|
|||
|
left: $(document).scrollLeft() + windowWidth/2 - origin.parent('.material-placeholder').offset().left - newWidth/2,
|
|||
|
top: $(document).scrollTop() + windowHeight/2 - origin.parent('.material-placeholder').offset().top - newHeight/ 2
|
|||
|
},
|
|||
|
{
|
|||
|
duration: inDuration,
|
|||
|
queue: false,
|
|||
|
easing: 'easeOutQuad',
|
|||
|
complete: function(){doneAnimating = true;}
|
|||
|
}
|
|||
|
); // End Velocity
|
|||
|
}
|
|||
|
|
|||
|
}); // End origin on click
|
|||
|
|
|||
|
|
|||
|
// Return on scroll
|
|||
|
$(window).scroll(function() {
|
|||
|
if (overlayActive) {
|
|||
|
returnToOriginal();
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Return on ESC
|
|||
|
$(document).keyup(function(e) {
|
|||
|
|
|||
|
if (e.keyCode === 27 && doneAnimating === true) { // ESC key
|
|||
|
if (overlayActive) {
|
|||
|
returnToOriginal();
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
// This function returns the modaled image to the original spot
|
|||
|
function returnToOriginal() {
|
|||
|
|
|||
|
doneAnimating = false;
|
|||
|
|
|||
|
var placeholder = origin.parent('.material-placeholder');
|
|||
|
var windowWidth = window.innerWidth;
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var originalWidth = origin.data('width');
|
|||
|
var originalHeight = origin.data('height');
|
|||
|
|
|||
|
origin.velocity("stop", true);
|
|||
|
$('#materialbox-overlay').velocity("stop", true);
|
|||
|
$('.materialbox-caption').velocity("stop", true);
|
|||
|
|
|||
|
|
|||
|
$('#materialbox-overlay').velocity({opacity: 0}, {
|
|||
|
duration: outDuration, // Delay prevents animation overlapping
|
|||
|
queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function(){
|
|||
|
// Remove Overlay
|
|||
|
overlayActive = false;
|
|||
|
$(this).remove();
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Resize Image
|
|||
|
origin.velocity(
|
|||
|
{
|
|||
|
width: originalWidth,
|
|||
|
height: originalHeight,
|
|||
|
left: 0,
|
|||
|
top: 0
|
|||
|
},
|
|||
|
{
|
|||
|
duration: outDuration,
|
|||
|
queue: false, easing: 'easeOutQuad'
|
|||
|
}
|
|||
|
);
|
|||
|
|
|||
|
// Remove Caption + reset css settings on image
|
|||
|
$('.materialbox-caption').velocity({opacity: 0}, {
|
|||
|
duration: outDuration, // Delay prevents animation overlapping
|
|||
|
queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function(){
|
|||
|
placeholder.css({
|
|||
|
height: '',
|
|||
|
width: '',
|
|||
|
position: '',
|
|||
|
top: '',
|
|||
|
left: ''
|
|||
|
});
|
|||
|
|
|||
|
origin.css({
|
|||
|
height: '',
|
|||
|
top: '',
|
|||
|
left: '',
|
|||
|
width: '',
|
|||
|
'max-width': '',
|
|||
|
position: '',
|
|||
|
'z-index': '',
|
|||
|
'will-change': ''
|
|||
|
});
|
|||
|
|
|||
|
// Remove class
|
|||
|
origin.removeClass('active');
|
|||
|
doneAnimating = true;
|
|||
|
$(this).remove();
|
|||
|
|
|||
|
// Remove overflow overrides on ancestors
|
|||
|
if (ancestorsChanged) {
|
|||
|
ancestorsChanged.css('overflow', '');
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
}
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('.materialboxed').materialbox();
|
|||
|
});
|
|||
|
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
$.fn.parallax = function () {
|
|||
|
var window_width = $(window).width();
|
|||
|
// Parallax Scripts
|
|||
|
return this.each(function(i) {
|
|||
|
var $this = $(this);
|
|||
|
$this.addClass('parallax');
|
|||
|
|
|||
|
function updateParallax(initial) {
|
|||
|
var container_height;
|
|||
|
if (window_width < 601) {
|
|||
|
container_height = ($this.height() > 0) ? $this.height() : $this.children("img").height();
|
|||
|
}
|
|||
|
else {
|
|||
|
container_height = ($this.height() > 0) ? $this.height() : 500;
|
|||
|
}
|
|||
|
var $img = $this.children("img").first();
|
|||
|
var img_height = $img.height();
|
|||
|
var parallax_dist = img_height - container_height;
|
|||
|
var bottom = $this.offset().top + container_height;
|
|||
|
var top = $this.offset().top;
|
|||
|
var scrollTop = $(window).scrollTop();
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var windowBottom = scrollTop + windowHeight;
|
|||
|
var percentScrolled = (windowBottom - top) / (container_height + windowHeight);
|
|||
|
var parallax = Math.round((parallax_dist * percentScrolled));
|
|||
|
|
|||
|
if (initial) {
|
|||
|
$img.css('display', 'block');
|
|||
|
}
|
|||
|
if ((bottom > scrollTop) && (top < (scrollTop + windowHeight))) {
|
|||
|
$img.css('transform', "translate3D(-50%," + parallax + "px, 0)");
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
// Wait for image load
|
|||
|
$this.children("img").one("load", function() {
|
|||
|
updateParallax(true);
|
|||
|
}).each(function() {
|
|||
|
if (this.complete) $(this).trigger("load");
|
|||
|
});
|
|||
|
|
|||
|
$(window).scroll(function() {
|
|||
|
window_width = $(window).width();
|
|||
|
updateParallax(false);
|
|||
|
});
|
|||
|
|
|||
|
$(window).resize(function() {
|
|||
|
window_width = $(window).width();
|
|||
|
updateParallax(false);
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
};
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
var methods = {
|
|||
|
init : function(options) {
|
|||
|
var defaults = {
|
|||
|
onShow: null,
|
|||
|
swipeable: false,
|
|||
|
responsiveThreshold: Infinity, // breakpoint for swipeable
|
|||
|
};
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
|
|||
|
// For each set of tabs, we want to keep track of
|
|||
|
// which tab is active and its associated content
|
|||
|
var $this = $(this),
|
|||
|
window_width = $(window).width();
|
|||
|
|
|||
|
var $active, $content, $links = $this.find('li.tab a'),
|
|||
|
$tabs_width = $this.width(),
|
|||
|
$tabs_content = $(),
|
|||
|
$tabs_wrapper,
|
|||
|
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length,
|
|||
|
$indicator,
|
|||
|
index = prev_index = 0,
|
|||
|
clicked = false,
|
|||
|
clickedTimeout,
|
|||
|
transition = 300;
|
|||
|
|
|||
|
|
|||
|
// Finds right attribute for indicator based on active tab.
|
|||
|
// el: jQuery Object
|
|||
|
var calcRightPos = function(el) {
|
|||
|
return $tabs_width - el.position().left - el.outerWidth() - $this.scrollLeft();
|
|||
|
};
|
|||
|
|
|||
|
// Finds left attribute for indicator based on active tab.
|
|||
|
// el: jQuery Object
|
|||
|
var calcLeftPos = function(el) {
|
|||
|
return el.position().left + $this.scrollLeft();
|
|||
|
};
|
|||
|
|
|||
|
// Animates Indicator to active tab.
|
|||
|
// prev_index: Number
|
|||
|
var animateIndicator = function(prev_index) {
|
|||
|
if ((index - prev_index) >= 0) {
|
|||
|
$indicator.velocity({"right": calcRightPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
$indicator.velocity({"left": calcLeftPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
|
|||
|
|
|||
|
} else {
|
|||
|
$indicator.velocity({"left": calcLeftPos($active) }, { duration: transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
$indicator.velocity({"right": calcRightPos($active) }, {duration: transition, queue: false, easing: 'easeOutQuad', delay: 90});
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
// Change swipeable according to responsive threshold
|
|||
|
if (options.swipeable) {
|
|||
|
if (window_width > options.responsiveThreshold) {
|
|||
|
options.swipeable = false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// If the location.hash matches one of the links, use that as the active tab.
|
|||
|
$active = $($links.filter('[href="'+location.hash+'"]'));
|
|||
|
|
|||
|
// If no match is found, use the first link or any with class 'active' as the initial active tab.
|
|||
|
if ($active.length === 0) {
|
|||
|
$active = $(this).find('li.tab a.active').first();
|
|||
|
}
|
|||
|
if ($active.length === 0) {
|
|||
|
$active = $(this).find('li.tab a').first();
|
|||
|
}
|
|||
|
|
|||
|
$active.addClass('active');
|
|||
|
index = $links.index($active);
|
|||
|
if (index < 0) {
|
|||
|
index = 0;
|
|||
|
}
|
|||
|
|
|||
|
if ($active[0] !== undefined) {
|
|||
|
$content = $($active[0].hash);
|
|||
|
$content.addClass('active');
|
|||
|
}
|
|||
|
|
|||
|
// append indicator then set indicator width to tab width
|
|||
|
if (!$this.find('.indicator').length) {
|
|||
|
$this.append('<div class="indicator"></div>');
|
|||
|
}
|
|||
|
$indicator = $this.find('.indicator');
|
|||
|
|
|||
|
// we make sure that the indicator is at the end of the tabs
|
|||
|
$this.append($indicator);
|
|||
|
|
|||
|
if ($this.is(":visible")) {
|
|||
|
// $indicator.css({"right": $tabs_width - ((index + 1) * $tab_width)});
|
|||
|
// $indicator.css({"left": index * $tab_width});
|
|||
|
setTimeout(function() {
|
|||
|
$indicator.css({"right": calcRightPos($active) });
|
|||
|
$indicator.css({"left": calcLeftPos($active) });
|
|||
|
}, 0);
|
|||
|
}
|
|||
|
$(window).resize(function () {
|
|||
|
$tabs_width = $this.width();
|
|||
|
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
|||
|
if (index < 0) {
|
|||
|
index = 0;
|
|||
|
}
|
|||
|
if ($tab_width !== 0 && $tabs_width !== 0) {
|
|||
|
$indicator.css({"right": calcRightPos($active) });
|
|||
|
$indicator.css({"left": calcLeftPos($active) });
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Initialize Tabs Content.
|
|||
|
if (options.swipeable) {
|
|||
|
// TODO: Duplicate calls with swipeable? handle multiple div wrapping.
|
|||
|
$links.each(function () {
|
|||
|
var $curr_content = $(Materialize.escapeHash(this.hash));
|
|||
|
$curr_content.addClass('carousel-item');
|
|||
|
$tabs_content = $tabs_content.add($curr_content);
|
|||
|
});
|
|||
|
$tabs_wrapper = $tabs_content.wrapAll('<div class="tabs-content carousel"></div>');
|
|||
|
$tabs_content.css('display', '');
|
|||
|
$('.tabs-content.carousel').carousel({
|
|||
|
fullWidth: true,
|
|||
|
noWrap: true,
|
|||
|
onCycleTo: function(item) {
|
|||
|
if (!clicked) {
|
|||
|
var prev_index = index;
|
|||
|
index = $tabs_wrapper.index(item);
|
|||
|
$active = $links.eq(index);
|
|||
|
animateIndicator(prev_index);
|
|||
|
}
|
|||
|
},
|
|||
|
});
|
|||
|
} else {
|
|||
|
// Hide the remaining content
|
|||
|
$links.not($active).each(function () {
|
|||
|
$(Materialize.escapeHash(this.hash)).hide();
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Bind the click event handler
|
|||
|
$this.on('click', 'a', function(e) {
|
|||
|
if ($(this).parent().hasClass('disabled')) {
|
|||
|
e.preventDefault();
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// Act as regular link if target attribute is specified.
|
|||
|
if (!!$(this).attr("target")) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
clicked = true;
|
|||
|
$tabs_width = $this.width();
|
|||
|
$tab_width = Math.max($tabs_width, $this[0].scrollWidth) / $links.length;
|
|||
|
|
|||
|
// Make the old tab inactive.
|
|||
|
$active.removeClass('active');
|
|||
|
var $oldContent = $content
|
|||
|
|
|||
|
// Update the variables with the new link and content
|
|||
|
$active = $(this);
|
|||
|
$content = $(Materialize.escapeHash(this.hash));
|
|||
|
$links = $this.find('li.tab a');
|
|||
|
var activeRect = $active.position();
|
|||
|
|
|||
|
// Make the tab active.
|
|||
|
$active.addClass('active');
|
|||
|
prev_index = index;
|
|||
|
index = $links.index($(this));
|
|||
|
if (index < 0) {
|
|||
|
index = 0;
|
|||
|
}
|
|||
|
// Change url to current tab
|
|||
|
// window.location.hash = $active.attr('href');
|
|||
|
|
|||
|
// Swap content
|
|||
|
if (options.swipeable) {
|
|||
|
if ($tabs_content.length) {
|
|||
|
$tabs_content.carousel('set', index);
|
|||
|
}
|
|||
|
} else {
|
|||
|
if ($content !== undefined) {
|
|||
|
$content.show();
|
|||
|
$content.addClass('active');
|
|||
|
if (typeof(options.onShow) === "function") {
|
|||
|
options.onShow.call(this, $content);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if ($oldContent !== undefined &&
|
|||
|
!$oldContent.is($content)) {
|
|||
|
$oldContent.hide();
|
|||
|
$oldContent.removeClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Reset clicked state
|
|||
|
clickedTimeout = setTimeout(function(){ clicked = false; }, transition);
|
|||
|
|
|||
|
// Update indicator
|
|||
|
animateIndicator(prev_index);
|
|||
|
|
|||
|
// Prevent the anchor's default click action
|
|||
|
e.preventDefault();
|
|||
|
});
|
|||
|
});
|
|||
|
|
|||
|
},
|
|||
|
select_tab : function( id ) {
|
|||
|
this.find('a[href="#' + id + '"]').trigger('click');
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
$.fn.tabs = function(methodOrOptions) {
|
|||
|
if ( methods[methodOrOptions] ) {
|
|||
|
return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
|||
|
} else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
|
|||
|
// Default to "init"
|
|||
|
return methods.init.apply( this, arguments );
|
|||
|
} else {
|
|||
|
$.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tabs' );
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('ul.tabs').tabs();
|
|||
|
});
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
$.fn.tooltip = function (options) {
|
|||
|
var timeout = null,
|
|||
|
margin = 5;
|
|||
|
|
|||
|
// Defaults
|
|||
|
var defaults = {
|
|||
|
delay: 350,
|
|||
|
tooltip: '',
|
|||
|
position: 'bottom',
|
|||
|
html: false
|
|||
|
};
|
|||
|
|
|||
|
// Remove tooltip from the activator
|
|||
|
if (options === "remove") {
|
|||
|
this.each(function() {
|
|||
|
$('#' + $(this).attr('data-tooltip-id')).remove();
|
|||
|
$(this).off('mouseenter.tooltip mouseleave.tooltip');
|
|||
|
});
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
var tooltipId = Materialize.guid();
|
|||
|
var origin = $(this);
|
|||
|
|
|||
|
// Destroy old tooltip
|
|||
|
if (origin.attr('data-tooltip-id')) {
|
|||
|
$('#' + origin.attr('data-tooltip-id')).remove();
|
|||
|
}
|
|||
|
|
|||
|
origin.attr('data-tooltip-id', tooltipId);
|
|||
|
|
|||
|
// Get attributes.
|
|||
|
var allowHtml,
|
|||
|
tooltipDelay,
|
|||
|
tooltipPosition,
|
|||
|
tooltipText,
|
|||
|
tooltipEl,
|
|||
|
backdrop;
|
|||
|
var setAttributes = function() {
|
|||
|
allowHtml = origin.attr('data-html') ? origin.attr('data-html') === 'true' : options.html;
|
|||
|
tooltipDelay = origin.attr('data-delay');
|
|||
|
tooltipDelay = (tooltipDelay === undefined || tooltipDelay === '') ?
|
|||
|
options.delay : tooltipDelay;
|
|||
|
tooltipPosition = origin.attr('data-position');
|
|||
|
tooltipPosition = (tooltipPosition === undefined || tooltipPosition === '') ?
|
|||
|
options.position : tooltipPosition;
|
|||
|
tooltipText = origin.attr('data-tooltip');
|
|||
|
tooltipText = (tooltipText === undefined || tooltipText === '') ?
|
|||
|
options.tooltip : tooltipText;
|
|||
|
};
|
|||
|
setAttributes();
|
|||
|
|
|||
|
var renderTooltipEl = function() {
|
|||
|
var tooltip = $('<div class="material-tooltip"></div>');
|
|||
|
|
|||
|
// Create Text span
|
|||
|
if (allowHtml) {
|
|||
|
tooltipText = $('<span></span>').html(tooltipText);
|
|||
|
} else{
|
|||
|
tooltipText = $('<span></span>').text(tooltipText);
|
|||
|
}
|
|||
|
|
|||
|
// Create tooltip
|
|||
|
tooltip.append(tooltipText)
|
|||
|
.appendTo($('body'))
|
|||
|
.attr('id', tooltipId);
|
|||
|
|
|||
|
// Create backdrop
|
|||
|
backdrop = $('<div class="backdrop"></div>');
|
|||
|
backdrop.appendTo(tooltip);
|
|||
|
return tooltip;
|
|||
|
};
|
|||
|
tooltipEl = renderTooltipEl();
|
|||
|
|
|||
|
// Destroy previously binded events
|
|||
|
origin.off('mouseenter.tooltip mouseleave.tooltip');
|
|||
|
// Mouse In
|
|||
|
var started = false, timeoutRef;
|
|||
|
origin.on({'mouseenter.tooltip': function(e) {
|
|||
|
var showTooltip = function() {
|
|||
|
setAttributes();
|
|||
|
started = true;
|
|||
|
tooltipEl.velocity('stop');
|
|||
|
backdrop.velocity('stop');
|
|||
|
tooltipEl.css({ visibility: 'visible', left: '0px', top: '0px' });
|
|||
|
|
|||
|
// Tooltip positioning
|
|||
|
var originWidth = origin.outerWidth();
|
|||
|
var originHeight = origin.outerHeight();
|
|||
|
var tooltipHeight = tooltipEl.outerHeight();
|
|||
|
var tooltipWidth = tooltipEl.outerWidth();
|
|||
|
var tooltipVerticalMovement = '0px';
|
|||
|
var tooltipHorizontalMovement = '0px';
|
|||
|
var backdropOffsetWidth = backdrop[0].offsetWidth;
|
|||
|
var backdropOffsetHeight = backdrop[0].offsetHeight;
|
|||
|
var scaleXFactor = 8;
|
|||
|
var scaleYFactor = 8;
|
|||
|
var scaleFactor = 0;
|
|||
|
var targetTop, targetLeft, newCoordinates;
|
|||
|
|
|||
|
if (tooltipPosition === "top") {
|
|||
|
// Top Position
|
|||
|
targetTop = origin.offset().top - tooltipHeight - margin;
|
|||
|
targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
|
|||
|
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|||
|
tooltipVerticalMovement = '-10px';
|
|||
|
backdrop.css({
|
|||
|
bottom: 0,
|
|||
|
left: 0,
|
|||
|
borderRadius: '14px 14px 0 0',
|
|||
|
transformOrigin: '50% 100%',
|
|||
|
marginTop: tooltipHeight,
|
|||
|
marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
|
|||
|
});
|
|||
|
}
|
|||
|
// Left Position
|
|||
|
else if (tooltipPosition === "left") {
|
|||
|
targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
|
|||
|
targetLeft = origin.offset().left - tooltipWidth - margin;
|
|||
|
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|||
|
|
|||
|
tooltipHorizontalMovement = '-10px';
|
|||
|
backdrop.css({
|
|||
|
top: '-7px',
|
|||
|
right: 0,
|
|||
|
width: '14px',
|
|||
|
height: '14px',
|
|||
|
borderRadius: '14px 0 0 14px',
|
|||
|
transformOrigin: '95% 50%',
|
|||
|
marginTop: tooltipHeight/2,
|
|||
|
marginLeft: tooltipWidth
|
|||
|
});
|
|||
|
}
|
|||
|
// Right Position
|
|||
|
else if (tooltipPosition === "right") {
|
|||
|
targetTop = origin.offset().top + originHeight/2 - tooltipHeight/2;
|
|||
|
targetLeft = origin.offset().left + originWidth + margin;
|
|||
|
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|||
|
|
|||
|
tooltipHorizontalMovement = '+10px';
|
|||
|
backdrop.css({
|
|||
|
top: '-7px',
|
|||
|
left: 0,
|
|||
|
width: '14px',
|
|||
|
height: '14px',
|
|||
|
borderRadius: '0 14px 14px 0',
|
|||
|
transformOrigin: '5% 50%',
|
|||
|
marginTop: tooltipHeight/2,
|
|||
|
marginLeft: '0px'
|
|||
|
});
|
|||
|
}
|
|||
|
else {
|
|||
|
// Bottom Position
|
|||
|
targetTop = origin.offset().top + origin.outerHeight() + margin;
|
|||
|
targetLeft = origin.offset().left + originWidth/2 - tooltipWidth/2;
|
|||
|
newCoordinates = repositionWithinScreen(targetLeft, targetTop, tooltipWidth, tooltipHeight);
|
|||
|
tooltipVerticalMovement = '+10px';
|
|||
|
backdrop.css({
|
|||
|
top: 0,
|
|||
|
left: 0,
|
|||
|
marginLeft: (tooltipWidth/2) - (backdropOffsetWidth/2)
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
// Set tooptip css placement
|
|||
|
tooltipEl.css({
|
|||
|
top: newCoordinates.y,
|
|||
|
left: newCoordinates.x
|
|||
|
});
|
|||
|
|
|||
|
// Calculate Scale to fill
|
|||
|
scaleXFactor = Math.SQRT2 * tooltipWidth / parseInt(backdropOffsetWidth);
|
|||
|
scaleYFactor = Math.SQRT2 * tooltipHeight / parseInt(backdropOffsetHeight);
|
|||
|
scaleFactor = Math.max(scaleXFactor, scaleYFactor);
|
|||
|
|
|||
|
tooltipEl.velocity({ translateY: tooltipVerticalMovement, translateX: tooltipHorizontalMovement}, { duration: 350, queue: false })
|
|||
|
.velocity({opacity: 1}, {duration: 300, delay: 50, queue: false});
|
|||
|
backdrop.css({ visibility: 'visible' })
|
|||
|
.velocity({opacity:1},{duration: 55, delay: 0, queue: false})
|
|||
|
.velocity({scaleX: scaleFactor, scaleY: scaleFactor}, {duration: 300, delay: 0, queue: false, easing: 'easeInOutQuad'});
|
|||
|
};
|
|||
|
|
|||
|
timeoutRef = setTimeout(showTooltip, tooltipDelay); // End Interval
|
|||
|
|
|||
|
// Mouse Out
|
|||
|
},
|
|||
|
'mouseleave.tooltip': function(){
|
|||
|
// Reset State
|
|||
|
started = false;
|
|||
|
clearTimeout(timeoutRef);
|
|||
|
|
|||
|
// Animate back
|
|||
|
setTimeout(function() {
|
|||
|
if (started !== true) {
|
|||
|
tooltipEl.velocity({
|
|||
|
opacity: 0, translateY: 0, translateX: 0}, { duration: 225, queue: false});
|
|||
|
backdrop.velocity({opacity: 0, scaleX: 1, scaleY: 1}, {
|
|||
|
duration:225,
|
|||
|
queue: false,
|
|||
|
complete: function(){
|
|||
|
backdrop.css({ visibility: 'hidden' });
|
|||
|
tooltipEl.css({ visibility: 'hidden' });
|
|||
|
started = false;}
|
|||
|
});
|
|||
|
}
|
|||
|
},225);
|
|||
|
}
|
|||
|
});
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
var repositionWithinScreen = function(x, y, width, height) {
|
|||
|
var newX = x;
|
|||
|
var newY = y;
|
|||
|
|
|||
|
if (newX < 0) {
|
|||
|
newX = 4;
|
|||
|
} else if (newX + width > window.innerWidth) {
|
|||
|
newX -= newX + width - window.innerWidth;
|
|||
|
}
|
|||
|
|
|||
|
if (newY < 0) {
|
|||
|
newY = 4;
|
|||
|
} else if (newY + height > window.innerHeight + $(window).scrollTop) {
|
|||
|
newY -= newY + height - window.innerHeight;
|
|||
|
}
|
|||
|
|
|||
|
return {x: newX, y: newY};
|
|||
|
};
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('.tooltipped').tooltip();
|
|||
|
});
|
|||
|
}( jQuery ));
|
|||
|
;/*!
|
|||
|
* Waves v0.6.4
|
|||
|
* http://fian.my.id/Waves
|
|||
|
*
|
|||
|
* Copyright 2014 Alfiana E. Sibuea and other contributors
|
|||
|
* Released under the MIT license
|
|||
|
* https://github.com/fians/Waves/blob/master/LICENSE
|
|||
|
*/
|
|||
|
|
|||
|
;(function(window) {
|
|||
|
'use strict';
|
|||
|
|
|||
|
var Waves = Waves || {};
|
|||
|
var $$ = document.querySelectorAll.bind(document);
|
|||
|
|
|||
|
// Find exact position of element
|
|||
|
function isWindow(obj) {
|
|||
|
return obj !== null && obj === obj.window;
|
|||
|
}
|
|||
|
|
|||
|
function getWindow(elem) {
|
|||
|
return isWindow(elem) ? elem : elem.nodeType === 9 && elem.defaultView;
|
|||
|
}
|
|||
|
|
|||
|
function offset(elem) {
|
|||
|
var docElem, win,
|
|||
|
box = {top: 0, left: 0},
|
|||
|
doc = elem && elem.ownerDocument;
|
|||
|
|
|||
|
docElem = doc.documentElement;
|
|||
|
|
|||
|
if (typeof elem.getBoundingClientRect !== typeof undefined) {
|
|||
|
box = elem.getBoundingClientRect();
|
|||
|
}
|
|||
|
win = getWindow(doc);
|
|||
|
return {
|
|||
|
top: box.top + win.pageYOffset - docElem.clientTop,
|
|||
|
left: box.left + win.pageXOffset - docElem.clientLeft
|
|||
|
};
|
|||
|
}
|
|||
|
|
|||
|
function convertStyle(obj) {
|
|||
|
var style = '';
|
|||
|
|
|||
|
for (var a in obj) {
|
|||
|
if (obj.hasOwnProperty(a)) {
|
|||
|
style += (a + ':' + obj[a] + ';');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
return style;
|
|||
|
}
|
|||
|
|
|||
|
var Effect = {
|
|||
|
|
|||
|
// Effect delay
|
|||
|
duration: 750,
|
|||
|
|
|||
|
show: function(e, element) {
|
|||
|
|
|||
|
// Disable right click
|
|||
|
if (e.button === 2) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
var el = element || this;
|
|||
|
|
|||
|
// Create ripple
|
|||
|
var ripple = document.createElement('div');
|
|||
|
ripple.className = 'waves-ripple';
|
|||
|
el.appendChild(ripple);
|
|||
|
|
|||
|
// Get click coordinate and element witdh
|
|||
|
var pos = offset(el);
|
|||
|
var relativeY = (e.pageY - pos.top);
|
|||
|
var relativeX = (e.pageX - pos.left);
|
|||
|
var scale = 'scale('+((el.clientWidth / 100) * 10)+')';
|
|||
|
|
|||
|
// Support for touch devices
|
|||
|
if ('touches' in e) {
|
|||
|
relativeY = (e.touches[0].pageY - pos.top);
|
|||
|
relativeX = (e.touches[0].pageX - pos.left);
|
|||
|
}
|
|||
|
|
|||
|
// Attach data to element
|
|||
|
ripple.setAttribute('data-hold', Date.now());
|
|||
|
ripple.setAttribute('data-scale', scale);
|
|||
|
ripple.setAttribute('data-x', relativeX);
|
|||
|
ripple.setAttribute('data-y', relativeY);
|
|||
|
|
|||
|
// Set ripple position
|
|||
|
var rippleStyle = {
|
|||
|
'top': relativeY+'px',
|
|||
|
'left': relativeX+'px'
|
|||
|
};
|
|||
|
|
|||
|
ripple.className = ripple.className + ' waves-notransition';
|
|||
|
ripple.setAttribute('style', convertStyle(rippleStyle));
|
|||
|
ripple.className = ripple.className.replace('waves-notransition', '');
|
|||
|
|
|||
|
// Scale the ripple
|
|||
|
rippleStyle['-webkit-transform'] = scale;
|
|||
|
rippleStyle['-moz-transform'] = scale;
|
|||
|
rippleStyle['-ms-transform'] = scale;
|
|||
|
rippleStyle['-o-transform'] = scale;
|
|||
|
rippleStyle.transform = scale;
|
|||
|
rippleStyle.opacity = '1';
|
|||
|
|
|||
|
rippleStyle['-webkit-transition-duration'] = Effect.duration + 'ms';
|
|||
|
rippleStyle['-moz-transition-duration'] = Effect.duration + 'ms';
|
|||
|
rippleStyle['-o-transition-duration'] = Effect.duration + 'ms';
|
|||
|
rippleStyle['transition-duration'] = Effect.duration + 'ms';
|
|||
|
|
|||
|
rippleStyle['-webkit-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|||
|
rippleStyle['-moz-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|||
|
rippleStyle['-o-transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|||
|
rippleStyle['transition-timing-function'] = 'cubic-bezier(0.250, 0.460, 0.450, 0.940)';
|
|||
|
|
|||
|
ripple.setAttribute('style', convertStyle(rippleStyle));
|
|||
|
},
|
|||
|
|
|||
|
hide: function(e) {
|
|||
|
TouchHandler.touchup(e);
|
|||
|
|
|||
|
var el = this;
|
|||
|
var width = el.clientWidth * 1.4;
|
|||
|
|
|||
|
// Get first ripple
|
|||
|
var ripple = null;
|
|||
|
var ripples = el.getElementsByClassName('waves-ripple');
|
|||
|
if (ripples.length > 0) {
|
|||
|
ripple = ripples[ripples.length - 1];
|
|||
|
} else {
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
var relativeX = ripple.getAttribute('data-x');
|
|||
|
var relativeY = ripple.getAttribute('data-y');
|
|||
|
var scale = ripple.getAttribute('data-scale');
|
|||
|
|
|||
|
// Get delay beetween mousedown and mouse leave
|
|||
|
var diff = Date.now() - Number(ripple.getAttribute('data-hold'));
|
|||
|
var delay = 350 - diff;
|
|||
|
|
|||
|
if (delay < 0) {
|
|||
|
delay = 0;
|
|||
|
}
|
|||
|
|
|||
|
// Fade out ripple after delay
|
|||
|
setTimeout(function() {
|
|||
|
var style = {
|
|||
|
'top': relativeY+'px',
|
|||
|
'left': relativeX+'px',
|
|||
|
'opacity': '0',
|
|||
|
|
|||
|
// Duration
|
|||
|
'-webkit-transition-duration': Effect.duration + 'ms',
|
|||
|
'-moz-transition-duration': Effect.duration + 'ms',
|
|||
|
'-o-transition-duration': Effect.duration + 'ms',
|
|||
|
'transition-duration': Effect.duration + 'ms',
|
|||
|
'-webkit-transform': scale,
|
|||
|
'-moz-transform': scale,
|
|||
|
'-ms-transform': scale,
|
|||
|
'-o-transform': scale,
|
|||
|
'transform': scale,
|
|||
|
};
|
|||
|
|
|||
|
ripple.setAttribute('style', convertStyle(style));
|
|||
|
|
|||
|
setTimeout(function() {
|
|||
|
try {
|
|||
|
el.removeChild(ripple);
|
|||
|
} catch(e) {
|
|||
|
return false;
|
|||
|
}
|
|||
|
}, Effect.duration);
|
|||
|
}, delay);
|
|||
|
},
|
|||
|
|
|||
|
// Little hack to make <input> can perform waves effect
|
|||
|
wrapInput: function(elements) {
|
|||
|
for (var a = 0; a < elements.length; a++) {
|
|||
|
var el = elements[a];
|
|||
|
|
|||
|
if (el.tagName.toLowerCase() === 'input') {
|
|||
|
var parent = el.parentNode;
|
|||
|
|
|||
|
// If input already have parent just pass through
|
|||
|
if (parent.tagName.toLowerCase() === 'i' && parent.className.indexOf('waves-effect') !== -1) {
|
|||
|
continue;
|
|||
|
}
|
|||
|
|
|||
|
// Put element class and style to the specified parent
|
|||
|
var wrapper = document.createElement('i');
|
|||
|
wrapper.className = el.className + ' waves-input-wrapper';
|
|||
|
|
|||
|
var elementStyle = el.getAttribute('style');
|
|||
|
|
|||
|
if (!elementStyle) {
|
|||
|
elementStyle = '';
|
|||
|
}
|
|||
|
|
|||
|
wrapper.setAttribute('style', elementStyle);
|
|||
|
|
|||
|
el.className = 'waves-button-input';
|
|||
|
el.removeAttribute('style');
|
|||
|
|
|||
|
// Put element as child
|
|||
|
parent.replaceChild(wrapper, el);
|
|||
|
wrapper.appendChild(el);
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Disable mousedown event for 500ms during and after touch
|
|||
|
*/
|
|||
|
var TouchHandler = {
|
|||
|
/* uses an integer rather than bool so there's no issues with
|
|||
|
* needing to clear timeouts if another touch event occurred
|
|||
|
* within the 500ms. Cannot mouseup between touchstart and
|
|||
|
* touchend, nor in the 500ms after touchend. */
|
|||
|
touches: 0,
|
|||
|
allowEvent: function(e) {
|
|||
|
var allow = true;
|
|||
|
|
|||
|
if (e.type === 'touchstart') {
|
|||
|
TouchHandler.touches += 1; //push
|
|||
|
} else if (e.type === 'touchend' || e.type === 'touchcancel') {
|
|||
|
setTimeout(function() {
|
|||
|
if (TouchHandler.touches > 0) {
|
|||
|
TouchHandler.touches -= 1; //pop after 500ms
|
|||
|
}
|
|||
|
}, 500);
|
|||
|
} else if (e.type === 'mousedown' && TouchHandler.touches > 0) {
|
|||
|
allow = false;
|
|||
|
}
|
|||
|
|
|||
|
return allow;
|
|||
|
},
|
|||
|
touchup: function(e) {
|
|||
|
TouchHandler.allowEvent(e);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Delegated click handler for .waves-effect element.
|
|||
|
* returns null when .waves-effect element not in "click tree"
|
|||
|
*/
|
|||
|
function getWavesEffectElement(e) {
|
|||
|
if (TouchHandler.allowEvent(e) === false) {
|
|||
|
return null;
|
|||
|
}
|
|||
|
|
|||
|
var element = null;
|
|||
|
var target = e.target || e.srcElement;
|
|||
|
|
|||
|
while (target.parentElement !== null) {
|
|||
|
if (!(target instanceof SVGElement) && target.className.indexOf('waves-effect') !== -1) {
|
|||
|
element = target;
|
|||
|
break;
|
|||
|
} else if (target.classList.contains('waves-effect')) {
|
|||
|
element = target;
|
|||
|
break;
|
|||
|
}
|
|||
|
target = target.parentElement;
|
|||
|
}
|
|||
|
|
|||
|
return element;
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Bubble the click and show effect if .waves-effect elem was found
|
|||
|
*/
|
|||
|
function showEffect(e) {
|
|||
|
var element = getWavesEffectElement(e);
|
|||
|
|
|||
|
if (element !== null) {
|
|||
|
Effect.show(e, element);
|
|||
|
|
|||
|
if ('ontouchstart' in window) {
|
|||
|
element.addEventListener('touchend', Effect.hide, false);
|
|||
|
element.addEventListener('touchcancel', Effect.hide, false);
|
|||
|
}
|
|||
|
|
|||
|
element.addEventListener('mouseup', Effect.hide, false);
|
|||
|
element.addEventListener('mouseleave', Effect.hide, false);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
Waves.displayEffect = function(options) {
|
|||
|
options = options || {};
|
|||
|
|
|||
|
if ('duration' in options) {
|
|||
|
Effect.duration = options.duration;
|
|||
|
}
|
|||
|
|
|||
|
//Wrap input inside <i> tag
|
|||
|
Effect.wrapInput($$('.waves-effect'));
|
|||
|
|
|||
|
if ('ontouchstart' in window) {
|
|||
|
document.body.addEventListener('touchstart', showEffect, false);
|
|||
|
}
|
|||
|
|
|||
|
document.body.addEventListener('mousedown', showEffect, false);
|
|||
|
};
|
|||
|
|
|||
|
/**
|
|||
|
* Attach Waves to an input element (or any element which doesn't
|
|||
|
* bubble mouseup/mousedown events).
|
|||
|
* Intended to be used with dynamically loaded forms/inputs, or
|
|||
|
* where the user doesn't want a delegated click handler.
|
|||
|
*/
|
|||
|
Waves.attach = function(element) {
|
|||
|
//FUTURE: automatically add waves classes and allow users
|
|||
|
// to specify them with an options param? Eg. light/classic/button
|
|||
|
if (element.tagName.toLowerCase() === 'input') {
|
|||
|
Effect.wrapInput([element]);
|
|||
|
element = element.parentElement;
|
|||
|
}
|
|||
|
|
|||
|
if ('ontouchstart' in window) {
|
|||
|
element.addEventListener('touchstart', showEffect, false);
|
|||
|
}
|
|||
|
|
|||
|
element.addEventListener('mousedown', showEffect, false);
|
|||
|
};
|
|||
|
|
|||
|
window.Waves = Waves;
|
|||
|
|
|||
|
document.addEventListener('DOMContentLoaded', function() {
|
|||
|
Waves.displayEffect();
|
|||
|
}, false);
|
|||
|
|
|||
|
})(window);
|
|||
|
;Materialize.toast = function (message, displayLength, className, completeCallback) {
|
|||
|
className = className || "";
|
|||
|
|
|||
|
var container = document.getElementById('toast-container');
|
|||
|
|
|||
|
// Create toast container if it does not exist
|
|||
|
if (container === null) {
|
|||
|
// create notification container
|
|||
|
container = document.createElement('div');
|
|||
|
container.id = 'toast-container';
|
|||
|
document.body.appendChild(container);
|
|||
|
}
|
|||
|
|
|||
|
// Select and append toast
|
|||
|
var newToast = createToast(message);
|
|||
|
|
|||
|
// only append toast if message is not undefined
|
|||
|
if(message){
|
|||
|
container.appendChild(newToast);
|
|||
|
}
|
|||
|
|
|||
|
newToast.style.opacity = 0;
|
|||
|
|
|||
|
// Animate toast in
|
|||
|
Vel(newToast, {translateY: '-35px', opacity: 1 }, {duration: 300,
|
|||
|
easing: 'easeOutCubic',
|
|||
|
queue: false});
|
|||
|
|
|||
|
// Allows timer to be pause while being panned
|
|||
|
var timeLeft = displayLength;
|
|||
|
var counterInterval;
|
|||
|
if (timeLeft != null) {
|
|||
|
counterInterval = setInterval (function(){
|
|||
|
if (newToast.parentNode === null)
|
|||
|
window.clearInterval(counterInterval);
|
|||
|
|
|||
|
// If toast is not being dragged, decrease its time remaining
|
|||
|
if (!newToast.classList.contains('panning')) {
|
|||
|
timeLeft -= 20;
|
|||
|
}
|
|||
|
|
|||
|
if (timeLeft <= 0) {
|
|||
|
// Animate toast out
|
|||
|
Vel(newToast, {"opacity": 0, marginTop: '-40px'}, { duration: 375,
|
|||
|
easing: 'easeOutExpo',
|
|||
|
queue: false,
|
|||
|
complete: function(){
|
|||
|
// Call the optional callback
|
|||
|
if(typeof(completeCallback) === "function")
|
|||
|
completeCallback();
|
|||
|
// Remove toast after it times out
|
|||
|
this[0].parentNode.removeChild(this[0]);
|
|||
|
}
|
|||
|
});
|
|||
|
window.clearInterval(counterInterval);
|
|||
|
}
|
|||
|
}, 20);
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
|
|||
|
function createToast(html) {
|
|||
|
|
|||
|
// Create toast
|
|||
|
var toast = document.createElement('div');
|
|||
|
toast.classList.add('toast');
|
|||
|
if (className) {
|
|||
|
var classes = className.split(' ');
|
|||
|
|
|||
|
for (var i = 0, count = classes.length; i < count; i++) {
|
|||
|
toast.classList.add(classes[i]);
|
|||
|
}
|
|||
|
}
|
|||
|
// If type of parameter is HTML Element
|
|||
|
if ( typeof HTMLElement === "object" ? html instanceof HTMLElement : html && typeof html === "object" && html !== null && html.nodeType === 1 && typeof html.nodeName==="string"
|
|||
|
) {
|
|||
|
toast.appendChild(html);
|
|||
|
}
|
|||
|
else if (html instanceof jQuery) {
|
|||
|
// Check if it is jQuery object
|
|||
|
toast.appendChild(html[0]);
|
|||
|
}
|
|||
|
else {
|
|||
|
// Insert as text;
|
|||
|
toast.innerHTML = html;
|
|||
|
}
|
|||
|
// Bind hammer
|
|||
|
var hammerHandler = new Hammer(toast, {prevent_default: false});
|
|||
|
hammerHandler.on('pan', function(e) {
|
|||
|
var deltaX = e.deltaX;
|
|||
|
var activationDistance = 80;
|
|||
|
|
|||
|
// Change toast state
|
|||
|
if (!toast.classList.contains('panning')){
|
|||
|
toast.classList.add('panning');
|
|||
|
}
|
|||
|
|
|||
|
var opacityPercent = 1-Math.abs(deltaX / activationDistance);
|
|||
|
if (opacityPercent < 0)
|
|||
|
opacityPercent = 0;
|
|||
|
|
|||
|
Vel(toast, {left: deltaX, opacity: opacityPercent }, {duration: 50, queue: false, easing: 'easeOutQuad'});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
hammerHandler.on('panend', function(e) {
|
|||
|
var deltaX = e.deltaX;
|
|||
|
var activationDistance = 80;
|
|||
|
|
|||
|
// If toast dragged past activation point
|
|||
|
if (Math.abs(deltaX) > activationDistance) {
|
|||
|
Vel(toast, {marginTop: '-40px'}, { duration: 375,
|
|||
|
easing: 'easeOutExpo',
|
|||
|
queue: false,
|
|||
|
complete: function(){
|
|||
|
if(typeof(completeCallback) === "function") {
|
|||
|
completeCallback();
|
|||
|
}
|
|||
|
toast.parentNode.removeChild(toast);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
} else {
|
|||
|
toast.classList.remove('panning');
|
|||
|
// Put toast back into original position
|
|||
|
Vel(toast, { left: 0, opacity: 1 }, { duration: 300,
|
|||
|
easing: 'easeOutExpo',
|
|||
|
queue: false
|
|||
|
});
|
|||
|
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
return toast;
|
|||
|
}
|
|||
|
};
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
var methods = {
|
|||
|
init : function(options) {
|
|||
|
var defaults = {
|
|||
|
menuWidth: 300,
|
|||
|
edge: 'left',
|
|||
|
closeOnClick: false,
|
|||
|
draggable: true
|
|||
|
};
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
$(this).each(function(){
|
|||
|
var $this = $(this);
|
|||
|
var menuId = $this.attr('data-activates');
|
|||
|
var menu = $("#"+ menuId);
|
|||
|
|
|||
|
// Set to width
|
|||
|
if (options.menuWidth != 300) {
|
|||
|
menu.css('width', options.menuWidth);
|
|||
|
}
|
|||
|
|
|||
|
// Add Touch Area
|
|||
|
var $dragTarget = $('.drag-target[data-sidenav="' + menuId + '"]');
|
|||
|
if (options.draggable) {
|
|||
|
// Regenerate dragTarget
|
|||
|
if ($dragTarget.length) {
|
|||
|
$dragTarget.remove();
|
|||
|
}
|
|||
|
|
|||
|
$dragTarget = $('<div class="drag-target"></div>').attr('data-sidenav', menuId);
|
|||
|
$('body').append($dragTarget);
|
|||
|
} else {
|
|||
|
$dragTarget = $();
|
|||
|
}
|
|||
|
|
|||
|
if (options.edge == 'left') {
|
|||
|
menu.css('transform', 'translateX(-100%)');
|
|||
|
$dragTarget.css({'left': 0}); // Add Touch Area
|
|||
|
}
|
|||
|
else {
|
|||
|
menu.addClass('right-aligned') // Change text-alignment to right
|
|||
|
.css('transform', 'translateX(100%)');
|
|||
|
$dragTarget.css({'right': 0}); // Add Touch Area
|
|||
|
}
|
|||
|
|
|||
|
// If fixed sidenav, bring menu out
|
|||
|
if (menu.hasClass('fixed')) {
|
|||
|
if (window.innerWidth > 992) {
|
|||
|
menu.css('transform', 'translateX(0)');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Window resize to reset on large screens fixed
|
|||
|
if (menu.hasClass('fixed')) {
|
|||
|
$(window).resize( function() {
|
|||
|
if (window.innerWidth > 992) {
|
|||
|
// Close menu if window is resized bigger than 992 and user has fixed sidenav
|
|||
|
if ($('#sidenav-overlay').length !== 0 && menuOut) {
|
|||
|
removeMenu(true);
|
|||
|
}
|
|||
|
else {
|
|||
|
// menu.removeAttr('style');
|
|||
|
menu.css('transform', 'translateX(0%)');
|
|||
|
// menu.css('width', options.menuWidth);
|
|||
|
}
|
|||
|
}
|
|||
|
else if (menuOut === false){
|
|||
|
if (options.edge === 'left') {
|
|||
|
menu.css('transform', 'translateX(-100%)');
|
|||
|
} else {
|
|||
|
menu.css('transform', 'translateX(100%)');
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
// if closeOnClick, then add close event for all a tags in side sideNav
|
|||
|
if (options.closeOnClick === true) {
|
|||
|
menu.on("click.itemclick", "a:not(.collapsible-header)", function(){
|
|||
|
removeMenu();
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
var removeMenu = function(restoreNav) {
|
|||
|
panning = false;
|
|||
|
menuOut = false;
|
|||
|
// Reenable scrolling
|
|||
|
$('body').css({
|
|||
|
overflow: '',
|
|||
|
width: ''
|
|||
|
});
|
|||
|
|
|||
|
$('#sidenav-overlay').velocity({opacity: 0}, {duration: 200,
|
|||
|
queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function() {
|
|||
|
$(this).remove();
|
|||
|
} });
|
|||
|
if (options.edge === 'left') {
|
|||
|
// Reset phantom div
|
|||
|
$dragTarget.css({width: '', right: '', left: '0'});
|
|||
|
menu.velocity(
|
|||
|
{'translateX': '-100%'},
|
|||
|
{ duration: 200,
|
|||
|
queue: false,
|
|||
|
easing: 'easeOutCubic',
|
|||
|
complete: function() {
|
|||
|
if (restoreNav === true) {
|
|||
|
// Restore Fixed sidenav
|
|||
|
menu.removeAttr('style');
|
|||
|
menu.css('width', options.menuWidth);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
});
|
|||
|
}
|
|||
|
else {
|
|||
|
// Reset phantom div
|
|||
|
$dragTarget.css({width: '', right: '0', left: ''});
|
|||
|
menu.velocity(
|
|||
|
{'translateX': '100%'},
|
|||
|
{ duration: 200,
|
|||
|
queue: false,
|
|||
|
easing: 'easeOutCubic',
|
|||
|
complete: function() {
|
|||
|
if (restoreNav === true) {
|
|||
|
// Restore Fixed sidenav
|
|||
|
menu.removeAttr('style');
|
|||
|
menu.css('width', options.menuWidth);
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
|
|||
|
// Touch Event
|
|||
|
var panning = false;
|
|||
|
var menuOut = false;
|
|||
|
|
|||
|
if (options.draggable) {
|
|||
|
$dragTarget.on('click', function(){
|
|||
|
if (menuOut) {
|
|||
|
removeMenu();
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$dragTarget.hammer({
|
|||
|
prevent_default: false
|
|||
|
}).bind('pan', function(e) {
|
|||
|
|
|||
|
if (e.gesture.pointerType == "touch") {
|
|||
|
|
|||
|
var direction = e.gesture.direction;
|
|||
|
var x = e.gesture.center.x;
|
|||
|
var y = e.gesture.center.y;
|
|||
|
var velocityX = e.gesture.velocityX;
|
|||
|
|
|||
|
// Disable Scrolling
|
|||
|
var $body = $('body');
|
|||
|
var $overlay = $('#sidenav-overlay');
|
|||
|
var oldWidth = $body.innerWidth();
|
|||
|
$body.css('overflow', 'hidden');
|
|||
|
$body.width(oldWidth);
|
|||
|
|
|||
|
// If overlay does not exist, create one and if it is clicked, close menu
|
|||
|
if ($overlay.length === 0) {
|
|||
|
$overlay = $('<div id="sidenav-overlay"></div>');
|
|||
|
$overlay.css('opacity', 0).click( function(){
|
|||
|
removeMenu();
|
|||
|
});
|
|||
|
$('body').append($overlay);
|
|||
|
}
|
|||
|
|
|||
|
// Keep within boundaries
|
|||
|
if (options.edge === 'left') {
|
|||
|
if (x > options.menuWidth) { x = options.menuWidth; }
|
|||
|
else if (x < 0) { x = 0; }
|
|||
|
}
|
|||
|
|
|||
|
if (options.edge === 'left') {
|
|||
|
// Left Direction
|
|||
|
if (x < (options.menuWidth / 2)) { menuOut = false; }
|
|||
|
// Right Direction
|
|||
|
else if (x >= (options.menuWidth / 2)) { menuOut = true; }
|
|||
|
menu.css('transform', 'translateX(' + (x - options.menuWidth) + 'px)');
|
|||
|
}
|
|||
|
else {
|
|||
|
// Left Direction
|
|||
|
if (x < (window.innerWidth - options.menuWidth / 2)) {
|
|||
|
menuOut = true;
|
|||
|
}
|
|||
|
// Right Direction
|
|||
|
else if (x >= (window.innerWidth - options.menuWidth / 2)) {
|
|||
|
menuOut = false;
|
|||
|
}
|
|||
|
var rightPos = (x - options.menuWidth / 2);
|
|||
|
if (rightPos < 0) {
|
|||
|
rightPos = 0;
|
|||
|
}
|
|||
|
|
|||
|
menu.css('transform', 'translateX(' + rightPos + 'px)');
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Percentage overlay
|
|||
|
var overlayPerc;
|
|||
|
if (options.edge === 'left') {
|
|||
|
overlayPerc = x / options.menuWidth;
|
|||
|
$overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
else {
|
|||
|
overlayPerc = Math.abs((x - window.innerWidth) / options.menuWidth);
|
|||
|
$overlay.velocity({opacity: overlayPerc }, {duration: 10, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
}).bind('panend', function(e) {
|
|||
|
|
|||
|
if (e.gesture.pointerType == "touch") {
|
|||
|
var $overlay = $('<div id="sidenav-overlay"></div>');
|
|||
|
var velocityX = e.gesture.velocityX;
|
|||
|
var x = e.gesture.center.x;
|
|||
|
var leftPos = x - options.menuWidth;
|
|||
|
var rightPos = x - options.menuWidth / 2;
|
|||
|
if (leftPos > 0 ) {
|
|||
|
leftPos = 0;
|
|||
|
}
|
|||
|
if (rightPos < 0) {
|
|||
|
rightPos = 0;
|
|||
|
}
|
|||
|
panning = false;
|
|||
|
|
|||
|
if (options.edge === 'left') {
|
|||
|
// If velocityX <= 0.3 then the user is flinging the menu closed so ignore menuOut
|
|||
|
if ((menuOut && velocityX <= 0.3) || velocityX < -0.5) {
|
|||
|
// Return menu to open
|
|||
|
if (leftPos !== 0) {
|
|||
|
menu.velocity({'translateX': [0, leftPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
$overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
|
|||
|
$dragTarget.css({width: '50%', right: 0, left: ''});
|
|||
|
menuOut = true;
|
|||
|
}
|
|||
|
else if (!menuOut || velocityX > 0.3) {
|
|||
|
// Enable Scrolling
|
|||
|
$('body').css({
|
|||
|
overflow: '',
|
|||
|
width: ''
|
|||
|
});
|
|||
|
// Slide menu closed
|
|||
|
menu.velocity({'translateX': [-1 * options.menuWidth - 10, leftPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
|
|||
|
$overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function () {
|
|||
|
$(this).remove();
|
|||
|
}});
|
|||
|
$dragTarget.css({width: '10px', right: '', left: 0});
|
|||
|
}
|
|||
|
}
|
|||
|
else {
|
|||
|
if ((menuOut && velocityX >= -0.3) || velocityX > 0.5) {
|
|||
|
// Return menu to open
|
|||
|
if (rightPos !== 0) {
|
|||
|
menu.velocity({'translateX': [0, rightPos]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
$overlay.velocity({opacity: 1 }, {duration: 50, queue: false, easing: 'easeOutQuad'});
|
|||
|
$dragTarget.css({width: '50%', right: '', left: 0});
|
|||
|
menuOut = true;
|
|||
|
}
|
|||
|
else if (!menuOut || velocityX < -0.3) {
|
|||
|
// Enable Scrolling
|
|||
|
$('body').css({
|
|||
|
overflow: '',
|
|||
|
width: ''
|
|||
|
});
|
|||
|
|
|||
|
// Slide menu closed
|
|||
|
menu.velocity({'translateX': [options.menuWidth + 10, rightPos]}, {duration: 200, queue: false, easing: 'easeOutQuad'});
|
|||
|
$overlay.velocity({opacity: 0 }, {duration: 200, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function () {
|
|||
|
$(this).remove();
|
|||
|
}});
|
|||
|
$dragTarget.css({width: '10px', right: 0, left: ''});
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
$this.off('click.sidenav').on('click.sidenav', function() {
|
|||
|
if (menuOut === true) {
|
|||
|
menuOut = false;
|
|||
|
panning = false;
|
|||
|
removeMenu();
|
|||
|
}
|
|||
|
else {
|
|||
|
|
|||
|
// Disable Scrolling
|
|||
|
var $body = $('body');
|
|||
|
var $overlay = $('<div id="sidenav-overlay"></div>');
|
|||
|
var oldWidth = $body.innerWidth();
|
|||
|
$body.css('overflow', 'hidden');
|
|||
|
$body.width(oldWidth);
|
|||
|
|
|||
|
// Push current drag target on top of DOM tree
|
|||
|
$('body').append($dragTarget);
|
|||
|
|
|||
|
if (options.edge === 'left') {
|
|||
|
$dragTarget.css({width: '50%', right: 0, left: ''});
|
|||
|
menu.velocity({'translateX': [0, -1 * options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
else {
|
|||
|
$dragTarget.css({width: '50%', right: '', left: 0});
|
|||
|
menu.velocity({'translateX': [0, options.menuWidth]}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
$overlay.css('opacity', 0)
|
|||
|
.click(function(){
|
|||
|
menuOut = false;
|
|||
|
panning = false;
|
|||
|
removeMenu();
|
|||
|
$overlay.velocity({opacity: 0}, {duration: 300, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function() {
|
|||
|
$(this).remove();
|
|||
|
} });
|
|||
|
|
|||
|
});
|
|||
|
$('body').append($overlay);
|
|||
|
$overlay.velocity({opacity: 1}, {duration: 300, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function () {
|
|||
|
menuOut = true;
|
|||
|
panning = false;
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
return false;
|
|||
|
});
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
},
|
|||
|
destroy: function () {
|
|||
|
var $overlay = $('#sidenav-overlay');
|
|||
|
var $dragTarget = $('.drag-target[data-sidenav="' + $(this).attr('data-activates') + '"]');
|
|||
|
$overlay.trigger('click');
|
|||
|
$dragTarget.remove();
|
|||
|
$(this).off('click');
|
|||
|
$overlay.remove();
|
|||
|
},
|
|||
|
show : function() {
|
|||
|
this.trigger('click');
|
|||
|
},
|
|||
|
hide : function() {
|
|||
|
$('#sidenav-overlay').trigger('click');
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
$.fn.sideNav = function(methodOrOptions) {
|
|||
|
if ( methods[methodOrOptions] ) {
|
|||
|
return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
|||
|
} else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
|
|||
|
// Default to "init"
|
|||
|
return methods.init.apply( this, arguments );
|
|||
|
} else {
|
|||
|
$.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.sideNav' );
|
|||
|
}
|
|||
|
}; // Plugin end
|
|||
|
}( jQuery ));
|
|||
|
;/**
|
|||
|
* Extend jquery with a scrollspy plugin.
|
|||
|
* This watches the window scroll and fires events when elements are scrolled into viewport.
|
|||
|
*
|
|||
|
* throttle() and getTime() taken from Underscore.js
|
|||
|
* https://github.com/jashkenas/underscore
|
|||
|
*
|
|||
|
* @author Copyright 2013 John Smart
|
|||
|
* @license https://raw.github.com/thesmart/jquery-scrollspy/master/LICENSE
|
|||
|
* @see https://github.com/thesmart
|
|||
|
* @version 0.1.2
|
|||
|
*/
|
|||
|
(function($) {
|
|||
|
|
|||
|
var jWindow = $(window);
|
|||
|
var elements = [];
|
|||
|
var elementsInView = [];
|
|||
|
var isSpying = false;
|
|||
|
var ticks = 0;
|
|||
|
var unique_id = 1;
|
|||
|
var offset = {
|
|||
|
top : 0,
|
|||
|
right : 0,
|
|||
|
bottom : 0,
|
|||
|
left : 0,
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Find elements that are within the boundary
|
|||
|
* @param {number} top
|
|||
|
* @param {number} right
|
|||
|
* @param {number} bottom
|
|||
|
* @param {number} left
|
|||
|
* @return {jQuery} A collection of elements
|
|||
|
*/
|
|||
|
function findElements(top, right, bottom, left) {
|
|||
|
var hits = $();
|
|||
|
$.each(elements, function(i, element) {
|
|||
|
if (element.height() > 0) {
|
|||
|
var elTop = element.offset().top,
|
|||
|
elLeft = element.offset().left,
|
|||
|
elRight = elLeft + element.width(),
|
|||
|
elBottom = elTop + element.height();
|
|||
|
|
|||
|
var isIntersect = !(elLeft > right ||
|
|||
|
elRight < left ||
|
|||
|
elTop > bottom ||
|
|||
|
elBottom < top);
|
|||
|
|
|||
|
if (isIntersect) {
|
|||
|
hits.push(element);
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
return hits;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Called when the user scrolls the window
|
|||
|
*/
|
|||
|
function onScroll(scrollOffset) {
|
|||
|
// unique tick id
|
|||
|
++ticks;
|
|||
|
|
|||
|
// viewport rectangle
|
|||
|
var top = jWindow.scrollTop(),
|
|||
|
left = jWindow.scrollLeft(),
|
|||
|
right = left + jWindow.width(),
|
|||
|
bottom = top + jWindow.height();
|
|||
|
|
|||
|
// determine which elements are in view
|
|||
|
var intersections = findElements(top+offset.top + scrollOffset || 200, right+offset.right, bottom+offset.bottom, left+offset.left);
|
|||
|
$.each(intersections, function(i, element) {
|
|||
|
|
|||
|
var lastTick = element.data('scrollSpy:ticks');
|
|||
|
if (typeof lastTick != 'number') {
|
|||
|
// entered into view
|
|||
|
element.triggerHandler('scrollSpy:enter');
|
|||
|
}
|
|||
|
|
|||
|
// update tick id
|
|||
|
element.data('scrollSpy:ticks', ticks);
|
|||
|
});
|
|||
|
|
|||
|
// determine which elements are no longer in view
|
|||
|
$.each(elementsInView, function(i, element) {
|
|||
|
var lastTick = element.data('scrollSpy:ticks');
|
|||
|
if (typeof lastTick == 'number' && lastTick !== ticks) {
|
|||
|
// exited from view
|
|||
|
element.triggerHandler('scrollSpy:exit');
|
|||
|
element.data('scrollSpy:ticks', null);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// remember elements in view for next tick
|
|||
|
elementsInView = intersections;
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Called when window is resized
|
|||
|
*/
|
|||
|
function onWinSize() {
|
|||
|
jWindow.trigger('scrollSpy:winSize');
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Enables ScrollSpy using a selector
|
|||
|
* @param {jQuery|string} selector The elements collection, or a selector
|
|||
|
* @param {Object=} options Optional.
|
|||
|
throttle : number -> scrollspy throttling. Default: 100 ms
|
|||
|
offsetTop : number -> offset from top. Default: 0
|
|||
|
offsetRight : number -> offset from right. Default: 0
|
|||
|
offsetBottom : number -> offset from bottom. Default: 0
|
|||
|
offsetLeft : number -> offset from left. Default: 0
|
|||
|
* @returns {jQuery}
|
|||
|
*/
|
|||
|
$.scrollSpy = function(selector, options) {
|
|||
|
var defaults = {
|
|||
|
throttle: 100,
|
|||
|
scrollOffset: 200 // offset - 200 allows elements near bottom of page to scroll
|
|||
|
};
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
var visible = [];
|
|||
|
selector = $(selector);
|
|||
|
selector.each(function(i, element) {
|
|||
|
elements.push($(element));
|
|||
|
$(element).data("scrollSpy:id", i);
|
|||
|
// Smooth scroll to section
|
|||
|
$('a[href="#' + $(element).attr('id') + '"]').click(function(e) {
|
|||
|
e.preventDefault();
|
|||
|
var offset = $(Materialize.escapeHash(this.hash)).offset().top + 1;
|
|||
|
$('html, body').animate({ scrollTop: offset - options.scrollOffset }, {duration: 400, queue: false, easing: 'easeOutCubic'});
|
|||
|
});
|
|||
|
});
|
|||
|
|
|||
|
offset.top = options.offsetTop || 0;
|
|||
|
offset.right = options.offsetRight || 0;
|
|||
|
offset.bottom = options.offsetBottom || 0;
|
|||
|
offset.left = options.offsetLeft || 0;
|
|||
|
|
|||
|
var throttledScroll = Materialize.throttle(function() {
|
|||
|
onScroll(options.scrollOffset);
|
|||
|
}, options.throttle || 100);
|
|||
|
var readyScroll = function(){
|
|||
|
$(document).ready(throttledScroll);
|
|||
|
};
|
|||
|
|
|||
|
if (!isSpying) {
|
|||
|
jWindow.on('scroll', readyScroll);
|
|||
|
jWindow.on('resize', readyScroll);
|
|||
|
isSpying = true;
|
|||
|
}
|
|||
|
|
|||
|
// perform a scan once, after current execution context, and after dom is ready
|
|||
|
setTimeout(readyScroll, 0);
|
|||
|
|
|||
|
|
|||
|
selector.on('scrollSpy:enter', function() {
|
|||
|
visible = $.grep(visible, function(value) {
|
|||
|
return value.height() != 0;
|
|||
|
});
|
|||
|
|
|||
|
var $this = $(this);
|
|||
|
|
|||
|
if (visible[0]) {
|
|||
|
$('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
|
|||
|
if ($this.data('scrollSpy:id') < visible[0].data('scrollSpy:id')) {
|
|||
|
visible.unshift($(this));
|
|||
|
}
|
|||
|
else {
|
|||
|
visible.push($(this));
|
|||
|
}
|
|||
|
}
|
|||
|
else {
|
|||
|
visible.push($(this));
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
$('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
|
|||
|
});
|
|||
|
selector.on('scrollSpy:exit', function() {
|
|||
|
visible = $.grep(visible, function(value) {
|
|||
|
return value.height() != 0;
|
|||
|
});
|
|||
|
|
|||
|
if (visible[0]) {
|
|||
|
$('a[href="#' + visible[0].attr('id') + '"]').removeClass('active');
|
|||
|
var $this = $(this);
|
|||
|
visible = $.grep(visible, function(value) {
|
|||
|
return value.attr('id') != $this.attr('id');
|
|||
|
});
|
|||
|
if (visible[0]) { // Check if empty
|
|||
|
$('a[href="#' + visible[0].attr('id') + '"]').addClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
return selector;
|
|||
|
};
|
|||
|
|
|||
|
/**
|
|||
|
* Listen for window resize events
|
|||
|
* @param {Object=} options Optional. Set { throttle: number } to change throttling. Default: 100 ms
|
|||
|
* @returns {jQuery} $(window)
|
|||
|
*/
|
|||
|
$.winSizeSpy = function(options) {
|
|||
|
$.winSizeSpy = function() { return jWindow; }; // lock from multiple calls
|
|||
|
options = options || {
|
|||
|
throttle: 100
|
|||
|
};
|
|||
|
return jWindow.on('resize', Materialize.throttle(onWinSize, options.throttle || 100));
|
|||
|
};
|
|||
|
|
|||
|
/**
|
|||
|
* Enables ScrollSpy on a collection of elements
|
|||
|
* e.g. $('.scrollSpy').scrollSpy()
|
|||
|
* @param {Object=} options Optional.
|
|||
|
throttle : number -> scrollspy throttling. Default: 100 ms
|
|||
|
offsetTop : number -> offset from top. Default: 0
|
|||
|
offsetRight : number -> offset from right. Default: 0
|
|||
|
offsetBottom : number -> offset from bottom. Default: 0
|
|||
|
offsetLeft : number -> offset from left. Default: 0
|
|||
|
* @returns {jQuery}
|
|||
|
*/
|
|||
|
$.fn.scrollSpy = function(options) {
|
|||
|
return $.scrollSpy($(this), options);
|
|||
|
};
|
|||
|
|
|||
|
})(jQuery);
|
|||
|
;(function ($) {
|
|||
|
$(document).ready(function() {
|
|||
|
|
|||
|
// Function to update labels of text fields
|
|||
|
Materialize.updateTextFields = function() {
|
|||
|
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
|||
|
$(input_selector).each(function(index, element) {
|
|||
|
var $this = $(this);
|
|||
|
if ($(element).val().length > 0 || element.autofocus || $this.attr('placeholder') !== undefined) {
|
|||
|
$this.siblings('label').addClass('active');
|
|||
|
} else if ($(element)[0].validity) {
|
|||
|
$this.siblings('label').toggleClass('active', $(element)[0].validity.badInput === true);
|
|||
|
} else {
|
|||
|
$this.siblings('label').removeClass('active');
|
|||
|
}
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
// Text based inputs
|
|||
|
var input_selector = 'input[type=text], input[type=password], input[type=email], input[type=url], input[type=tel], input[type=number], input[type=search], textarea';
|
|||
|
|
|||
|
// Add active if form auto complete
|
|||
|
$(document).on('change', input_selector, function () {
|
|||
|
if($(this).val().length !== 0 || $(this).attr('placeholder') !== undefined) {
|
|||
|
$(this).siblings('label').addClass('active');
|
|||
|
}
|
|||
|
validate_field($(this));
|
|||
|
});
|
|||
|
|
|||
|
// Add active if input element has been pre-populated on document ready
|
|||
|
$(document).ready(function() {
|
|||
|
Materialize.updateTextFields();
|
|||
|
});
|
|||
|
|
|||
|
// HTML DOM FORM RESET handling
|
|||
|
$(document).on('reset', function(e) {
|
|||
|
var formReset = $(e.target);
|
|||
|
if (formReset.is('form')) {
|
|||
|
formReset.find(input_selector).removeClass('valid').removeClass('invalid');
|
|||
|
formReset.find(input_selector).each(function () {
|
|||
|
if ($(this).attr('value') === '') {
|
|||
|
$(this).siblings('label').removeClass('active');
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Reset select
|
|||
|
formReset.find('select.initialized').each(function () {
|
|||
|
var reset_text = formReset.find('option[selected]').text();
|
|||
|
formReset.siblings('input.select-dropdown').val(reset_text);
|
|||
|
});
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Add active when element has focus
|
|||
|
$(document).on('focus', input_selector, function () {
|
|||
|
$(this).siblings('label, .prefix').addClass('active');
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('blur', input_selector, function () {
|
|||
|
var $inputElement = $(this);
|
|||
|
var selector = ".prefix";
|
|||
|
|
|||
|
if ($inputElement.val().length === 0 && $inputElement[0].validity.badInput !== true && $inputElement.attr('placeholder') === undefined) {
|
|||
|
selector += ", label";
|
|||
|
}
|
|||
|
|
|||
|
$inputElement.siblings(selector).removeClass('active');
|
|||
|
|
|||
|
validate_field($inputElement);
|
|||
|
});
|
|||
|
|
|||
|
window.validate_field = function(object) {
|
|||
|
var hasLength = object.attr('data-length') !== undefined;
|
|||
|
var lenAttr = parseInt(object.attr('data-length'));
|
|||
|
var len = object.val().length;
|
|||
|
|
|||
|
if (object.val().length === 0 && object[0].validity.badInput === false) {
|
|||
|
if (object.hasClass('validate')) {
|
|||
|
object.removeClass('valid');
|
|||
|
object.removeClass('invalid');
|
|||
|
}
|
|||
|
}
|
|||
|
else {
|
|||
|
if (object.hasClass('validate')) {
|
|||
|
// Check for character counter attributes
|
|||
|
if ((object.is(':valid') && hasLength && (len <= lenAttr)) || (object.is(':valid') && !hasLength)) {
|
|||
|
object.removeClass('invalid');
|
|||
|
object.addClass('valid');
|
|||
|
}
|
|||
|
else {
|
|||
|
object.removeClass('valid');
|
|||
|
object.addClass('invalid');
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
// Radio and Checkbox focus class
|
|||
|
var radio_checkbox = 'input[type=radio], input[type=checkbox]';
|
|||
|
$(document).on('keyup.radio', radio_checkbox, function(e) {
|
|||
|
// TAB, check if tabbing to radio or checkbox.
|
|||
|
if (e.which === 9) {
|
|||
|
$(this).addClass('tabbed');
|
|||
|
var $this = $(this);
|
|||
|
$this.one('blur', function(e) {
|
|||
|
|
|||
|
$(this).removeClass('tabbed');
|
|||
|
});
|
|||
|
return;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Textarea Auto Resize
|
|||
|
var hiddenDiv = $('.hiddendiv').first();
|
|||
|
if (!hiddenDiv.length) {
|
|||
|
hiddenDiv = $('<div class="hiddendiv common"></div>');
|
|||
|
$('body').append(hiddenDiv);
|
|||
|
}
|
|||
|
var text_area_selector = '.materialize-textarea';
|
|||
|
|
|||
|
function textareaAutoResize($textarea) {
|
|||
|
// Set font properties of hiddenDiv
|
|||
|
|
|||
|
var fontFamily = $textarea.css('font-family');
|
|||
|
var fontSize = $textarea.css('font-size');
|
|||
|
var lineHeight = $textarea.css('line-height');
|
|||
|
|
|||
|
if (fontSize) { hiddenDiv.css('font-size', fontSize); }
|
|||
|
if (fontFamily) { hiddenDiv.css('font-family', fontFamily); }
|
|||
|
if (lineHeight) { hiddenDiv.css('line-height', lineHeight); }
|
|||
|
|
|||
|
if ($textarea.attr('wrap') === "off") {
|
|||
|
hiddenDiv.css('overflow-wrap', "normal")
|
|||
|
.css('white-space', "pre");
|
|||
|
}
|
|||
|
|
|||
|
hiddenDiv.text($textarea.val() + '\n');
|
|||
|
var content = hiddenDiv.html().replace(/\n/g, '<br>');
|
|||
|
hiddenDiv.html(content);
|
|||
|
|
|||
|
|
|||
|
// When textarea is hidden, width goes crazy.
|
|||
|
// Approximate with half of window size
|
|||
|
|
|||
|
if ($textarea.is(':visible')) {
|
|||
|
hiddenDiv.css('width', $textarea.width());
|
|||
|
}
|
|||
|
else {
|
|||
|
hiddenDiv.css('width', $(window).width()/2);
|
|||
|
}
|
|||
|
|
|||
|
$textarea.css('height', hiddenDiv.height());
|
|||
|
}
|
|||
|
|
|||
|
$(text_area_selector).each(function () {
|
|||
|
var $textarea = $(this);
|
|||
|
if ($textarea.val().length) {
|
|||
|
textareaAutoResize($textarea);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$('body').on('keyup keydown autoresize', text_area_selector, function () {
|
|||
|
textareaAutoResize($(this));
|
|||
|
});
|
|||
|
|
|||
|
// File Input Path
|
|||
|
$(document).on('change', '.file-field input[type="file"]', function () {
|
|||
|
var file_field = $(this).closest('.file-field');
|
|||
|
var path_input = file_field.find('input.file-path');
|
|||
|
var files = $(this)[0].files;
|
|||
|
var file_names = [];
|
|||
|
for (var i = 0; i < files.length; i++) {
|
|||
|
file_names.push(files[i].name);
|
|||
|
}
|
|||
|
path_input.val(file_names.join(", "));
|
|||
|
path_input.trigger('change');
|
|||
|
});
|
|||
|
|
|||
|
/****************
|
|||
|
* Range Input *
|
|||
|
****************/
|
|||
|
|
|||
|
var range_type = 'input[type=range]';
|
|||
|
var range_mousedown = false;
|
|||
|
var left;
|
|||
|
|
|||
|
$(range_type).each(function () {
|
|||
|
var thumb = $('<span class="thumb"><span class="value"></span></span>');
|
|||
|
$(this).after(thumb);
|
|||
|
});
|
|||
|
|
|||
|
var range_wrapper = '.range-field';
|
|||
|
$(document).on('change', range_type, function(e) {
|
|||
|
var thumb = $(this).siblings('.thumb');
|
|||
|
thumb.find('.value').html($(this).val());
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('input mousedown touchstart', range_type, function(e) {
|
|||
|
var thumb = $(this).siblings('.thumb');
|
|||
|
var width = $(this).outerWidth();
|
|||
|
|
|||
|
// If thumb indicator does not exist yet, create it
|
|||
|
if (thumb.length <= 0) {
|
|||
|
thumb = $('<span class="thumb"><span class="value"></span></span>');
|
|||
|
$(this).after(thumb);
|
|||
|
}
|
|||
|
|
|||
|
// Set indicator value
|
|||
|
thumb.find('.value').html($(this).val());
|
|||
|
|
|||
|
range_mousedown = true;
|
|||
|
$(this).addClass('active');
|
|||
|
|
|||
|
if (!thumb.hasClass('active')) {
|
|||
|
thumb.velocity({ height: "30px", width: "30px", top: "-20px", marginLeft: "-15px"}, { duration: 300, easing: 'easeOutExpo' });
|
|||
|
}
|
|||
|
|
|||
|
if (e.type !== 'input') {
|
|||
|
if(e.pageX === undefined || e.pageX === null){//mobile
|
|||
|
left = e.originalEvent.touches[0].pageX - $(this).offset().left;
|
|||
|
}
|
|||
|
else{ // desktop
|
|||
|
left = e.pageX - $(this).offset().left;
|
|||
|
}
|
|||
|
if (left < 0) {
|
|||
|
left = 0;
|
|||
|
}
|
|||
|
else if (left > width) {
|
|||
|
left = width;
|
|||
|
}
|
|||
|
thumb.addClass('active').css('left', left);
|
|||
|
}
|
|||
|
|
|||
|
thumb.find('.value').html($(this).val());
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('mouseup touchend', range_wrapper, function() {
|
|||
|
range_mousedown = false;
|
|||
|
$(this).removeClass('active');
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('mousemove touchmove', range_wrapper, function(e) {
|
|||
|
var thumb = $(this).children('.thumb');
|
|||
|
var left;
|
|||
|
if (range_mousedown) {
|
|||
|
if (!thumb.hasClass('active')) {
|
|||
|
thumb.velocity({ height: '30px', width: '30px', top: '-20px', marginLeft: '-15px'}, { duration: 300, easing: 'easeOutExpo' });
|
|||
|
}
|
|||
|
if (e.pageX === undefined || e.pageX === null) { //mobile
|
|||
|
left = e.originalEvent.touches[0].pageX - $(this).offset().left;
|
|||
|
}
|
|||
|
else{ // desktop
|
|||
|
left = e.pageX - $(this).offset().left;
|
|||
|
}
|
|||
|
var width = $(this).outerWidth();
|
|||
|
|
|||
|
if (left < 0) {
|
|||
|
left = 0;
|
|||
|
}
|
|||
|
else if (left > width) {
|
|||
|
left = width;
|
|||
|
}
|
|||
|
thumb.addClass('active').css('left', left);
|
|||
|
thumb.find('.value').html(thumb.siblings(range_type).val());
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('mouseout touchleave', range_wrapper, function() {
|
|||
|
if (!range_mousedown) {
|
|||
|
|
|||
|
var thumb = $(this).children('.thumb');
|
|||
|
|
|||
|
if (thumb.hasClass('active')) {
|
|||
|
thumb.velocity({ height: '0', width: '0', top: '10px', marginLeft: '-6px'}, { duration: 100 });
|
|||
|
}
|
|||
|
thumb.removeClass('active');
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
/**************************
|
|||
|
* Auto complete plugin *
|
|||
|
*************************/
|
|||
|
$.fn.autocomplete = function (options) {
|
|||
|
// Defaults
|
|||
|
var defaults = {
|
|||
|
data: {},
|
|||
|
limit: Infinity,
|
|||
|
onAutocomplete: null
|
|||
|
};
|
|||
|
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
var $input = $(this);
|
|||
|
var data = options.data,
|
|||
|
count = 0,
|
|||
|
activeIndex = 0,
|
|||
|
oldVal,
|
|||
|
$inputDiv = $input.closest('.input-field'); // Div to append on
|
|||
|
|
|||
|
// Check if data isn't empty
|
|||
|
if (!$.isEmptyObject(data)) {
|
|||
|
var $autocomplete = $('<ul class="autocomplete-content dropdown-content"></ul>');
|
|||
|
var $oldAutocomplete;
|
|||
|
|
|||
|
// Append autocomplete element.
|
|||
|
// Prevent double structure init.
|
|||
|
if ($inputDiv.length) {
|
|||
|
$oldAutocomplete = $inputDiv.children('.autocomplete-content.dropdown-content').first();
|
|||
|
if (!$oldAutocomplete.length) {
|
|||
|
$inputDiv.append($autocomplete); // Set ul in body
|
|||
|
}
|
|||
|
} else {
|
|||
|
$oldAutocomplete = $input.next('.autocomplete-content.dropdown-content');
|
|||
|
if (!$oldAutocomplete.length) {
|
|||
|
$input.after($autocomplete);
|
|||
|
}
|
|||
|
}
|
|||
|
if ($oldAutocomplete.length) {
|
|||
|
$autocomplete = $oldAutocomplete;
|
|||
|
}
|
|||
|
|
|||
|
// Highlight partial match.
|
|||
|
var highlight = function(string, $el) {
|
|||
|
var img = $el.find('img');
|
|||
|
var matchStart = $el.text().toLowerCase().indexOf("" + string.toLowerCase() + ""),
|
|||
|
matchEnd = matchStart + string.length - 1,
|
|||
|
beforeMatch = $el.text().slice(0, matchStart),
|
|||
|
matchText = $el.text().slice(matchStart, matchEnd + 1),
|
|||
|
afterMatch = $el.text().slice(matchEnd + 1);
|
|||
|
$el.html("<span>" + beforeMatch + "<span class='highlight'>" + matchText + "</span>" + afterMatch + "</span>");
|
|||
|
if (img.length) {
|
|||
|
$el.prepend(img);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
// Reset current element position
|
|||
|
var resetCurrentElement = function() {
|
|||
|
activeIndex = 0;
|
|||
|
$autocomplete.find('.active').removeClass('active');
|
|||
|
}
|
|||
|
|
|||
|
// Perform search
|
|||
|
$input.off('keyup.autocomplete').on('keyup.autocomplete', function (e) {
|
|||
|
// Reset count.
|
|||
|
count = 0;
|
|||
|
|
|||
|
// Don't capture enter or arrow key usage.
|
|||
|
if (e.which === 13 ||
|
|||
|
e.which === 38 ||
|
|||
|
e.which === 40) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var val = $input.val().toLowerCase();
|
|||
|
|
|||
|
// Check if the input isn't empty
|
|||
|
if (oldVal !== val) {
|
|||
|
$autocomplete.empty();
|
|||
|
resetCurrentElement();
|
|||
|
|
|||
|
if (val !== '') {
|
|||
|
for(var key in data) {
|
|||
|
if (data.hasOwnProperty(key) &&
|
|||
|
key.toLowerCase().indexOf(val) !== -1 &&
|
|||
|
key.toLowerCase() !== val) {
|
|||
|
// Break if past limit
|
|||
|
if (count >= options.limit) {
|
|||
|
break;
|
|||
|
}
|
|||
|
|
|||
|
var autocompleteOption = $('<li></li>');
|
|||
|
if (!!data[key]) {
|
|||
|
autocompleteOption.append('<img src="'+ data[key] +'" class="right circle"><span>'+ key +'</span>');
|
|||
|
} else {
|
|||
|
autocompleteOption.append('<span>'+ key +'</span>');
|
|||
|
}
|
|||
|
|
|||
|
$autocomplete.append(autocompleteOption);
|
|||
|
highlight(val, autocompleteOption);
|
|||
|
count++;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Update oldVal
|
|||
|
oldVal = val;
|
|||
|
});
|
|||
|
|
|||
|
$input.off('keydown.autocomplete').on('keydown.autocomplete', function (e) {
|
|||
|
// Arrow keys and enter key usage
|
|||
|
var keyCode = e.which,
|
|||
|
liElement,
|
|||
|
numItems = $autocomplete.children('li').length,
|
|||
|
$active = $autocomplete.children('.active').first();
|
|||
|
|
|||
|
// select element on Enter
|
|||
|
if (keyCode === 13) {
|
|||
|
liElement = $autocomplete.children('li').eq(activeIndex);
|
|||
|
if (liElement.length) {
|
|||
|
liElement.click();
|
|||
|
e.preventDefault();
|
|||
|
}
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// Capture up and down key
|
|||
|
if ( keyCode === 38 || keyCode === 40 ) {
|
|||
|
e.preventDefault();
|
|||
|
|
|||
|
if (keyCode === 38 &&
|
|||
|
activeIndex > 0) {
|
|||
|
activeIndex--;
|
|||
|
}
|
|||
|
|
|||
|
if (keyCode === 40 &&
|
|||
|
activeIndex < (numItems - 1) &&
|
|||
|
$active.length) {
|
|||
|
activeIndex++;
|
|||
|
}
|
|||
|
|
|||
|
$active.removeClass('active');
|
|||
|
$autocomplete.children('li').eq(activeIndex).addClass('active');
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Set input value
|
|||
|
$autocomplete.on('click', 'li', function () {
|
|||
|
var text = $(this).text().trim();
|
|||
|
$input.val(text);
|
|||
|
$input.trigger('change');
|
|||
|
$autocomplete.empty();
|
|||
|
resetCurrentElement();
|
|||
|
|
|||
|
// Handle onAutocomplete callback.
|
|||
|
if (typeof(options.onAutocomplete) === "function") {
|
|||
|
options.onAutocomplete.call(this, text);
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
}); // End of $(document).ready
|
|||
|
|
|||
|
/*******************
|
|||
|
* Select Plugin *
|
|||
|
******************/
|
|||
|
$.fn.material_select = function (callback) {
|
|||
|
$(this).each(function(){
|
|||
|
var $select = $(this);
|
|||
|
|
|||
|
if ($select.hasClass('browser-default')) {
|
|||
|
return; // Continue to next (return false breaks out of entire loop)
|
|||
|
}
|
|||
|
|
|||
|
var multiple = $select.attr('multiple') ? true : false,
|
|||
|
lastID = $select.data('select-id'); // Tear down structure if Select needs to be rebuilt
|
|||
|
|
|||
|
if (lastID) {
|
|||
|
$select.parent().find('span.caret').remove();
|
|||
|
$select.parent().find('input').remove();
|
|||
|
|
|||
|
$select.unwrap();
|
|||
|
$('ul#select-options-'+lastID).remove();
|
|||
|
}
|
|||
|
|
|||
|
// If destroying the select, remove the selelct-id and reset it to it's uninitialized state.
|
|||
|
if(callback === 'destroy') {
|
|||
|
$select.data('select-id', null).removeClass('initialized');
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var uniqueID = Materialize.guid();
|
|||
|
$select.data('select-id', uniqueID);
|
|||
|
var wrapper = $('<div class="select-wrapper"></div>');
|
|||
|
wrapper.addClass($select.attr('class'));
|
|||
|
var options = $('<ul id="select-options-' + uniqueID +'" class="dropdown-content select-dropdown ' + (multiple ? 'multiple-select-dropdown' : '') + '"></ul>'),
|
|||
|
selectChildren = $select.children('option, optgroup'),
|
|||
|
valuesSelected = [],
|
|||
|
optionsHover = false;
|
|||
|
|
|||
|
var label = $select.find('option:selected').html() || $select.find('option:first').html() || "";
|
|||
|
|
|||
|
// Function that renders and appends the option taking into
|
|||
|
// account type and possible image icon.
|
|||
|
var appendOptionWithIcon = function(select, option, type) {
|
|||
|
// Add disabled attr if disabled
|
|||
|
var disabledClass = (option.is(':disabled')) ? 'disabled ' : '';
|
|||
|
var optgroupClass = (type === 'optgroup-option') ? 'optgroup-option ' : '';
|
|||
|
|
|||
|
// add icons
|
|||
|
var icon_url = option.data('icon');
|
|||
|
var classes = option.attr('class');
|
|||
|
if (!!icon_url) {
|
|||
|
var classString = '';
|
|||
|
if (!!classes) classString = ' class="' + classes + '"';
|
|||
|
|
|||
|
// Check for multiple type.
|
|||
|
if (type === 'multiple') {
|
|||
|
options.append($('<li class="' + disabledClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
|
|||
|
} else {
|
|||
|
options.append($('<li class="' + disabledClass + optgroupClass + '"><img alt="" src="' + icon_url + '"' + classString + '><span>' + option.html() + '</span></li>'));
|
|||
|
}
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
// Check for multiple type.
|
|||
|
if (type === 'multiple') {
|
|||
|
options.append($('<li class="' + disabledClass + '"><span><input type="checkbox"' + disabledClass + '/><label></label>' + option.html() + '</span></li>'));
|
|||
|
} else {
|
|||
|
options.append($('<li class="' + disabledClass + optgroupClass + '"><span>' + option.html() + '</span></li>'));
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
/* Create dropdown structure. */
|
|||
|
if (selectChildren.length) {
|
|||
|
selectChildren.each(function() {
|
|||
|
if ($(this).is('option')) {
|
|||
|
// Direct descendant option.
|
|||
|
if (multiple) {
|
|||
|
appendOptionWithIcon($select, $(this), 'multiple');
|
|||
|
|
|||
|
} else {
|
|||
|
appendOptionWithIcon($select, $(this));
|
|||
|
}
|
|||
|
} else if ($(this).is('optgroup')) {
|
|||
|
// Optgroup.
|
|||
|
var selectOptions = $(this).children('option');
|
|||
|
options.append($('<li class="optgroup"><span>' + $(this).attr('label') + '</span></li>'));
|
|||
|
|
|||
|
selectOptions.each(function() {
|
|||
|
appendOptionWithIcon($select, $(this), 'optgroup-option');
|
|||
|
});
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
options.find('li:not(.optgroup)').each(function (i) {
|
|||
|
$(this).click(function (e) {
|
|||
|
// Check if option element is disabled
|
|||
|
if (!$(this).hasClass('disabled') && !$(this).hasClass('optgroup')) {
|
|||
|
var selected = true;
|
|||
|
|
|||
|
if (multiple) {
|
|||
|
$('input[type="checkbox"]', this).prop('checked', function(i, v) { return !v; });
|
|||
|
selected = toggleEntryFromArray(valuesSelected, $(this).index(), $select);
|
|||
|
$newSelect.trigger('focus');
|
|||
|
} else {
|
|||
|
options.find('li').removeClass('active');
|
|||
|
$(this).toggleClass('active');
|
|||
|
$newSelect.val($(this).text());
|
|||
|
}
|
|||
|
|
|||
|
activateOption(options, $(this));
|
|||
|
$select.find('option').eq(i).prop('selected', selected);
|
|||
|
// Trigger onchange() event
|
|||
|
$select.trigger('change');
|
|||
|
if (typeof callback !== 'undefined') callback();
|
|||
|
}
|
|||
|
|
|||
|
e.stopPropagation();
|
|||
|
});
|
|||
|
});
|
|||
|
|
|||
|
// Wrap Elements
|
|||
|
$select.wrap(wrapper);
|
|||
|
// Add Select Display Element
|
|||
|
var dropdownIcon = $('<span class="caret">▼</span>');
|
|||
|
if ($select.is(':disabled'))
|
|||
|
dropdownIcon.addClass('disabled');
|
|||
|
|
|||
|
// escape double quotes
|
|||
|
var sanitizedLabelHtml = label.replace(/"/g, '"');
|
|||
|
|
|||
|
var $newSelect = $('<input type="text" class="select-dropdown" readonly="true" ' + (($select.is(':disabled')) ? 'disabled' : '') + ' data-activates="select-options-' + uniqueID +'" value="'+ sanitizedLabelHtml +'"/>');
|
|||
|
$select.before($newSelect);
|
|||
|
$newSelect.before(dropdownIcon);
|
|||
|
|
|||
|
$newSelect.after(options);
|
|||
|
// Check if section element is disabled
|
|||
|
if (!$select.is(':disabled')) {
|
|||
|
$newSelect.dropdown({'hover': false, 'closeOnClick': false});
|
|||
|
}
|
|||
|
|
|||
|
// Copy tabindex
|
|||
|
if ($select.attr('tabindex')) {
|
|||
|
$($newSelect[0]).attr('tabindex', $select.attr('tabindex'));
|
|||
|
}
|
|||
|
|
|||
|
$select.addClass('initialized');
|
|||
|
|
|||
|
$newSelect.on({
|
|||
|
'focus': function (){
|
|||
|
if ($('ul.select-dropdown').not(options[0]).is(':visible')) {
|
|||
|
$('input.select-dropdown').trigger('close');
|
|||
|
}
|
|||
|
if (!options.is(':visible')) {
|
|||
|
$(this).trigger('open', ['focus']);
|
|||
|
var label = $(this).val();
|
|||
|
if (multiple && label.indexOf(',') >= 0) {
|
|||
|
label = label.split(',')[0];
|
|||
|
}
|
|||
|
|
|||
|
var selectedOption = options.find('li').filter(function() {
|
|||
|
return $(this).text().toLowerCase() === label.toLowerCase();
|
|||
|
})[0];
|
|||
|
activateOption(options, selectedOption, true);
|
|||
|
}
|
|||
|
},
|
|||
|
'click': function (e){
|
|||
|
e.stopPropagation();
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$newSelect.on('blur', function() {
|
|||
|
if (!multiple) {
|
|||
|
$(this).trigger('close');
|
|||
|
}
|
|||
|
options.find('li.selected').removeClass('selected');
|
|||
|
});
|
|||
|
|
|||
|
options.hover(function() {
|
|||
|
optionsHover = true;
|
|||
|
}, function () {
|
|||
|
optionsHover = false;
|
|||
|
});
|
|||
|
|
|||
|
$(window).on({
|
|||
|
'click': function () {
|
|||
|
multiple && (optionsHover || $newSelect.trigger('close'));
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Add initial multiple selections.
|
|||
|
if (multiple) {
|
|||
|
$select.find("option:selected:not(:disabled)").each(function () {
|
|||
|
var index = $(this).index();
|
|||
|
|
|||
|
toggleEntryFromArray(valuesSelected, index, $select);
|
|||
|
options.find("li").eq(index).find(":checkbox").prop("checked", true);
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
/**
|
|||
|
* Make option as selected and scroll to selected position
|
|||
|
* @param {jQuery} collection Select options jQuery element
|
|||
|
* @param {Element} newOption element of the new option
|
|||
|
* @param {Boolean} firstActivation If on first activation of select
|
|||
|
*/
|
|||
|
var activateOption = function(collection, newOption, firstActivation) {
|
|||
|
if (newOption) {
|
|||
|
collection.find('li.selected').removeClass('selected');
|
|||
|
var option = $(newOption);
|
|||
|
option.addClass('selected');
|
|||
|
if (!multiple || !!firstActivation) {
|
|||
|
options.scrollTo(option);
|
|||
|
}
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
// Allow user to search by typing
|
|||
|
// this array is cleared after 1 second
|
|||
|
var filterQuery = [],
|
|||
|
onKeyDown = function(e){
|
|||
|
// TAB - switch to another input
|
|||
|
if(e.which == 9){
|
|||
|
$newSelect.trigger('close');
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// ARROW DOWN WHEN SELECT IS CLOSED - open select options
|
|||
|
if(e.which == 40 && !options.is(':visible')){
|
|||
|
$newSelect.trigger('open');
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// ENTER WHEN SELECT IS CLOSED - submit form
|
|||
|
if(e.which == 13 && !options.is(':visible')){
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
e.preventDefault();
|
|||
|
|
|||
|
// CASE WHEN USER TYPE LETTERS
|
|||
|
var letter = String.fromCharCode(e.which).toLowerCase(),
|
|||
|
nonLetters = [9,13,27,38,40];
|
|||
|
if (letter && (nonLetters.indexOf(e.which) === -1)) {
|
|||
|
filterQuery.push(letter);
|
|||
|
|
|||
|
var string = filterQuery.join(''),
|
|||
|
newOption = options.find('li').filter(function() {
|
|||
|
return $(this).text().toLowerCase().indexOf(string) === 0;
|
|||
|
})[0];
|
|||
|
|
|||
|
if (newOption) {
|
|||
|
activateOption(options, newOption);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// ENTER - select option and close when select options are opened
|
|||
|
if (e.which == 13) {
|
|||
|
var activeOption = options.find('li.selected:not(.disabled)')[0];
|
|||
|
if(activeOption){
|
|||
|
$(activeOption).trigger('click');
|
|||
|
if (!multiple) {
|
|||
|
$newSelect.trigger('close');
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// ARROW DOWN - move to next not disabled option
|
|||
|
if (e.which == 40) {
|
|||
|
if (options.find('li.selected').length) {
|
|||
|
newOption = options.find('li.selected').next('li:not(.disabled)')[0];
|
|||
|
} else {
|
|||
|
newOption = options.find('li:not(.disabled)')[0];
|
|||
|
}
|
|||
|
activateOption(options, newOption);
|
|||
|
}
|
|||
|
|
|||
|
// ESC - close options
|
|||
|
if (e.which == 27) {
|
|||
|
$newSelect.trigger('close');
|
|||
|
}
|
|||
|
|
|||
|
// ARROW UP - move to previous not disabled option
|
|||
|
if (e.which == 38) {
|
|||
|
newOption = options.find('li.selected').prev('li:not(.disabled)')[0];
|
|||
|
if(newOption)
|
|||
|
activateOption(options, newOption);
|
|||
|
}
|
|||
|
|
|||
|
// Automaticaly clean filter query so user can search again by starting letters
|
|||
|
setTimeout(function(){ filterQuery = []; }, 1000);
|
|||
|
};
|
|||
|
|
|||
|
$newSelect.on('keydown', onKeyDown);
|
|||
|
});
|
|||
|
|
|||
|
function toggleEntryFromArray(entriesArray, entryIndex, select) {
|
|||
|
var index = entriesArray.indexOf(entryIndex),
|
|||
|
notAdded = index === -1;
|
|||
|
|
|||
|
if (notAdded) {
|
|||
|
entriesArray.push(entryIndex);
|
|||
|
} else {
|
|||
|
entriesArray.splice(index, 1);
|
|||
|
}
|
|||
|
|
|||
|
select.siblings('ul.dropdown-content').find('li').eq(entryIndex).toggleClass('active');
|
|||
|
|
|||
|
// use notAdded instead of true (to detect if the option is selected or not)
|
|||
|
select.find('option').eq(entryIndex).prop('selected', notAdded);
|
|||
|
setValueToInput(entriesArray, select);
|
|||
|
|
|||
|
return notAdded;
|
|||
|
}
|
|||
|
|
|||
|
function setValueToInput(entriesArray, select) {
|
|||
|
var value = '';
|
|||
|
|
|||
|
for (var i = 0, count = entriesArray.length; i < count; i++) {
|
|||
|
var text = select.find('option').eq(entriesArray[i]).text();
|
|||
|
|
|||
|
i === 0 ? value += text : value += ', ' + text;
|
|||
|
}
|
|||
|
|
|||
|
if (value === '') {
|
|||
|
value = select.find('option:disabled').eq(0).text();
|
|||
|
}
|
|||
|
|
|||
|
select.siblings('input.select-dropdown').val(value);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
var methods = {
|
|||
|
|
|||
|
init : function(options) {
|
|||
|
var defaults = {
|
|||
|
indicators: true,
|
|||
|
height: 400,
|
|||
|
transition: 500,
|
|||
|
interval: 6000
|
|||
|
};
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
|
|||
|
// For each slider, we want to keep track of
|
|||
|
// which slide is active and its associated content
|
|||
|
var $this = $(this);
|
|||
|
var $slider = $this.find('ul.slides').first();
|
|||
|
var $slides = $slider.find('> li');
|
|||
|
var $active_index = $slider.find('.active').index();
|
|||
|
var $active, $indicators, $interval;
|
|||
|
if ($active_index != -1) { $active = $slides.eq($active_index); }
|
|||
|
|
|||
|
// Transitions the caption depending on alignment
|
|||
|
function captionTransition(caption, duration) {
|
|||
|
if (caption.hasClass("center-align")) {
|
|||
|
caption.velocity({opacity: 0, translateY: -100}, {duration: duration, queue: false});
|
|||
|
}
|
|||
|
else if (caption.hasClass("right-align")) {
|
|||
|
caption.velocity({opacity: 0, translateX: 100}, {duration: duration, queue: false});
|
|||
|
}
|
|||
|
else if (caption.hasClass("left-align")) {
|
|||
|
caption.velocity({opacity: 0, translateX: -100}, {duration: duration, queue: false});
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// This function will transition the slide to any index of the next slide
|
|||
|
function moveToSlide(index) {
|
|||
|
// Wrap around indices.
|
|||
|
if (index >= $slides.length) index = 0;
|
|||
|
else if (index < 0) index = $slides.length -1;
|
|||
|
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
|
|||
|
// Only do if index changes
|
|||
|
if ($active_index != index) {
|
|||
|
$active = $slides.eq($active_index);
|
|||
|
$caption = $active.find('.caption');
|
|||
|
|
|||
|
$active.removeClass('active');
|
|||
|
$active.velocity({opacity: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function() {
|
|||
|
$slides.not('.active').velocity({opacity: 0, translateX: 0, translateY: 0}, {duration: 0, queue: false});
|
|||
|
} });
|
|||
|
captionTransition($caption, options.transition);
|
|||
|
|
|||
|
|
|||
|
// Update indicators
|
|||
|
if (options.indicators) {
|
|||
|
$indicators.eq($active_index).removeClass('active');
|
|||
|
}
|
|||
|
|
|||
|
$slides.eq(index).velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
$slides.eq(index).find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, delay: options.transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
$slides.eq(index).addClass('active');
|
|||
|
|
|||
|
|
|||
|
// Update indicators
|
|||
|
if (options.indicators) {
|
|||
|
$indicators.eq(index).addClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Set height of slider
|
|||
|
// If fullscreen, do nothing
|
|||
|
if (!$this.hasClass('fullscreen')) {
|
|||
|
if (options.indicators) {
|
|||
|
// Add height if indicators are present
|
|||
|
$this.height(options.height + 40);
|
|||
|
}
|
|||
|
else {
|
|||
|
$this.height(options.height);
|
|||
|
}
|
|||
|
$slider.height(options.height);
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Set initial positions of captions
|
|||
|
$slides.find('.caption').each(function () {
|
|||
|
captionTransition($(this), 0);
|
|||
|
});
|
|||
|
|
|||
|
// Move img src into background-image
|
|||
|
$slides.find('img').each(function () {
|
|||
|
var placeholderBase64 = 'data:image/gif;base64,R0lGODlhAQABAIABAP///wAAACH5BAEKAAEALAAAAAABAAEAAAICTAEAOw==';
|
|||
|
if ($(this).attr('src') !== placeholderBase64) {
|
|||
|
$(this).css('background-image', 'url(' + $(this).attr('src') + ')' );
|
|||
|
$(this).attr('src', placeholderBase64);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// dynamically add indicators
|
|||
|
if (options.indicators) {
|
|||
|
$indicators = $('<ul class="indicators"></ul>');
|
|||
|
$slides.each(function( index ) {
|
|||
|
var $indicator = $('<li class="indicator-item"></li>');
|
|||
|
|
|||
|
// Handle clicks on indicators
|
|||
|
$indicator.click(function () {
|
|||
|
var $parent = $slider.parent();
|
|||
|
var curr_index = $parent.find($(this)).index();
|
|||
|
moveToSlide(curr_index);
|
|||
|
|
|||
|
// reset interval
|
|||
|
clearInterval($interval);
|
|||
|
$interval = setInterval(
|
|||
|
function(){
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|||
|
else $active_index += 1;
|
|||
|
|
|||
|
moveToSlide($active_index);
|
|||
|
|
|||
|
}, options.transition + options.interval
|
|||
|
);
|
|||
|
});
|
|||
|
$indicators.append($indicator);
|
|||
|
});
|
|||
|
$this.append($indicators);
|
|||
|
$indicators = $this.find('ul.indicators').find('li.indicator-item');
|
|||
|
}
|
|||
|
|
|||
|
if ($active) {
|
|||
|
$active.show();
|
|||
|
}
|
|||
|
else {
|
|||
|
$slides.first().addClass('active').velocity({opacity: 1}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
|
|||
|
$active_index = 0;
|
|||
|
$active = $slides.eq($active_index);
|
|||
|
|
|||
|
// Update indicators
|
|||
|
if (options.indicators) {
|
|||
|
$indicators.eq($active_index).addClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Adjust height to current slide
|
|||
|
$active.find('img').each(function() {
|
|||
|
$active.find('.caption').velocity({opacity: 1, translateX: 0, translateY: 0}, {duration: options.transition, queue: false, easing: 'easeOutQuad'});
|
|||
|
});
|
|||
|
|
|||
|
// auto scroll
|
|||
|
$interval = setInterval(
|
|||
|
function(){
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
moveToSlide($active_index + 1);
|
|||
|
|
|||
|
}, options.transition + options.interval
|
|||
|
);
|
|||
|
|
|||
|
|
|||
|
// HammerJS, Swipe navigation
|
|||
|
|
|||
|
// Touch Event
|
|||
|
var panning = false;
|
|||
|
var swipeLeft = false;
|
|||
|
var swipeRight = false;
|
|||
|
|
|||
|
$this.hammer({
|
|||
|
prevent_default: false
|
|||
|
}).bind('pan', function(e) {
|
|||
|
if (e.gesture.pointerType === "touch") {
|
|||
|
|
|||
|
// reset interval
|
|||
|
clearInterval($interval);
|
|||
|
|
|||
|
var direction = e.gesture.direction;
|
|||
|
var x = e.gesture.deltaX;
|
|||
|
var velocityX = e.gesture.velocityX;
|
|||
|
var velocityY = e.gesture.velocityY;
|
|||
|
|
|||
|
$curr_slide = $slider.find('.active');
|
|||
|
if (Math.abs(velocityX) > Math.abs(velocityY)) {
|
|||
|
$curr_slide.velocity({ translateX: x
|
|||
|
}, {duration: 50, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
// Swipe Left
|
|||
|
if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.65)) {
|
|||
|
swipeRight = true;
|
|||
|
}
|
|||
|
// Swipe Right
|
|||
|
else if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.65)) {
|
|||
|
swipeLeft = true;
|
|||
|
}
|
|||
|
|
|||
|
// Make Slide Behind active slide visible
|
|||
|
var next_slide;
|
|||
|
if (swipeLeft) {
|
|||
|
next_slide = $curr_slide.next();
|
|||
|
if (next_slide.length === 0) {
|
|||
|
next_slide = $slides.first();
|
|||
|
}
|
|||
|
next_slide.velocity({ opacity: 1
|
|||
|
}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
if (swipeRight) {
|
|||
|
next_slide = $curr_slide.prev();
|
|||
|
if (next_slide.length === 0) {
|
|||
|
next_slide = $slides.last();
|
|||
|
}
|
|||
|
next_slide.velocity({ opacity: 1
|
|||
|
}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
}).bind('panend', function(e) {
|
|||
|
if (e.gesture.pointerType === "touch") {
|
|||
|
|
|||
|
$curr_slide = $slider.find('.active');
|
|||
|
panning = false;
|
|||
|
curr_index = $slider.find('.active').index();
|
|||
|
|
|||
|
if (!swipeRight && !swipeLeft || $slides.length <=1) {
|
|||
|
// Return to original spot
|
|||
|
$curr_slide.velocity({ translateX: 0
|
|||
|
}, {duration: 300, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
else if (swipeLeft) {
|
|||
|
moveToSlide(curr_index + 1);
|
|||
|
$curr_slide.velocity({translateX: -1 * $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function() {
|
|||
|
$curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
|
|||
|
} });
|
|||
|
}
|
|||
|
else if (swipeRight) {
|
|||
|
moveToSlide(curr_index - 1);
|
|||
|
$curr_slide.velocity({translateX: $this.innerWidth() }, {duration: 300, queue: false, easing: 'easeOutQuad',
|
|||
|
complete: function() {
|
|||
|
$curr_slide.velocity({opacity: 0, translateX: 0}, {duration: 0, queue: false});
|
|||
|
} });
|
|||
|
}
|
|||
|
swipeLeft = false;
|
|||
|
swipeRight = false;
|
|||
|
|
|||
|
// Restart interval
|
|||
|
clearInterval($interval);
|
|||
|
$interval = setInterval(
|
|||
|
function(){
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|||
|
else $active_index += 1;
|
|||
|
|
|||
|
moveToSlide($active_index);
|
|||
|
|
|||
|
}, options.transition + options.interval
|
|||
|
);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$this.on('sliderPause', function() {
|
|||
|
clearInterval($interval);
|
|||
|
});
|
|||
|
|
|||
|
$this.on('sliderStart', function() {
|
|||
|
clearInterval($interval);
|
|||
|
$interval = setInterval(
|
|||
|
function(){
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
if ($slides.length == $active_index + 1) $active_index = 0; // loop to start
|
|||
|
else $active_index += 1;
|
|||
|
|
|||
|
moveToSlide($active_index);
|
|||
|
|
|||
|
}, options.transition + options.interval
|
|||
|
);
|
|||
|
});
|
|||
|
|
|||
|
$this.on('sliderNext', function() {
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
moveToSlide($active_index + 1);
|
|||
|
});
|
|||
|
|
|||
|
$this.on('sliderPrev', function() {
|
|||
|
$active_index = $slider.find('.active').index();
|
|||
|
moveToSlide($active_index - 1);
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
|
|||
|
},
|
|||
|
pause : function() {
|
|||
|
$(this).trigger('sliderPause');
|
|||
|
},
|
|||
|
start : function() {
|
|||
|
$(this).trigger('sliderStart');
|
|||
|
},
|
|||
|
next : function() {
|
|||
|
$(this).trigger('sliderNext');
|
|||
|
},
|
|||
|
prev : function() {
|
|||
|
$(this).trigger('sliderPrev');
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
$.fn.slider = function(methodOrOptions) {
|
|||
|
if ( methods[methodOrOptions] ) {
|
|||
|
return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
|||
|
} else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
|
|||
|
// Default to "init"
|
|||
|
return methods.init.apply( this, arguments );
|
|||
|
} else {
|
|||
|
$.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.tooltip' );
|
|||
|
}
|
|||
|
}; // Plugin end
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
$(document).ready(function() {
|
|||
|
|
|||
|
$(document).on('click.card', '.card', function (e) {
|
|||
|
if ($(this).find('> .card-reveal').length) {
|
|||
|
if ($(e.target).is($('.card-reveal .card-title')) || $(e.target).is($('.card-reveal .card-title i'))) {
|
|||
|
// Make Reveal animate down and display none
|
|||
|
$(this).find('.card-reveal').velocity(
|
|||
|
{translateY: 0}, {
|
|||
|
duration: 225,
|
|||
|
queue: false,
|
|||
|
easing: 'easeInOutQuad',
|
|||
|
complete: function() { $(this).css({ display: 'none'}); }
|
|||
|
}
|
|||
|
);
|
|||
|
}
|
|||
|
else if ($(e.target).is($('.card .activator')) ||
|
|||
|
$(e.target).is($('.card .activator i')) ) {
|
|||
|
$(e.target).closest('.card').css('overflow', 'hidden');
|
|||
|
$(this).find('.card-reveal').css({ display: 'block'}).velocity("stop", false).velocity({translateY: '-100%'}, {duration: 300, queue: false, easing: 'easeInOutQuad'});
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
}( jQuery ));;(function ($) {
|
|||
|
var materialChipsDefaults = {
|
|||
|
data: [],
|
|||
|
placeholder: '',
|
|||
|
secondaryPlaceholder: '',
|
|||
|
autocompleteData: {},
|
|||
|
autocompleteLimit: Infinity,
|
|||
|
};
|
|||
|
|
|||
|
$(document).ready(function() {
|
|||
|
// Handle removal of static chips.
|
|||
|
$(document).on('click', '.chip .close', function(e){
|
|||
|
var $chips = $(this).closest('.chips');
|
|||
|
if ($chips.attr('data-initialized')) {
|
|||
|
return;
|
|||
|
}
|
|||
|
$(this).closest('.chip').remove();
|
|||
|
});
|
|||
|
});
|
|||
|
|
|||
|
$.fn.material_chip = function (options) {
|
|||
|
var self = this;
|
|||
|
this.$el = $(this);
|
|||
|
this.$document = $(document);
|
|||
|
this.SELS = {
|
|||
|
CHIPS: '.chips',
|
|||
|
CHIP: '.chip',
|
|||
|
INPUT: 'input',
|
|||
|
DELETE: '.material-icons',
|
|||
|
SELECTED_CHIP: '.selected',
|
|||
|
};
|
|||
|
|
|||
|
if ('data' === options) {
|
|||
|
return this.$el.data('chips');
|
|||
|
}
|
|||
|
|
|||
|
var curr_options = $.extend({}, materialChipsDefaults, options);
|
|||
|
self.hasAutocomplete = !$.isEmptyObject(curr_options.autocompleteData);
|
|||
|
|
|||
|
// Initialize
|
|||
|
this.init = function() {
|
|||
|
var i = 0;
|
|||
|
var chips;
|
|||
|
self.$el.each(function(){
|
|||
|
var $chips = $(this);
|
|||
|
var chipId = Materialize.guid();
|
|||
|
self.chipId = chipId;
|
|||
|
|
|||
|
if (!curr_options.data || !(curr_options.data instanceof Array)) {
|
|||
|
curr_options.data = [];
|
|||
|
}
|
|||
|
$chips.data('chips', curr_options.data);
|
|||
|
$chips.attr('data-index', i);
|
|||
|
$chips.attr('data-initialized', true);
|
|||
|
|
|||
|
if (!$chips.hasClass(self.SELS.CHIPS)) {
|
|||
|
$chips.addClass('chips');
|
|||
|
}
|
|||
|
|
|||
|
self.chips($chips, chipId);
|
|||
|
i++;
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
this.handleEvents = function() {
|
|||
|
var SELS = self.SELS;
|
|||
|
|
|||
|
self.$document.off('click.chips-focus', SELS.CHIPS).on('click.chips-focus', SELS.CHIPS, function(e){
|
|||
|
$(e.target).find(SELS.INPUT).focus();
|
|||
|
});
|
|||
|
|
|||
|
self.$document.off('click.chips-select', SELS.CHIP).on('click.chips-select', SELS.CHIP, function(e){
|
|||
|
var $chip = $(e.target);
|
|||
|
if ($chip.length) {
|
|||
|
var wasSelected = $chip.hasClass('selected');
|
|||
|
var $chips = $chip.closest(SELS.CHIPS);
|
|||
|
$(SELS.CHIP).removeClass('selected');
|
|||
|
|
|||
|
if (!wasSelected) {
|
|||
|
self.selectChip($chip.index(), $chips);
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
self.$document.off('keydown.chips').on('keydown.chips', function(e){
|
|||
|
if ($(e.target).is('input, textarea')) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// delete
|
|||
|
var $chip = self.$document.find(SELS.CHIP + SELS.SELECTED_CHIP);
|
|||
|
var $chips = $chip.closest(SELS.CHIPS);
|
|||
|
var length = $chip.siblings(SELS.CHIP).length;
|
|||
|
var index;
|
|||
|
|
|||
|
if (!$chip.length) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
if (e.which === 8 || e.which === 46) {
|
|||
|
e.preventDefault();
|
|||
|
|
|||
|
index = $chip.index();
|
|||
|
self.deleteChip(index, $chips);
|
|||
|
|
|||
|
var selectIndex = null;
|
|||
|
if ((index + 1) < length) {
|
|||
|
selectIndex = index;
|
|||
|
} else if (index === length || (index + 1) === length) {
|
|||
|
selectIndex = length - 1;
|
|||
|
}
|
|||
|
|
|||
|
if (selectIndex < 0) selectIndex = null;
|
|||
|
|
|||
|
if (null !== selectIndex) {
|
|||
|
self.selectChip(selectIndex, $chips);
|
|||
|
}
|
|||
|
if (!length) $chips.find('input').focus();
|
|||
|
|
|||
|
// left
|
|||
|
} else if (e.which === 37) {
|
|||
|
index = $chip.index() - 1;
|
|||
|
if (index < 0) {
|
|||
|
return;
|
|||
|
}
|
|||
|
$(SELS.CHIP).removeClass('selected');
|
|||
|
self.selectChip(index, $chips);
|
|||
|
|
|||
|
// right
|
|||
|
} else if (e.which === 39) {
|
|||
|
index = $chip.index() + 1;
|
|||
|
$(SELS.CHIP).removeClass('selected');
|
|||
|
if (index > length) {
|
|||
|
$chips.find('input').focus();
|
|||
|
return;
|
|||
|
}
|
|||
|
self.selectChip(index, $chips);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
self.$document.off('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusin.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
|
|||
|
var $currChips = $(e.target).closest(SELS.CHIPS);
|
|||
|
$currChips.addClass('focus');
|
|||
|
$currChips.siblings('label, .prefix').addClass('active');
|
|||
|
$(SELS.CHIP).removeClass('selected');
|
|||
|
});
|
|||
|
|
|||
|
self.$document.off('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT).on('focusout.chips', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
|
|||
|
var $currChips = $(e.target).closest(SELS.CHIPS);
|
|||
|
$currChips.removeClass('focus');
|
|||
|
|
|||
|
// Remove active if empty
|
|||
|
if (!$currChips.data('chips').length) {
|
|||
|
$currChips.siblings('label').removeClass('active');
|
|||
|
}
|
|||
|
$currChips.siblings('.prefix').removeClass('active');
|
|||
|
});
|
|||
|
|
|||
|
self.$document.off('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT).on('keydown.chips-add', SELS.CHIPS + ' ' + SELS.INPUT, function(e){
|
|||
|
var $target = $(e.target);
|
|||
|
var $chips = $target.closest(SELS.CHIPS);
|
|||
|
var chipsLength = $chips.children(SELS.CHIP).length;
|
|||
|
|
|||
|
// enter
|
|||
|
if (13 === e.which) {
|
|||
|
// Override enter if autocompleting.
|
|||
|
if (self.hasAutocomplete &&
|
|||
|
$chips.find('.autocomplete-content.dropdown-content').length &&
|
|||
|
$chips.find('.autocomplete-content.dropdown-content').children().length) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
e.preventDefault();
|
|||
|
self.addChip({tag: $target.val()}, $chips);
|
|||
|
$target.val('');
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
// delete or left
|
|||
|
if ((8 === e.keyCode || 37 === e.keyCode) && '' === $target.val() && chipsLength) {
|
|||
|
e.preventDefault();
|
|||
|
self.selectChip(chipsLength - 1, $chips);
|
|||
|
$target.blur();
|
|||
|
return;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Click on delete icon in chip.
|
|||
|
self.$document.off('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE).on('click.chips-delete', SELS.CHIPS + ' ' + SELS.DELETE, function(e) {
|
|||
|
var $target = $(e.target);
|
|||
|
var $chips = $target.closest(SELS.CHIPS);
|
|||
|
var $chip = $target.closest(SELS.CHIP);
|
|||
|
e.stopPropagation();
|
|||
|
self.deleteChip($chip.index(), $chips);
|
|||
|
$chips.find('input').focus();
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
this.chips = function($chips, chipId) {
|
|||
|
var html = '';
|
|||
|
$chips.data('chips').forEach(function(elem){
|
|||
|
html += self.renderChip(elem);
|
|||
|
});
|
|||
|
html += '<input id="' + chipId +'" class="input" placeholder="">';
|
|||
|
$chips.html(html);
|
|||
|
self.setPlaceholder($chips);
|
|||
|
|
|||
|
// Set for attribute for label
|
|||
|
var label = $chips.next('label');
|
|||
|
if (label.length) {
|
|||
|
label.attr('for', chipId);
|
|||
|
|
|||
|
if ($chips.data('chips').length) {
|
|||
|
label.addClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Setup autocomplete if needed.
|
|||
|
var input = $('#' + chipId);
|
|||
|
if (self.hasAutocomplete) {
|
|||
|
input.autocomplete({
|
|||
|
data: curr_options.autocompleteData,
|
|||
|
limit: curr_options.autocompleteLimit,
|
|||
|
onAutocomplete: function(val) {
|
|||
|
self.addChip({tag: val}, $chips);
|
|||
|
input.val('');
|
|||
|
input.focus();
|
|||
|
},
|
|||
|
})
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
this.renderChip = function(elem) {
|
|||
|
if (!elem.tag) return;
|
|||
|
|
|||
|
var html = '<div class="chip">' + elem.tag;
|
|||
|
if (elem.image) {
|
|||
|
html += ' <img src="' + elem.image + '"> ';
|
|||
|
}
|
|||
|
html += '<i class="material-icons close">close</i>';
|
|||
|
html += '</div>';
|
|||
|
return html;
|
|||
|
};
|
|||
|
|
|||
|
this.setPlaceholder = function($chips) {
|
|||
|
if ($chips.data('chips').length && curr_options.placeholder) {
|
|||
|
$chips.find('input').prop('placeholder', curr_options.placeholder);
|
|||
|
|
|||
|
} else if (!$chips.data('chips').length && curr_options.secondaryPlaceholder) {
|
|||
|
$chips.find('input').prop('placeholder', curr_options.secondaryPlaceholder);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
this.isValid = function($chips, elem) {
|
|||
|
var chips = $chips.data('chips');
|
|||
|
var exists = false;
|
|||
|
for (var i=0; i < chips.length; i++) {
|
|||
|
if (chips[i].tag === elem.tag) {
|
|||
|
exists = true;
|
|||
|
return;
|
|||
|
}
|
|||
|
}
|
|||
|
return '' !== elem.tag && !exists;
|
|||
|
};
|
|||
|
|
|||
|
this.addChip = function(elem, $chips) {
|
|||
|
if (!self.isValid($chips, elem)) {
|
|||
|
return;
|
|||
|
}
|
|||
|
var chipHtml = self.renderChip(elem);
|
|||
|
var newData = [];
|
|||
|
var oldData = $chips.data('chips');
|
|||
|
for (var i = 0; i < oldData.length; i++) {
|
|||
|
newData.push(oldData[i]);
|
|||
|
}
|
|||
|
newData.push(elem);
|
|||
|
|
|||
|
$chips.data('chips', newData);
|
|||
|
$(chipHtml).insertBefore($chips.find('input'));
|
|||
|
$chips.trigger('chip.add', elem);
|
|||
|
self.setPlaceholder($chips);
|
|||
|
};
|
|||
|
|
|||
|
this.deleteChip = function(chipIndex, $chips) {
|
|||
|
var chip = $chips.data('chips')[chipIndex];
|
|||
|
$chips.find('.chip').eq(chipIndex).remove();
|
|||
|
|
|||
|
var newData = [];
|
|||
|
var oldData = $chips.data('chips');
|
|||
|
for (var i = 0; i < oldData.length; i++) {
|
|||
|
if (i !== chipIndex) {
|
|||
|
newData.push(oldData[i]);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
$chips.data('chips', newData);
|
|||
|
$chips.trigger('chip.delete', chip);
|
|||
|
self.setPlaceholder($chips);
|
|||
|
};
|
|||
|
|
|||
|
this.selectChip = function(chipIndex, $chips) {
|
|||
|
var $chip = $chips.find('.chip').eq(chipIndex);
|
|||
|
if ($chip && false === $chip.hasClass('selected')) {
|
|||
|
$chip.addClass('selected');
|
|||
|
$chips.trigger('chip.select', $chips.data('chips')[chipIndex]);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
this.getChipsElement = function(index, $chips) {
|
|||
|
return $chips.eq(index);
|
|||
|
};
|
|||
|
|
|||
|
// init
|
|||
|
this.init();
|
|||
|
|
|||
|
this.handleEvents();
|
|||
|
};
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
$.fn.pushpin = function (options) {
|
|||
|
// Defaults
|
|||
|
var defaults = {
|
|||
|
top: 0,
|
|||
|
bottom: Infinity,
|
|||
|
offset: 0
|
|||
|
};
|
|||
|
|
|||
|
// Remove pushpin event and classes
|
|||
|
if (options === "remove") {
|
|||
|
this.each(function () {
|
|||
|
if (id = $(this).data('pushpin-id')) {
|
|||
|
$(window).off('scroll.' + id);
|
|||
|
$(this).removeData('pushpin-id').removeClass('pin-top pinned pin-bottom').removeAttr('style');
|
|||
|
}
|
|||
|
});
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
|
|||
|
$index = 0;
|
|||
|
return this.each(function() {
|
|||
|
var $uniqueId = Materialize.guid(),
|
|||
|
$this = $(this),
|
|||
|
$original_offset = $(this).offset().top;
|
|||
|
|
|||
|
function removePinClasses(object) {
|
|||
|
object.removeClass('pin-top');
|
|||
|
object.removeClass('pinned');
|
|||
|
object.removeClass('pin-bottom');
|
|||
|
}
|
|||
|
|
|||
|
function updateElements(objects, scrolled) {
|
|||
|
objects.each(function () {
|
|||
|
// Add position fixed (because its between top and bottom)
|
|||
|
if (options.top <= scrolled && options.bottom >= scrolled && !$(this).hasClass('pinned')) {
|
|||
|
removePinClasses($(this));
|
|||
|
$(this).css('top', options.offset);
|
|||
|
$(this).addClass('pinned');
|
|||
|
}
|
|||
|
|
|||
|
// Add pin-top (when scrolled position is above top)
|
|||
|
if (scrolled < options.top && !$(this).hasClass('pin-top')) {
|
|||
|
removePinClasses($(this));
|
|||
|
$(this).css('top', 0);
|
|||
|
$(this).addClass('pin-top');
|
|||
|
}
|
|||
|
|
|||
|
// Add pin-bottom (when scrolled position is below bottom)
|
|||
|
if (scrolled > options.bottom && !$(this).hasClass('pin-bottom')) {
|
|||
|
removePinClasses($(this));
|
|||
|
$(this).addClass('pin-bottom');
|
|||
|
$(this).css('top', options.bottom - $original_offset);
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
|
|||
|
$(this).data('pushpin-id', $uniqueId);
|
|||
|
updateElements($this, $(window).scrollTop());
|
|||
|
$(window).on('scroll.' + $uniqueId, function () {
|
|||
|
var $scrolled = $(window).scrollTop() + options.offset;
|
|||
|
updateElements($this, $scrolled);
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
};
|
|||
|
}( jQuery ));;(function ($) {
|
|||
|
$(document).ready(function() {
|
|||
|
|
|||
|
// jQuery reverse
|
|||
|
$.fn.reverse = [].reverse;
|
|||
|
|
|||
|
// Hover behaviour: make sure this doesn't work on .click-to-toggle FABs!
|
|||
|
$(document).on('mouseenter.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
|
|||
|
var $this = $(this);
|
|||
|
openFABMenu($this);
|
|||
|
});
|
|||
|
$(document).on('mouseleave.fixedActionBtn', '.fixed-action-btn:not(.click-to-toggle):not(.toolbar)', function(e) {
|
|||
|
var $this = $(this);
|
|||
|
closeFABMenu($this);
|
|||
|
});
|
|||
|
|
|||
|
// Toggle-on-click behaviour.
|
|||
|
$(document).on('click.fabClickToggle', '.fixed-action-btn.click-to-toggle > a', function(e) {
|
|||
|
var $this = $(this);
|
|||
|
var $menu = $this.parent();
|
|||
|
if ($menu.hasClass('active')) {
|
|||
|
closeFABMenu($menu);
|
|||
|
} else {
|
|||
|
openFABMenu($menu);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
// Toolbar transition behaviour.
|
|||
|
$(document).on('click.fabToolbar', '.fixed-action-btn.toolbar > a', function(e) {
|
|||
|
var $this = $(this);
|
|||
|
var $menu = $this.parent();
|
|||
|
FABtoToolbar($menu);
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
$.fn.extend({
|
|||
|
openFAB: function() {
|
|||
|
openFABMenu($(this));
|
|||
|
},
|
|||
|
closeFAB: function() {
|
|||
|
closeFABMenu($(this));
|
|||
|
},
|
|||
|
openToolbar: function() {
|
|||
|
FABtoToolbar($(this));
|
|||
|
},
|
|||
|
closeToolbar: function() {
|
|||
|
toolbarToFAB($(this));
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
var openFABMenu = function (btn) {
|
|||
|
var $this = btn;
|
|||
|
if ($this.hasClass('active') === false) {
|
|||
|
|
|||
|
// Get direction option
|
|||
|
var horizontal = $this.hasClass('horizontal');
|
|||
|
var offsetY, offsetX;
|
|||
|
|
|||
|
if (horizontal === true) {
|
|||
|
offsetX = 40;
|
|||
|
} else {
|
|||
|
offsetY = 40;
|
|||
|
}
|
|||
|
|
|||
|
$this.addClass('active');
|
|||
|
$this.find('ul .btn-floating').velocity(
|
|||
|
{ scaleY: ".4", scaleX: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
|
|||
|
{ duration: 0 });
|
|||
|
|
|||
|
var time = 0;
|
|||
|
$this.find('ul .btn-floating').reverse().each( function () {
|
|||
|
$(this).velocity(
|
|||
|
{ opacity: "1", scaleX: "1", scaleY: "1", translateY: "0", translateX: '0'},
|
|||
|
{ duration: 80, delay: time });
|
|||
|
time += 40;
|
|||
|
});
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
var closeFABMenu = function (btn) {
|
|||
|
var $this = btn;
|
|||
|
// Get direction option
|
|||
|
var horizontal = $this.hasClass('horizontal');
|
|||
|
var offsetY, offsetX;
|
|||
|
|
|||
|
if (horizontal === true) {
|
|||
|
offsetX = 40;
|
|||
|
} else {
|
|||
|
offsetY = 40;
|
|||
|
}
|
|||
|
|
|||
|
$this.removeClass('active');
|
|||
|
var time = 0;
|
|||
|
$this.find('ul .btn-floating').velocity("stop", true);
|
|||
|
$this.find('ul .btn-floating').velocity(
|
|||
|
{ opacity: "0", scaleX: ".4", scaleY: ".4", translateY: offsetY + 'px', translateX: offsetX + 'px'},
|
|||
|
{ duration: 80 }
|
|||
|
);
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Transform FAB into toolbar
|
|||
|
* @param {Object} object jQuery object
|
|||
|
*/
|
|||
|
var FABtoToolbar = function(btn) {
|
|||
|
if (btn.attr('data-open') === "true") {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var offsetX, offsetY, scaleFactor;
|
|||
|
var windowWidth = window.innerWidth;
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var btnRect = btn[0].getBoundingClientRect();
|
|||
|
var anchor = btn.find('> a').first();
|
|||
|
var menu = btn.find('> ul').first();
|
|||
|
var backdrop = $('<div class="fab-backdrop"></div>');
|
|||
|
var fabColor = anchor.css('background-color');
|
|||
|
anchor.append(backdrop);
|
|||
|
|
|||
|
offsetX = btnRect.left - (windowWidth / 2) + (btnRect.width / 2);
|
|||
|
offsetY = windowHeight - btnRect.bottom;
|
|||
|
scaleFactor = windowWidth / backdrop.width();
|
|||
|
btn.attr('data-origin-bottom', btnRect.bottom);
|
|||
|
btn.attr('data-origin-left', btnRect.left);
|
|||
|
btn.attr('data-origin-width', btnRect.width);
|
|||
|
|
|||
|
// Set initial state
|
|||
|
btn.addClass('active');
|
|||
|
btn.attr('data-open', true);
|
|||
|
btn.css({
|
|||
|
'text-align': 'center',
|
|||
|
width: '100%',
|
|||
|
bottom: 0,
|
|||
|
left: 0,
|
|||
|
transform: 'translateX(' + offsetX + 'px)',
|
|||
|
transition: 'none'
|
|||
|
});
|
|||
|
anchor.css({
|
|||
|
transform: 'translateY(' + -offsetY + 'px)',
|
|||
|
transition: 'none'
|
|||
|
});
|
|||
|
backdrop.css({
|
|||
|
'background-color': fabColor
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
setTimeout(function() {
|
|||
|
btn.css({
|
|||
|
transform: '',
|
|||
|
transition: 'transform .2s cubic-bezier(0.550, 0.085, 0.680, 0.530), background-color 0s linear .2s'
|
|||
|
});
|
|||
|
anchor.css({
|
|||
|
overflow: 'visible',
|
|||
|
transform: '',
|
|||
|
transition: 'transform .2s'
|
|||
|
});
|
|||
|
|
|||
|
setTimeout(function() {
|
|||
|
btn.css({
|
|||
|
overflow: 'hidden',
|
|||
|
'background-color': fabColor
|
|||
|
});
|
|||
|
backdrop.css({
|
|||
|
transform: 'scale(' + scaleFactor + ')',
|
|||
|
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
|||
|
});
|
|||
|
menu.find('> li > a').css({
|
|||
|
opacity: 1
|
|||
|
});
|
|||
|
|
|||
|
// Scroll to close.
|
|||
|
$(window).on('scroll.fabToolbarClose', function() {
|
|||
|
toolbarToFAB(btn);
|
|||
|
$(window).off('scroll.fabToolbarClose');
|
|||
|
$(document).off('click.fabToolbarClose');
|
|||
|
});
|
|||
|
|
|||
|
$(document).on('click.fabToolbarClose', function(e) {
|
|||
|
if (!$(e.target).closest(menu).length) {
|
|||
|
toolbarToFAB(btn);
|
|||
|
$(window).off('scroll.fabToolbarClose');
|
|||
|
$(document).off('click.fabToolbarClose');
|
|||
|
}
|
|||
|
});
|
|||
|
}, 100);
|
|||
|
}, 0);
|
|||
|
};
|
|||
|
|
|||
|
/**
|
|||
|
* Transform toolbar back into FAB
|
|||
|
* @param {Object} object jQuery object
|
|||
|
*/
|
|||
|
var toolbarToFAB = function(btn) {
|
|||
|
if (btn.attr('data-open') !== "true") {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var offsetX, offsetY, scaleFactor;
|
|||
|
var windowWidth = window.innerWidth;
|
|||
|
var windowHeight = window.innerHeight;
|
|||
|
var btnWidth = btn.attr('data-origin-width');
|
|||
|
var btnBottom = btn.attr('data-origin-bottom');
|
|||
|
var btnLeft = btn.attr('data-origin-left');
|
|||
|
var anchor = btn.find('> .btn-floating').first();
|
|||
|
var menu = btn.find('> ul').first();
|
|||
|
var backdrop = btn.find('.fab-backdrop');
|
|||
|
var fabColor = anchor.css('background-color');
|
|||
|
|
|||
|
offsetX = btnLeft - (windowWidth / 2) + (btnWidth / 2);
|
|||
|
offsetY = windowHeight - btnBottom;
|
|||
|
scaleFactor = windowWidth / backdrop.width();
|
|||
|
|
|||
|
|
|||
|
// Hide backdrop
|
|||
|
btn.removeClass('active');
|
|||
|
btn.attr('data-open', false);
|
|||
|
btn.css({
|
|||
|
'background-color': 'transparent',
|
|||
|
transition: 'none'
|
|||
|
});
|
|||
|
anchor.css({
|
|||
|
transition: 'none'
|
|||
|
});
|
|||
|
backdrop.css({
|
|||
|
transform: 'scale(0)',
|
|||
|
'background-color': fabColor
|
|||
|
});
|
|||
|
menu.find('> li > a').css({
|
|||
|
opacity: ''
|
|||
|
});
|
|||
|
|
|||
|
setTimeout(function() {
|
|||
|
backdrop.remove();
|
|||
|
|
|||
|
// Set initial state.
|
|||
|
btn.css({
|
|||
|
'text-align': '',
|
|||
|
width: '',
|
|||
|
bottom: '',
|
|||
|
left: '',
|
|||
|
overflow: '',
|
|||
|
'background-color': '',
|
|||
|
transform: 'translate3d(' + -offsetX + 'px,0,0)'
|
|||
|
});
|
|||
|
anchor.css({
|
|||
|
overflow: '',
|
|||
|
transform: 'translate3d(0,' + offsetY + 'px,0)'
|
|||
|
});
|
|||
|
|
|||
|
setTimeout(function() {
|
|||
|
btn.css({
|
|||
|
transform: 'translate3d(0,0,0)',
|
|||
|
transition: 'transform .2s'
|
|||
|
});
|
|||
|
anchor.css({
|
|||
|
transform: 'translate3d(0,0,0)',
|
|||
|
transition: 'transform .2s cubic-bezier(0.550, 0.055, 0.675, 0.190)'
|
|||
|
});
|
|||
|
}, 20);
|
|||
|
}, 200);
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
// Image transition function
|
|||
|
Materialize.fadeInImage = function(selectorOrEl) {
|
|||
|
var element;
|
|||
|
if (typeof(selectorOrEl) === 'string') {
|
|||
|
element = $(selectorOrEl);
|
|||
|
} else if (typeof(selectorOrEl) === 'object') {
|
|||
|
element = selectorOrEl;
|
|||
|
} else {
|
|||
|
return;
|
|||
|
}
|
|||
|
element.css({opacity: 0});
|
|||
|
$(element).velocity({opacity: 1}, {
|
|||
|
duration: 650,
|
|||
|
queue: false,
|
|||
|
easing: 'easeOutSine'
|
|||
|
});
|
|||
|
$(element).velocity({opacity: 1}, {
|
|||
|
duration: 1300,
|
|||
|
queue: false,
|
|||
|
easing: 'swing',
|
|||
|
step: function(now, fx) {
|
|||
|
fx.start = 100;
|
|||
|
var grayscale_setting = now/100;
|
|||
|
var brightness_setting = 150 - (100 - now)/1.75;
|
|||
|
|
|||
|
if (brightness_setting < 100) {
|
|||
|
brightness_setting = 100;
|
|||
|
}
|
|||
|
if (now >= 0) {
|
|||
|
$(this).css({
|
|||
|
"-webkit-filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)",
|
|||
|
"filter": "grayscale("+grayscale_setting+")" + "brightness("+brightness_setting+"%)"
|
|||
|
});
|
|||
|
}
|
|||
|
}
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
// Horizontal staggered list
|
|||
|
Materialize.showStaggeredList = function(selectorOrEl) {
|
|||
|
var element;
|
|||
|
if (typeof(selectorOrEl) === 'string') {
|
|||
|
element = $(selectorOrEl);
|
|||
|
} else if (typeof(selectorOrEl) === 'object') {
|
|||
|
element = selectorOrEl;
|
|||
|
} else {
|
|||
|
return;
|
|||
|
}
|
|||
|
var time = 0;
|
|||
|
element.find('li').velocity(
|
|||
|
{ translateX: "-100px"},
|
|||
|
{ duration: 0 });
|
|||
|
|
|||
|
element.find('li').each(function() {
|
|||
|
$(this).velocity(
|
|||
|
{ opacity: "1", translateX: "0"},
|
|||
|
{ duration: 800, delay: time, easing: [60, 10] });
|
|||
|
time += 120;
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
$(document).ready(function() {
|
|||
|
// Hardcoded .staggered-list scrollFire
|
|||
|
// var staggeredListOptions = [];
|
|||
|
// $('ul.staggered-list').each(function (i) {
|
|||
|
|
|||
|
// var label = 'scrollFire-' + i;
|
|||
|
// $(this).addClass(label);
|
|||
|
// staggeredListOptions.push(
|
|||
|
// {selector: 'ul.staggered-list.' + label,
|
|||
|
// offset: 200,
|
|||
|
// callback: 'showStaggeredList("ul.staggered-list.' + label + '")'});
|
|||
|
// });
|
|||
|
// scrollFire(staggeredListOptions);
|
|||
|
|
|||
|
// HammerJS, Swipe navigation
|
|||
|
|
|||
|
// Touch Event
|
|||
|
var swipeLeft = false;
|
|||
|
var swipeRight = false;
|
|||
|
|
|||
|
|
|||
|
// Dismissible Collections
|
|||
|
$('.dismissable').each(function() {
|
|||
|
$(this).hammer({
|
|||
|
prevent_default: false
|
|||
|
}).bind('pan', function(e) {
|
|||
|
if (e.gesture.pointerType === "touch") {
|
|||
|
var $this = $(this);
|
|||
|
var direction = e.gesture.direction;
|
|||
|
var x = e.gesture.deltaX;
|
|||
|
var velocityX = e.gesture.velocityX;
|
|||
|
|
|||
|
$this.velocity({ translateX: x
|
|||
|
}, {duration: 50, queue: false, easing: 'easeOutQuad'});
|
|||
|
|
|||
|
// Swipe Left
|
|||
|
if (direction === 4 && (x > ($this.innerWidth() / 2) || velocityX < -0.75)) {
|
|||
|
swipeLeft = true;
|
|||
|
}
|
|||
|
|
|||
|
// Swipe Right
|
|||
|
if (direction === 2 && (x < (-1 * $this.innerWidth() / 2) || velocityX > 0.75)) {
|
|||
|
swipeRight = true;
|
|||
|
}
|
|||
|
}
|
|||
|
}).bind('panend', function(e) {
|
|||
|
// Reset if collection is moved back into original position
|
|||
|
if (Math.abs(e.gesture.deltaX) < ($(this).innerWidth() / 2)) {
|
|||
|
swipeRight = false;
|
|||
|
swipeLeft = false;
|
|||
|
}
|
|||
|
|
|||
|
if (e.gesture.pointerType === "touch") {
|
|||
|
var $this = $(this);
|
|||
|
if (swipeLeft || swipeRight) {
|
|||
|
var fullWidth;
|
|||
|
if (swipeLeft) { fullWidth = $this.innerWidth(); }
|
|||
|
else { fullWidth = -1 * $this.innerWidth(); }
|
|||
|
|
|||
|
$this.velocity({ translateX: fullWidth,
|
|||
|
}, {duration: 100, queue: false, easing: 'easeOutQuad', complete:
|
|||
|
function() {
|
|||
|
$this.css('border', 'none');
|
|||
|
$this.velocity({ height: 0, padding: 0,
|
|||
|
}, {duration: 200, queue: false, easing: 'easeOutQuad', complete:
|
|||
|
function() { $this.remove(); }
|
|||
|
});
|
|||
|
}
|
|||
|
});
|
|||
|
}
|
|||
|
else {
|
|||
|
$this.velocity({ translateX: 0,
|
|||
|
}, {duration: 100, queue: false, easing: 'easeOutQuad'});
|
|||
|
}
|
|||
|
swipeLeft = false;
|
|||
|
swipeRight = false;
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
// time = 0
|
|||
|
// // Vertical Staggered list
|
|||
|
// $('ul.staggered-list.vertical li').velocity(
|
|||
|
// { translateY: "100px"},
|
|||
|
// { duration: 0 });
|
|||
|
|
|||
|
// $('ul.staggered-list.vertical li').each(function() {
|
|||
|
// $(this).velocity(
|
|||
|
// { opacity: "1", translateY: "0"},
|
|||
|
// { duration: 800, delay: time, easing: [60, 25] });
|
|||
|
// time += 120;
|
|||
|
// });
|
|||
|
|
|||
|
// // Fade in and Scale
|
|||
|
// $('.fade-in.scale').velocity(
|
|||
|
// { scaleX: .4, scaleY: .4, translateX: -600},
|
|||
|
// { duration: 0});
|
|||
|
// $('.fade-in').each(function() {
|
|||
|
// $(this).velocity(
|
|||
|
// { opacity: "1", scaleX: 1, scaleY: 1, translateX: 0},
|
|||
|
// { duration: 800, easing: [60, 10] });
|
|||
|
// });
|
|||
|
});
|
|||
|
}( jQuery ));
|
|||
|
;(function($) {
|
|||
|
|
|||
|
var scrollFireEventsHandled = false;
|
|||
|
|
|||
|
// Input: Array of JSON objects {selector, offset, callback}
|
|||
|
Materialize.scrollFire = function(options) {
|
|||
|
var onScroll = function() {
|
|||
|
var windowScroll = window.pageYOffset + window.innerHeight;
|
|||
|
|
|||
|
for (var i = 0 ; i < options.length; i++) {
|
|||
|
// Get options from each line
|
|||
|
var value = options[i];
|
|||
|
var selector = value.selector,
|
|||
|
offset = value.offset,
|
|||
|
callback = value.callback;
|
|||
|
|
|||
|
var currentElement = document.querySelector(selector);
|
|||
|
if ( currentElement !== null) {
|
|||
|
var elementOffset = currentElement.getBoundingClientRect().top + window.pageYOffset;
|
|||
|
|
|||
|
if (windowScroll > (elementOffset + offset)) {
|
|||
|
if (value.done !== true) {
|
|||
|
if (typeof(callback) === 'function') {
|
|||
|
callback.call(this, currentElement);
|
|||
|
} else if (typeof(callback) === 'string') {
|
|||
|
var callbackFunc = new Function(callback);
|
|||
|
callbackFunc(currentElement);
|
|||
|
}
|
|||
|
value.done = true;
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
var throttledScroll = Materialize.throttle(function() {
|
|||
|
onScroll();
|
|||
|
}, options.throttle || 100);
|
|||
|
|
|||
|
if (!scrollFireEventsHandled) {
|
|||
|
window.addEventListener("scroll", throttledScroll);
|
|||
|
window.addEventListener("resize", throttledScroll);
|
|||
|
scrollFireEventsHandled = true;
|
|||
|
}
|
|||
|
|
|||
|
// perform a scan once, after current execution context, and after dom is ready
|
|||
|
setTimeout(throttledScroll, 0);
|
|||
|
};
|
|||
|
|
|||
|
})(jQuery);
|
|||
|
;/*!
|
|||
|
* pickadate.js v3.5.0, 2014/04/13
|
|||
|
* By Amsul, http://amsul.ca
|
|||
|
* Hosted on http://amsul.github.io/pickadate.js
|
|||
|
* Licensed under MIT
|
|||
|
*/
|
|||
|
|
|||
|
(function ( factory ) {
|
|||
|
|
|||
|
// AMD.
|
|||
|
if ( typeof define == 'function' && define.amd )
|
|||
|
define( 'picker', ['jquery'], factory )
|
|||
|
|
|||
|
// Node.js/browserify.
|
|||
|
else if ( typeof exports == 'object' )
|
|||
|
module.exports = factory( require('jquery') )
|
|||
|
|
|||
|
// Browser globals.
|
|||
|
else this.Picker = factory( jQuery )
|
|||
|
|
|||
|
}(function( $ ) {
|
|||
|
|
|||
|
var $window = $( window )
|
|||
|
var $document = $( document )
|
|||
|
var $html = $( document.documentElement )
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* The picker constructor that creates a blank picker.
|
|||
|
*/
|
|||
|
function PickerConstructor( ELEMENT, NAME, COMPONENT, OPTIONS ) {
|
|||
|
|
|||
|
// If there’s no element, return the picker constructor.
|
|||
|
if ( !ELEMENT ) return PickerConstructor
|
|||
|
|
|||
|
|
|||
|
var
|
|||
|
IS_DEFAULT_THEME = false,
|
|||
|
|
|||
|
|
|||
|
// The state of the picker.
|
|||
|
STATE = {
|
|||
|
id: ELEMENT.id || 'P' + Math.abs( ~~(Math.random() * new Date()) )
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
// Merge the defaults and options passed.
|
|||
|
SETTINGS = COMPONENT ? $.extend( true, {}, COMPONENT.defaults, OPTIONS ) : OPTIONS || {},
|
|||
|
|
|||
|
|
|||
|
// Merge the default classes with the settings classes.
|
|||
|
CLASSES = $.extend( {}, PickerConstructor.klasses(), SETTINGS.klass ),
|
|||
|
|
|||
|
|
|||
|
// The element node wrapper into a jQuery object.
|
|||
|
$ELEMENT = $( ELEMENT ),
|
|||
|
|
|||
|
|
|||
|
// Pseudo picker constructor.
|
|||
|
PickerInstance = function() {
|
|||
|
return this.start()
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
// The picker prototype.
|
|||
|
P = PickerInstance.prototype = {
|
|||
|
|
|||
|
constructor: PickerInstance,
|
|||
|
|
|||
|
$node: $ELEMENT,
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Initialize everything
|
|||
|
*/
|
|||
|
start: function() {
|
|||
|
|
|||
|
// If it’s already started, do nothing.
|
|||
|
if ( STATE && STATE.start ) return P
|
|||
|
|
|||
|
|
|||
|
// Update the picker states.
|
|||
|
STATE.methods = {}
|
|||
|
STATE.start = true
|
|||
|
STATE.open = false
|
|||
|
STATE.type = ELEMENT.type
|
|||
|
|
|||
|
|
|||
|
// Confirm focus state, convert into text input to remove UA stylings,
|
|||
|
// and set as readonly to prevent keyboard popup.
|
|||
|
ELEMENT.autofocus = ELEMENT == getActiveElement()
|
|||
|
ELEMENT.readOnly = !SETTINGS.editable
|
|||
|
ELEMENT.id = ELEMENT.id || STATE.id
|
|||
|
if ( ELEMENT.type != 'text' ) {
|
|||
|
ELEMENT.type = 'text'
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Create a new picker component with the settings.
|
|||
|
P.component = new COMPONENT(P, SETTINGS)
|
|||
|
|
|||
|
|
|||
|
// Create the picker root with a holder and then prepare it.
|
|||
|
P.$root = $( PickerConstructor._.node('div', createWrappedComponent(), CLASSES.picker, 'id="' + ELEMENT.id + '_root" tabindex="0"') )
|
|||
|
prepareElementRoot()
|
|||
|
|
|||
|
|
|||
|
// If there’s a format for the hidden input element, create the element.
|
|||
|
if ( SETTINGS.formatSubmit ) {
|
|||
|
prepareElementHidden()
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Prepare the input element.
|
|||
|
prepareElement()
|
|||
|
|
|||
|
|
|||
|
// Insert the root as specified in the settings.
|
|||
|
if ( SETTINGS.container ) $( SETTINGS.container ).append( P.$root )
|
|||
|
else $ELEMENT.after( P.$root )
|
|||
|
|
|||
|
|
|||
|
// Bind the default component and settings events.
|
|||
|
P.on({
|
|||
|
start: P.component.onStart,
|
|||
|
render: P.component.onRender,
|
|||
|
stop: P.component.onStop,
|
|||
|
open: P.component.onOpen,
|
|||
|
close: P.component.onClose,
|
|||
|
set: P.component.onSet
|
|||
|
}).on({
|
|||
|
start: SETTINGS.onStart,
|
|||
|
render: SETTINGS.onRender,
|
|||
|
stop: SETTINGS.onStop,
|
|||
|
open: SETTINGS.onOpen,
|
|||
|
close: SETTINGS.onClose,
|
|||
|
set: SETTINGS.onSet
|
|||
|
})
|
|||
|
|
|||
|
|
|||
|
// Once we’re all set, check the theme in use.
|
|||
|
IS_DEFAULT_THEME = isUsingDefaultTheme( P.$root.children()[ 0 ] )
|
|||
|
|
|||
|
|
|||
|
// If the element has autofocus, open the picker.
|
|||
|
if ( ELEMENT.autofocus ) {
|
|||
|
P.open()
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Trigger queued the “start” and “render” events.
|
|||
|
return P.trigger( 'start' ).trigger( 'render' )
|
|||
|
}, //start
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Render a new picker
|
|||
|
*/
|
|||
|
render: function( entireComponent ) {
|
|||
|
|
|||
|
// Insert a new component holder in the root or box.
|
|||
|
if ( entireComponent ) P.$root.html( createWrappedComponent() )
|
|||
|
else P.$root.find( '.' + CLASSES.box ).html( P.component.nodes( STATE.open ) )
|
|||
|
|
|||
|
// Trigger the queued “render” events.
|
|||
|
return P.trigger( 'render' )
|
|||
|
}, //render
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Destroy everything
|
|||
|
*/
|
|||
|
stop: function() {
|
|||
|
|
|||
|
// If it’s already stopped, do nothing.
|
|||
|
if ( !STATE.start ) return P
|
|||
|
|
|||
|
// Then close the picker.
|
|||
|
P.close()
|
|||
|
|
|||
|
// Remove the hidden field.
|
|||
|
if ( P._hidden ) {
|
|||
|
P._hidden.parentNode.removeChild( P._hidden )
|
|||
|
}
|
|||
|
|
|||
|
// Remove the root.
|
|||
|
P.$root.remove()
|
|||
|
|
|||
|
// Remove the input class, remove the stored data, and unbind
|
|||
|
// the events (after a tick for IE - see `P.close`).
|
|||
|
$ELEMENT.removeClass( CLASSES.input ).removeData( NAME )
|
|||
|
setTimeout( function() {
|
|||
|
$ELEMENT.off( '.' + STATE.id )
|
|||
|
}, 0)
|
|||
|
|
|||
|
// Restore the element state
|
|||
|
ELEMENT.type = STATE.type
|
|||
|
ELEMENT.readOnly = false
|
|||
|
|
|||
|
// Trigger the queued “stop” events.
|
|||
|
P.trigger( 'stop' )
|
|||
|
|
|||
|
// Reset the picker states.
|
|||
|
STATE.methods = {}
|
|||
|
STATE.start = false
|
|||
|
|
|||
|
return P
|
|||
|
}, //stop
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Open up the picker
|
|||
|
*/
|
|||
|
open: function( dontGiveFocus ) {
|
|||
|
|
|||
|
// If it’s already open, do nothing.
|
|||
|
if ( STATE.open ) return P
|
|||
|
|
|||
|
// Add the “active” class.
|
|||
|
$ELEMENT.addClass( CLASSES.active )
|
|||
|
aria( ELEMENT, 'expanded', true )
|
|||
|
|
|||
|
// * A Firefox bug, when `html` has `overflow:hidden`, results in
|
|||
|
// killing transitions :(. So add the “opened” state on the next tick.
|
|||
|
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
|||
|
setTimeout( function() {
|
|||
|
|
|||
|
// Add the “opened” class to the picker root.
|
|||
|
P.$root.addClass( CLASSES.opened )
|
|||
|
aria( P.$root[0], 'hidden', false )
|
|||
|
|
|||
|
}, 0 )
|
|||
|
|
|||
|
// If we have to give focus, bind the element and doc events.
|
|||
|
if ( dontGiveFocus !== false ) {
|
|||
|
|
|||
|
// Set it as open.
|
|||
|
STATE.open = true
|
|||
|
|
|||
|
// Prevent the page from scrolling.
|
|||
|
if ( IS_DEFAULT_THEME ) {
|
|||
|
$html.
|
|||
|
css( 'overflow', 'hidden' ).
|
|||
|
css( 'padding-right', '+=' + getScrollbarWidth() )
|
|||
|
}
|
|||
|
|
|||
|
// Pass focus to the root element’s jQuery object.
|
|||
|
// * Workaround for iOS8 to bring the picker’s root into view.
|
|||
|
P.$root.eq(0).focus()
|
|||
|
|
|||
|
// Bind the document events.
|
|||
|
$document.on( 'click.' + STATE.id + ' focusin.' + STATE.id, function( event ) {
|
|||
|
|
|||
|
var target = event.target
|
|||
|
|
|||
|
// If the target of the event is not the element, close the picker picker.
|
|||
|
// * Don’t worry about clicks or focusins on the root because those don’t bubble up.
|
|||
|
// Also, for Firefox, a click on an `option` element bubbles up directly
|
|||
|
// to the doc. So make sure the target wasn't the doc.
|
|||
|
// * In Firefox stopPropagation() doesn’t prevent right-click events from bubbling,
|
|||
|
// which causes the picker to unexpectedly close when right-clicking it. So make
|
|||
|
// sure the event wasn’t a right-click.
|
|||
|
if ( target != ELEMENT && target != document && event.which != 3 ) {
|
|||
|
|
|||
|
// If the target was the holder that covers the screen,
|
|||
|
// keep the element focused to maintain tabindex.
|
|||
|
P.close( target === P.$root.children()[0] )
|
|||
|
}
|
|||
|
|
|||
|
}).on( 'keydown.' + STATE.id, function( event ) {
|
|||
|
|
|||
|
var
|
|||
|
// Get the keycode.
|
|||
|
keycode = event.keyCode,
|
|||
|
|
|||
|
// Translate that to a selection change.
|
|||
|
keycodeToMove = P.component.key[ keycode ],
|
|||
|
|
|||
|
// Grab the target.
|
|||
|
target = event.target
|
|||
|
|
|||
|
|
|||
|
// On escape, close the picker and give focus.
|
|||
|
if ( keycode == 27 ) {
|
|||
|
P.close( true )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Check if there is a key movement or “enter” keypress on the element.
|
|||
|
else if ( target == P.$root[0] && ( keycodeToMove || keycode == 13 ) ) {
|
|||
|
|
|||
|
// Prevent the default action to stop page movement.
|
|||
|
event.preventDefault()
|
|||
|
|
|||
|
// Trigger the key movement action.
|
|||
|
if ( keycodeToMove ) {
|
|||
|
PickerConstructor._.trigger( P.component.key.go, P, [ PickerConstructor._.trigger( keycodeToMove ) ] )
|
|||
|
}
|
|||
|
|
|||
|
// On “enter”, if the highlighted item isn’t disabled, set the value and close.
|
|||
|
else if ( !P.$root.find( '.' + CLASSES.highlighted ).hasClass( CLASSES.disabled ) ) {
|
|||
|
P.set( 'select', P.component.item.highlight ).close()
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// If the target is within the root and “enter” is pressed,
|
|||
|
// prevent the default action and trigger a click on the target instead.
|
|||
|
else if ( $.contains( P.$root[0], target ) && keycode == 13 ) {
|
|||
|
event.preventDefault()
|
|||
|
target.click()
|
|||
|
}
|
|||
|
})
|
|||
|
}
|
|||
|
|
|||
|
// Trigger the queued “open” events.
|
|||
|
return P.trigger( 'open' )
|
|||
|
}, //open
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Close the picker
|
|||
|
*/
|
|||
|
close: function( giveFocus ) {
|
|||
|
|
|||
|
// If we need to give focus, do it before changing states.
|
|||
|
if ( giveFocus ) {
|
|||
|
// ....ah yes! It would’ve been incomplete without a crazy workaround for IE :|
|
|||
|
// The focus is triggered *after* the close has completed - causing it
|
|||
|
// to open again. So unbind and rebind the event at the next tick.
|
|||
|
P.$root.off( 'focus.toOpen' ).eq(0).focus()
|
|||
|
setTimeout( function() {
|
|||
|
P.$root.on( 'focus.toOpen', handleFocusToOpenEvent )
|
|||
|
}, 0 )
|
|||
|
}
|
|||
|
|
|||
|
// Remove the “active” class.
|
|||
|
$ELEMENT.removeClass( CLASSES.active )
|
|||
|
aria( ELEMENT, 'expanded', false )
|
|||
|
|
|||
|
// * A Firefox bug, when `html` has `overflow:hidden`, results in
|
|||
|
// killing transitions :(. So remove the “opened” state on the next tick.
|
|||
|
// Bug: https://bugzilla.mozilla.org/show_bug.cgi?id=625289
|
|||
|
setTimeout( function() {
|
|||
|
|
|||
|
// Remove the “opened” and “focused” class from the picker root.
|
|||
|
P.$root.removeClass( CLASSES.opened + ' ' + CLASSES.focused )
|
|||
|
aria( P.$root[0], 'hidden', true )
|
|||
|
|
|||
|
}, 0 )
|
|||
|
|
|||
|
// If it’s already closed, do nothing more.
|
|||
|
if ( !STATE.open ) return P
|
|||
|
|
|||
|
// Set it as closed.
|
|||
|
STATE.open = false
|
|||
|
|
|||
|
// Allow the page to scroll.
|
|||
|
if ( IS_DEFAULT_THEME ) {
|
|||
|
$html.
|
|||
|
css( 'overflow', '' ).
|
|||
|
css( 'padding-right', '-=' + getScrollbarWidth() )
|
|||
|
}
|
|||
|
|
|||
|
// Unbind the document events.
|
|||
|
$document.off( '.' + STATE.id )
|
|||
|
|
|||
|
// Trigger the queued “close” events.
|
|||
|
return P.trigger( 'close' )
|
|||
|
}, //close
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Clear the values
|
|||
|
*/
|
|||
|
clear: function( options ) {
|
|||
|
return P.set( 'clear', null, options )
|
|||
|
}, //clear
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Set something
|
|||
|
*/
|
|||
|
set: function( thing, value, options ) {
|
|||
|
|
|||
|
var thingItem, thingValue,
|
|||
|
thingIsObject = $.isPlainObject( thing ),
|
|||
|
thingObject = thingIsObject ? thing : {}
|
|||
|
|
|||
|
// Make sure we have usable options.
|
|||
|
options = thingIsObject && $.isPlainObject( value ) ? value : options || {}
|
|||
|
|
|||
|
if ( thing ) {
|
|||
|
|
|||
|
// If the thing isn’t an object, make it one.
|
|||
|
if ( !thingIsObject ) {
|
|||
|
thingObject[ thing ] = value
|
|||
|
}
|
|||
|
|
|||
|
// Go through the things of items to set.
|
|||
|
for ( thingItem in thingObject ) {
|
|||
|
|
|||
|
// Grab the value of the thing.
|
|||
|
thingValue = thingObject[ thingItem ]
|
|||
|
|
|||
|
// First, if the item exists and there’s a value, set it.
|
|||
|
if ( thingItem in P.component.item ) {
|
|||
|
if ( thingValue === undefined ) thingValue = null
|
|||
|
P.component.set( thingItem, thingValue, options )
|
|||
|
}
|
|||
|
|
|||
|
// Then, check to update the element value and broadcast a change.
|
|||
|
if ( thingItem == 'select' || thingItem == 'clear' ) {
|
|||
|
$ELEMENT.
|
|||
|
val( thingItem == 'clear' ? '' : P.get( thingItem, SETTINGS.format ) ).
|
|||
|
trigger( 'change' )
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Render a new picker.
|
|||
|
P.render()
|
|||
|
}
|
|||
|
|
|||
|
// When the method isn’t muted, trigger queued “set” events and pass the `thingObject`.
|
|||
|
return options.muted ? P : P.trigger( 'set', thingObject )
|
|||
|
}, //set
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Get something
|
|||
|
*/
|
|||
|
get: function( thing, format ) {
|
|||
|
|
|||
|
// Make sure there’s something to get.
|
|||
|
thing = thing || 'value'
|
|||
|
|
|||
|
// If a picker state exists, return that.
|
|||
|
if ( STATE[ thing ] != null ) {
|
|||
|
return STATE[ thing ]
|
|||
|
}
|
|||
|
|
|||
|
// Return the submission value, if that.
|
|||
|
if ( thing == 'valueSubmit' ) {
|
|||
|
if ( P._hidden ) {
|
|||
|
return P._hidden.value
|
|||
|
}
|
|||
|
thing = 'value'
|
|||
|
}
|
|||
|
|
|||
|
// Return the value, if that.
|
|||
|
if ( thing == 'value' ) {
|
|||
|
return ELEMENT.value
|
|||
|
}
|
|||
|
|
|||
|
// Check if a component item exists, return that.
|
|||
|
if ( thing in P.component.item ) {
|
|||
|
if ( typeof format == 'string' ) {
|
|||
|
var thingValue = P.component.get( thing )
|
|||
|
return thingValue ?
|
|||
|
PickerConstructor._.trigger(
|
|||
|
P.component.formats.toString,
|
|||
|
P.component,
|
|||
|
[ format, thingValue ]
|
|||
|
) : ''
|
|||
|
}
|
|||
|
return P.component.get( thing )
|
|||
|
}
|
|||
|
}, //get
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Bind events on the things.
|
|||
|
*/
|
|||
|
on: function( thing, method, internal ) {
|
|||
|
|
|||
|
var thingName, thingMethod,
|
|||
|
thingIsObject = $.isPlainObject( thing ),
|
|||
|
thingObject = thingIsObject ? thing : {}
|
|||
|
|
|||
|
if ( thing ) {
|
|||
|
|
|||
|
// If the thing isn’t an object, make it one.
|
|||
|
if ( !thingIsObject ) {
|
|||
|
thingObject[ thing ] = method
|
|||
|
}
|
|||
|
|
|||
|
// Go through the things to bind to.
|
|||
|
for ( thingName in thingObject ) {
|
|||
|
|
|||
|
// Grab the method of the thing.
|
|||
|
thingMethod = thingObject[ thingName ]
|
|||
|
|
|||
|
// If it was an internal binding, prefix it.
|
|||
|
if ( internal ) {
|
|||
|
thingName = '_' + thingName
|
|||
|
}
|
|||
|
|
|||
|
// Make sure the thing methods collection exists.
|
|||
|
STATE.methods[ thingName ] = STATE.methods[ thingName ] || []
|
|||
|
|
|||
|
// Add the method to the relative method collection.
|
|||
|
STATE.methods[ thingName ].push( thingMethod )
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
return P
|
|||
|
}, //on
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Unbind events on the things.
|
|||
|
*/
|
|||
|
off: function() {
|
|||
|
var i, thingName,
|
|||
|
names = arguments;
|
|||
|
for ( i = 0, namesCount = names.length; i < namesCount; i += 1 ) {
|
|||
|
thingName = names[i]
|
|||
|
if ( thingName in STATE.methods ) {
|
|||
|
delete STATE.methods[thingName]
|
|||
|
}
|
|||
|
}
|
|||
|
return P
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Fire off method events.
|
|||
|
*/
|
|||
|
trigger: function( name, data ) {
|
|||
|
var _trigger = function( name ) {
|
|||
|
var methodList = STATE.methods[ name ]
|
|||
|
if ( methodList ) {
|
|||
|
methodList.map( function( method ) {
|
|||
|
PickerConstructor._.trigger( method, P, [ data ] )
|
|||
|
})
|
|||
|
}
|
|||
|
}
|
|||
|
_trigger( '_' + name )
|
|||
|
_trigger( name )
|
|||
|
return P
|
|||
|
} //trigger
|
|||
|
} //PickerInstance.prototype
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Wrap the picker holder components together.
|
|||
|
*/
|
|||
|
function createWrappedComponent() {
|
|||
|
|
|||
|
// Create a picker wrapper holder
|
|||
|
return PickerConstructor._.node( 'div',
|
|||
|
|
|||
|
// Create a picker wrapper node
|
|||
|
PickerConstructor._.node( 'div',
|
|||
|
|
|||
|
// Create a picker frame
|
|||
|
PickerConstructor._.node( 'div',
|
|||
|
|
|||
|
// Create a picker box node
|
|||
|
PickerConstructor._.node( 'div',
|
|||
|
|
|||
|
// Create the components nodes.
|
|||
|
P.component.nodes( STATE.open ),
|
|||
|
|
|||
|
// The picker box class
|
|||
|
CLASSES.box
|
|||
|
),
|
|||
|
|
|||
|
// Picker wrap class
|
|||
|
CLASSES.wrap
|
|||
|
),
|
|||
|
|
|||
|
// Picker frame class
|
|||
|
CLASSES.frame
|
|||
|
),
|
|||
|
|
|||
|
// Picker holder class
|
|||
|
CLASSES.holder
|
|||
|
) //endreturn
|
|||
|
} //createWrappedComponent
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Prepare the input element with all bindings.
|
|||
|
*/
|
|||
|
function prepareElement() {
|
|||
|
|
|||
|
$ELEMENT.
|
|||
|
|
|||
|
// Store the picker data by component name.
|
|||
|
data(NAME, P).
|
|||
|
|
|||
|
// Add the “input” class name.
|
|||
|
addClass(CLASSES.input).
|
|||
|
|
|||
|
// Remove the tabindex.
|
|||
|
attr('tabindex', -1).
|
|||
|
|
|||
|
// If there’s a `data-value`, update the value of the element.
|
|||
|
val( $ELEMENT.data('value') ?
|
|||
|
P.get('select', SETTINGS.format) :
|
|||
|
ELEMENT.value
|
|||
|
)
|
|||
|
|
|||
|
|
|||
|
// Only bind keydown events if the element isn’t editable.
|
|||
|
if ( !SETTINGS.editable ) {
|
|||
|
|
|||
|
$ELEMENT.
|
|||
|
|
|||
|
// On focus/click, focus onto the root to open it up.
|
|||
|
on( 'focus.' + STATE.id + ' click.' + STATE.id, function( event ) {
|
|||
|
event.preventDefault()
|
|||
|
P.$root.eq(0).focus()
|
|||
|
}).
|
|||
|
|
|||
|
// Handle keyboard event based on the picker being opened or not.
|
|||
|
on( 'keydown.' + STATE.id, handleKeydownEvent )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Update the aria attributes.
|
|||
|
aria(ELEMENT, {
|
|||
|
haspopup: true,
|
|||
|
expanded: false,
|
|||
|
readonly: false,
|
|||
|
owns: ELEMENT.id + '_root'
|
|||
|
})
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Prepare the root picker element with all bindings.
|
|||
|
*/
|
|||
|
function prepareElementRoot() {
|
|||
|
|
|||
|
P.$root.
|
|||
|
|
|||
|
on({
|
|||
|
|
|||
|
// For iOS8.
|
|||
|
keydown: handleKeydownEvent,
|
|||
|
|
|||
|
// When something within the root is focused, stop from bubbling
|
|||
|
// to the doc and remove the “focused” state from the root.
|
|||
|
focusin: function( event ) {
|
|||
|
P.$root.removeClass( CLASSES.focused )
|
|||
|
event.stopPropagation()
|
|||
|
},
|
|||
|
|
|||
|
// When something within the root holder is clicked, stop it
|
|||
|
// from bubbling to the doc.
|
|||
|
'mousedown click': function( event ) {
|
|||
|
|
|||
|
var target = event.target
|
|||
|
|
|||
|
// Make sure the target isn’t the root holder so it can bubble up.
|
|||
|
if ( target != P.$root.children()[ 0 ] ) {
|
|||
|
|
|||
|
event.stopPropagation()
|
|||
|
|
|||
|
// * For mousedown events, cancel the default action in order to
|
|||
|
// prevent cases where focus is shifted onto external elements
|
|||
|
// when using things like jQuery mobile or MagnificPopup (ref: #249 & #120).
|
|||
|
// Also, for Firefox, don’t prevent action on the `option` element.
|
|||
|
if ( event.type == 'mousedown' && !$( target ).is( 'input, select, textarea, button, option' )) {
|
|||
|
|
|||
|
event.preventDefault()
|
|||
|
|
|||
|
// Re-focus onto the root so that users can click away
|
|||
|
// from elements focused within the picker.
|
|||
|
P.$root.eq(0).focus()
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
}).
|
|||
|
|
|||
|
// Add/remove the “target” class on focus and blur.
|
|||
|
on({
|
|||
|
focus: function() {
|
|||
|
$ELEMENT.addClass( CLASSES.target )
|
|||
|
},
|
|||
|
blur: function() {
|
|||
|
$ELEMENT.removeClass( CLASSES.target )
|
|||
|
}
|
|||
|
}).
|
|||
|
|
|||
|
// Open the picker and adjust the root “focused” state
|
|||
|
on( 'focus.toOpen', handleFocusToOpenEvent ).
|
|||
|
|
|||
|
// If there’s a click on an actionable element, carry out the actions.
|
|||
|
on( 'click', '[data-pick], [data-nav], [data-clear], [data-close]', function() {
|
|||
|
|
|||
|
var $target = $( this ),
|
|||
|
targetData = $target.data(),
|
|||
|
targetDisabled = $target.hasClass( CLASSES.navDisabled ) || $target.hasClass( CLASSES.disabled ),
|
|||
|
|
|||
|
// * For IE, non-focusable elements can be active elements as well
|
|||
|
// (http://stackoverflow.com/a/2684561).
|
|||
|
activeElement = getActiveElement()
|
|||
|
activeElement = activeElement && ( activeElement.type || activeElement.href )
|
|||
|
|
|||
|
// If it’s disabled or nothing inside is actively focused, re-focus the element.
|
|||
|
if ( targetDisabled || activeElement && !$.contains( P.$root[0], activeElement ) ) {
|
|||
|
P.$root.eq(0).focus()
|
|||
|
}
|
|||
|
|
|||
|
// If something is superficially changed, update the `highlight` based on the `nav`.
|
|||
|
if ( !targetDisabled && targetData.nav ) {
|
|||
|
P.set( 'highlight', P.component.item.highlight, { nav: targetData.nav } )
|
|||
|
}
|
|||
|
|
|||
|
// If something is picked, set `select` then close with focus.
|
|||
|
else if ( !targetDisabled && 'pick' in targetData ) {
|
|||
|
P.set( 'select', targetData.pick )
|
|||
|
}
|
|||
|
|
|||
|
// If a “clear” button is pressed, empty the values and close with focus.
|
|||
|
else if ( targetData.clear ) {
|
|||
|
P.clear().close( true )
|
|||
|
}
|
|||
|
|
|||
|
else if ( targetData.close ) {
|
|||
|
P.close( true )
|
|||
|
}
|
|||
|
|
|||
|
}) //P.$root
|
|||
|
|
|||
|
aria( P.$root[0], 'hidden', true )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Prepare the hidden input element along with all bindings.
|
|||
|
*/
|
|||
|
function prepareElementHidden() {
|
|||
|
|
|||
|
var name
|
|||
|
|
|||
|
if ( SETTINGS.hiddenName === true ) {
|
|||
|
name = ELEMENT.name
|
|||
|
ELEMENT.name = ''
|
|||
|
}
|
|||
|
else {
|
|||
|
name = [
|
|||
|
typeof SETTINGS.hiddenPrefix == 'string' ? SETTINGS.hiddenPrefix : '',
|
|||
|
typeof SETTINGS.hiddenSuffix == 'string' ? SETTINGS.hiddenSuffix : '_submit'
|
|||
|
]
|
|||
|
name = name[0] + ELEMENT.name + name[1]
|
|||
|
}
|
|||
|
|
|||
|
P._hidden = $(
|
|||
|
'<input ' +
|
|||
|
'type=hidden ' +
|
|||
|
|
|||
|
// Create the name using the original input’s with a prefix and suffix.
|
|||
|
'name="' + name + '"' +
|
|||
|
|
|||
|
// If the element has a value, set the hidden value as well.
|
|||
|
(
|
|||
|
$ELEMENT.data('value') || ELEMENT.value ?
|
|||
|
' value="' + P.get('select', SETTINGS.formatSubmit) + '"' :
|
|||
|
''
|
|||
|
) +
|
|||
|
'>'
|
|||
|
)[0]
|
|||
|
|
|||
|
$ELEMENT.
|
|||
|
|
|||
|
// If the value changes, update the hidden input with the correct format.
|
|||
|
on('change.' + STATE.id, function() {
|
|||
|
P._hidden.value = ELEMENT.value ?
|
|||
|
P.get('select', SETTINGS.formatSubmit) :
|
|||
|
''
|
|||
|
})
|
|||
|
|
|||
|
|
|||
|
// Insert the hidden input as specified in the settings.
|
|||
|
if ( SETTINGS.container ) $( SETTINGS.container ).append( P._hidden )
|
|||
|
else $ELEMENT.after( P._hidden )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// For iOS8.
|
|||
|
function handleKeydownEvent( event ) {
|
|||
|
|
|||
|
var keycode = event.keyCode,
|
|||
|
|
|||
|
// Check if one of the delete keys was pressed.
|
|||
|
isKeycodeDelete = /^(8|46)$/.test(keycode)
|
|||
|
|
|||
|
// For some reason IE clears the input value on “escape”.
|
|||
|
if ( keycode == 27 ) {
|
|||
|
P.close()
|
|||
|
return false
|
|||
|
}
|
|||
|
|
|||
|
// Check if `space` or `delete` was pressed or the picker is closed with a key movement.
|
|||
|
if ( keycode == 32 || isKeycodeDelete || !STATE.open && P.component.key[keycode] ) {
|
|||
|
|
|||
|
// Prevent it from moving the page and bubbling to doc.
|
|||
|
event.preventDefault()
|
|||
|
event.stopPropagation()
|
|||
|
|
|||
|
// If `delete` was pressed, clear the values and close the picker.
|
|||
|
// Otherwise open the picker.
|
|||
|
if ( isKeycodeDelete ) { P.clear().close() }
|
|||
|
else { P.open() }
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Separated for IE
|
|||
|
function handleFocusToOpenEvent( event ) {
|
|||
|
|
|||
|
// Stop the event from propagating to the doc.
|
|||
|
event.stopPropagation()
|
|||
|
|
|||
|
// If it’s a focus event, add the “focused” class to the root.
|
|||
|
if ( event.type == 'focus' ) {
|
|||
|
P.$root.addClass( CLASSES.focused )
|
|||
|
}
|
|||
|
|
|||
|
// And then finally open the picker.
|
|||
|
P.open()
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Return a new picker instance.
|
|||
|
return new PickerInstance()
|
|||
|
} //PickerConstructor
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* The default classes and prefix to use for the HTML classes.
|
|||
|
*/
|
|||
|
PickerConstructor.klasses = function( prefix ) {
|
|||
|
prefix = prefix || 'picker'
|
|||
|
return {
|
|||
|
|
|||
|
picker: prefix,
|
|||
|
opened: prefix + '--opened',
|
|||
|
focused: prefix + '--focused',
|
|||
|
|
|||
|
input: prefix + '__input',
|
|||
|
active: prefix + '__input--active',
|
|||
|
target: prefix + '__input--target',
|
|||
|
|
|||
|
holder: prefix + '__holder',
|
|||
|
|
|||
|
frame: prefix + '__frame',
|
|||
|
wrap: prefix + '__wrap',
|
|||
|
|
|||
|
box: prefix + '__box'
|
|||
|
}
|
|||
|
} //PickerConstructor.klasses
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if the default theme is being used.
|
|||
|
*/
|
|||
|
function isUsingDefaultTheme( element ) {
|
|||
|
|
|||
|
var theme,
|
|||
|
prop = 'position'
|
|||
|
|
|||
|
// For IE.
|
|||
|
if ( element.currentStyle ) {
|
|||
|
theme = element.currentStyle[prop]
|
|||
|
}
|
|||
|
|
|||
|
// For normal browsers.
|
|||
|
else if ( window.getComputedStyle ) {
|
|||
|
theme = getComputedStyle( element )[prop]
|
|||
|
}
|
|||
|
|
|||
|
return theme == 'fixed'
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Get the width of the browser’s scrollbar.
|
|||
|
* Taken from: https://github.com/VodkaBears/Remodal/blob/master/src/jquery.remodal.js
|
|||
|
*/
|
|||
|
function getScrollbarWidth() {
|
|||
|
|
|||
|
if ( $html.height() <= $window.height() ) {
|
|||
|
return 0
|
|||
|
}
|
|||
|
|
|||
|
var $outer = $( '<div style="visibility:hidden;width:100px" />' ).
|
|||
|
appendTo( 'body' )
|
|||
|
|
|||
|
// Get the width without scrollbars.
|
|||
|
var widthWithoutScroll = $outer[0].offsetWidth
|
|||
|
|
|||
|
// Force adding scrollbars.
|
|||
|
$outer.css( 'overflow', 'scroll' )
|
|||
|
|
|||
|
// Add the inner div.
|
|||
|
var $inner = $( '<div style="width:100%" />' ).appendTo( $outer )
|
|||
|
|
|||
|
// Get the width with scrollbars.
|
|||
|
var widthWithScroll = $inner[0].offsetWidth
|
|||
|
|
|||
|
// Remove the divs.
|
|||
|
$outer.remove()
|
|||
|
|
|||
|
// Return the difference between the widths.
|
|||
|
return widthWithoutScroll - widthWithScroll
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* PickerConstructor helper methods.
|
|||
|
*/
|
|||
|
PickerConstructor._ = {
|
|||
|
|
|||
|
/**
|
|||
|
* Create a group of nodes. Expects:
|
|||
|
* `
|
|||
|
{
|
|||
|
min: {Integer},
|
|||
|
max: {Integer},
|
|||
|
i: {Integer},
|
|||
|
node: {String},
|
|||
|
item: {Function}
|
|||
|
}
|
|||
|
* `
|
|||
|
*/
|
|||
|
group: function( groupObject ) {
|
|||
|
|
|||
|
var
|
|||
|
// Scope for the looped object
|
|||
|
loopObjectScope,
|
|||
|
|
|||
|
// Create the nodes list
|
|||
|
nodesList = '',
|
|||
|
|
|||
|
// The counter starts from the `min`
|
|||
|
counter = PickerConstructor._.trigger( groupObject.min, groupObject )
|
|||
|
|
|||
|
|
|||
|
// Loop from the `min` to `max`, incrementing by `i`
|
|||
|
for ( ; counter <= PickerConstructor._.trigger( groupObject.max, groupObject, [ counter ] ); counter += groupObject.i ) {
|
|||
|
|
|||
|
// Trigger the `item` function within scope of the object
|
|||
|
loopObjectScope = PickerConstructor._.trigger( groupObject.item, groupObject, [ counter ] )
|
|||
|
|
|||
|
// Splice the subgroup and create nodes out of the sub nodes
|
|||
|
nodesList += PickerConstructor._.node(
|
|||
|
groupObject.node,
|
|||
|
loopObjectScope[ 0 ], // the node
|
|||
|
loopObjectScope[ 1 ], // the classes
|
|||
|
loopObjectScope[ 2 ] // the attributes
|
|||
|
)
|
|||
|
}
|
|||
|
|
|||
|
// Return the list of nodes
|
|||
|
return nodesList
|
|||
|
}, //group
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create a dom node string
|
|||
|
*/
|
|||
|
node: function( wrapper, item, klass, attribute ) {
|
|||
|
|
|||
|
// If the item is false-y, just return an empty string
|
|||
|
if ( !item ) return ''
|
|||
|
|
|||
|
// If the item is an array, do a join
|
|||
|
item = $.isArray( item ) ? item.join( '' ) : item
|
|||
|
|
|||
|
// Check for the class
|
|||
|
klass = klass ? ' class="' + klass + '"' : ''
|
|||
|
|
|||
|
// Check for any attributes
|
|||
|
attribute = attribute ? ' ' + attribute : ''
|
|||
|
|
|||
|
// Return the wrapped item
|
|||
|
return '<' + wrapper + klass + attribute + '>' + item + '</' + wrapper + '>'
|
|||
|
}, //node
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Lead numbers below 10 with a zero.
|
|||
|
*/
|
|||
|
lead: function( number ) {
|
|||
|
return ( number < 10 ? '0': '' ) + number
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Trigger a function otherwise return the value.
|
|||
|
*/
|
|||
|
trigger: function( callback, scope, args ) {
|
|||
|
return typeof callback == 'function' ? callback.apply( scope, args || [] ) : callback
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* If the second character is a digit, length is 2 otherwise 1.
|
|||
|
*/
|
|||
|
digits: function( string ) {
|
|||
|
return ( /\d/ ).test( string[ 1 ] ) ? 2 : 1
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Tell if something is a date object.
|
|||
|
*/
|
|||
|
isDate: function( value ) {
|
|||
|
return {}.toString.call( value ).indexOf( 'Date' ) > -1 && this.isInteger( value.getDate() )
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Tell if something is an integer.
|
|||
|
*/
|
|||
|
isInteger: function( value ) {
|
|||
|
return {}.toString.call( value ).indexOf( 'Number' ) > -1 && value % 1 === 0
|
|||
|
},
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create ARIA attribute strings.
|
|||
|
*/
|
|||
|
ariaAttr: ariaAttr
|
|||
|
} //PickerConstructor._
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Extend the picker with a component and defaults.
|
|||
|
*/
|
|||
|
PickerConstructor.extend = function( name, Component ) {
|
|||
|
|
|||
|
// Extend jQuery.
|
|||
|
$.fn[ name ] = function( options, action ) {
|
|||
|
|
|||
|
// Grab the component data.
|
|||
|
var componentData = this.data( name )
|
|||
|
|
|||
|
// If the picker is requested, return the data object.
|
|||
|
if ( options == 'picker' ) {
|
|||
|
return componentData
|
|||
|
}
|
|||
|
|
|||
|
// If the component data exists and `options` is a string, carry out the action.
|
|||
|
if ( componentData && typeof options == 'string' ) {
|
|||
|
return PickerConstructor._.trigger( componentData[ options ], componentData, [ action ] )
|
|||
|
}
|
|||
|
|
|||
|
// Otherwise go through each matched element and if the component
|
|||
|
// doesn’t exist, create a new picker using `this` element
|
|||
|
// and merging the defaults and options with a deep copy.
|
|||
|
return this.each( function() {
|
|||
|
var $this = $( this )
|
|||
|
if ( !$this.data( name ) ) {
|
|||
|
new PickerConstructor( this, name, Component, options )
|
|||
|
}
|
|||
|
})
|
|||
|
}
|
|||
|
|
|||
|
// Set the defaults.
|
|||
|
$.fn[ name ].defaults = Component.defaults
|
|||
|
} //PickerConstructor.extend
|
|||
|
|
|||
|
|
|||
|
|
|||
|
function aria(element, attribute, value) {
|
|||
|
if ( $.isPlainObject(attribute) ) {
|
|||
|
for ( var key in attribute ) {
|
|||
|
ariaSet(element, key, attribute[key])
|
|||
|
}
|
|||
|
}
|
|||
|
else {
|
|||
|
ariaSet(element, attribute, value)
|
|||
|
}
|
|||
|
}
|
|||
|
function ariaSet(element, attribute, value) {
|
|||
|
element.setAttribute(
|
|||
|
(attribute == 'role' ? '' : 'aria-') + attribute,
|
|||
|
value
|
|||
|
)
|
|||
|
}
|
|||
|
function ariaAttr(attribute, data) {
|
|||
|
if ( !$.isPlainObject(attribute) ) {
|
|||
|
attribute = { attribute: data }
|
|||
|
}
|
|||
|
data = ''
|
|||
|
for ( var key in attribute ) {
|
|||
|
var attr = (key == 'role' ? '' : 'aria-') + key,
|
|||
|
attrVal = attribute[key]
|
|||
|
data += attrVal == null ? '' : attr + '="' + attribute[key] + '"'
|
|||
|
}
|
|||
|
return data
|
|||
|
}
|
|||
|
|
|||
|
// IE8 bug throws an error for activeElements within iframes.
|
|||
|
function getActiveElement() {
|
|||
|
try {
|
|||
|
return document.activeElement
|
|||
|
} catch ( err ) { }
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
|
|||
|
// Expose the picker constructor.
|
|||
|
return PickerConstructor
|
|||
|
|
|||
|
|
|||
|
}));
|
|||
|
|
|||
|
|
|||
|
;/*!
|
|||
|
* Date picker for pickadate.js v3.5.0
|
|||
|
* http://amsul.github.io/pickadate.js/date.htm
|
|||
|
*/
|
|||
|
|
|||
|
(function ( factory ) {
|
|||
|
|
|||
|
// AMD.
|
|||
|
if ( typeof define == 'function' && define.amd )
|
|||
|
define( ['picker', 'jquery'], factory )
|
|||
|
|
|||
|
// Node.js/browserify.
|
|||
|
else if ( typeof exports == 'object' )
|
|||
|
module.exports = factory( require('./picker.js'), require('jquery') )
|
|||
|
|
|||
|
// Browser globals.
|
|||
|
else factory( Picker, jQuery )
|
|||
|
|
|||
|
}(function( Picker, $ ) {
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Globals and constants
|
|||
|
*/
|
|||
|
var DAYS_IN_WEEK = 7,
|
|||
|
WEEKS_IN_CALENDAR = 6,
|
|||
|
_ = Picker._
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* The date picker constructor
|
|||
|
*/
|
|||
|
function DatePicker( picker, settings ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
element = picker.$node[ 0 ],
|
|||
|
elementValue = element.value,
|
|||
|
elementDataValue = picker.$node.data( 'value' ),
|
|||
|
valueString = elementDataValue || elementValue,
|
|||
|
formatString = elementDataValue ? settings.formatSubmit : settings.format,
|
|||
|
isRTL = function() {
|
|||
|
|
|||
|
return element.currentStyle ?
|
|||
|
|
|||
|
// For IE.
|
|||
|
element.currentStyle.direction == 'rtl' :
|
|||
|
|
|||
|
// For normal browsers.
|
|||
|
getComputedStyle( picker.$root[0] ).direction == 'rtl'
|
|||
|
}
|
|||
|
|
|||
|
calendar.settings = settings
|
|||
|
calendar.$node = picker.$node
|
|||
|
|
|||
|
// The queue of methods that will be used to build item objects.
|
|||
|
calendar.queue = {
|
|||
|
min: 'measure create',
|
|||
|
max: 'measure create',
|
|||
|
now: 'now create',
|
|||
|
select: 'parse create validate',
|
|||
|
highlight: 'parse navigate create validate',
|
|||
|
view: 'parse create validate viewset',
|
|||
|
disable: 'deactivate',
|
|||
|
enable: 'activate'
|
|||
|
}
|
|||
|
|
|||
|
// The component's item object.
|
|||
|
calendar.item = {}
|
|||
|
|
|||
|
calendar.item.clear = null
|
|||
|
calendar.item.disable = ( settings.disable || [] ).slice( 0 )
|
|||
|
calendar.item.enable = -(function( collectionDisabled ) {
|
|||
|
return collectionDisabled[ 0 ] === true ? collectionDisabled.shift() : -1
|
|||
|
})( calendar.item.disable )
|
|||
|
|
|||
|
calendar.
|
|||
|
set( 'min', settings.min ).
|
|||
|
set( 'max', settings.max ).
|
|||
|
set( 'now' )
|
|||
|
|
|||
|
// When there’s a value, set the `select`, which in turn
|
|||
|
// also sets the `highlight` and `view`.
|
|||
|
if ( valueString ) {
|
|||
|
calendar.set( 'select', valueString, { format: formatString })
|
|||
|
}
|
|||
|
|
|||
|
// If there’s no value, default to highlighting “today”.
|
|||
|
else {
|
|||
|
calendar.
|
|||
|
set( 'select', null ).
|
|||
|
set( 'highlight', calendar.item.now )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// The keycode to movement mapping.
|
|||
|
calendar.key = {
|
|||
|
40: 7, // Down
|
|||
|
38: -7, // Up
|
|||
|
39: function() { return isRTL() ? -1 : 1 }, // Right
|
|||
|
37: function() { return isRTL() ? 1 : -1 }, // Left
|
|||
|
go: function( timeChange ) {
|
|||
|
var highlightedObject = calendar.item.highlight,
|
|||
|
targetDate = new Date( highlightedObject.year, highlightedObject.month, highlightedObject.date + timeChange )
|
|||
|
calendar.set(
|
|||
|
'highlight',
|
|||
|
targetDate,
|
|||
|
{ interval: timeChange }
|
|||
|
)
|
|||
|
this.render()
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Bind some picker events.
|
|||
|
picker.
|
|||
|
on( 'render', function() {
|
|||
|
picker.$root.find( '.' + settings.klass.selectMonth ).on( 'change', function() {
|
|||
|
var value = this.value
|
|||
|
if ( value ) {
|
|||
|
picker.set( 'highlight', [ picker.get( 'view' ).year, value, picker.get( 'highlight' ).date ] )
|
|||
|
picker.$root.find( '.' + settings.klass.selectMonth ).trigger( 'focus' )
|
|||
|
}
|
|||
|
})
|
|||
|
picker.$root.find( '.' + settings.klass.selectYear ).on( 'change', function() {
|
|||
|
var value = this.value
|
|||
|
if ( value ) {
|
|||
|
picker.set( 'highlight', [ value, picker.get( 'view' ).month, picker.get( 'highlight' ).date ] )
|
|||
|
picker.$root.find( '.' + settings.klass.selectYear ).trigger( 'focus' )
|
|||
|
}
|
|||
|
})
|
|||
|
}, 1 ).
|
|||
|
on( 'open', function() {
|
|||
|
var includeToday = ''
|
|||
|
if ( calendar.disabled( calendar.get('now') ) ) {
|
|||
|
includeToday = ':not(.' + settings.klass.buttonToday + ')'
|
|||
|
}
|
|||
|
picker.$root.find( 'button' + includeToday + ', select' ).attr( 'disabled', false )
|
|||
|
}, 1 ).
|
|||
|
on( 'close', function() {
|
|||
|
picker.$root.find( 'button, select' ).attr( 'disabled', true )
|
|||
|
}, 1 )
|
|||
|
|
|||
|
} //DatePicker
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Set a datepicker item object.
|
|||
|
*/
|
|||
|
DatePicker.prototype.set = function( type, value, options ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
calendarItem = calendar.item
|
|||
|
|
|||
|
// If the value is `null` just set it immediately.
|
|||
|
if ( value === null ) {
|
|||
|
if ( type == 'clear' ) type = 'select'
|
|||
|
calendarItem[ type ] = value
|
|||
|
return calendar
|
|||
|
}
|
|||
|
|
|||
|
// Otherwise go through the queue of methods, and invoke the functions.
|
|||
|
// Update this as the time unit, and set the final value as this item.
|
|||
|
// * In the case of `enable`, keep the queue but set `disable` instead.
|
|||
|
// And in the case of `flip`, keep the queue but set `enable` instead.
|
|||
|
calendarItem[ ( type == 'enable' ? 'disable' : type == 'flip' ? 'enable' : type ) ] = calendar.queue[ type ].split( ' ' ).map( function( method ) {
|
|||
|
value = calendar[ method ]( type, value, options )
|
|||
|
return value
|
|||
|
}).pop()
|
|||
|
|
|||
|
// Check if we need to cascade through more updates.
|
|||
|
if ( type == 'select' ) {
|
|||
|
calendar.set( 'highlight', calendarItem.select, options )
|
|||
|
}
|
|||
|
else if ( type == 'highlight' ) {
|
|||
|
calendar.set( 'view', calendarItem.highlight, options )
|
|||
|
}
|
|||
|
else if ( type.match( /^(flip|min|max|disable|enable)$/ ) ) {
|
|||
|
if ( calendarItem.select && calendar.disabled( calendarItem.select ) ) {
|
|||
|
calendar.set( 'select', calendarItem.select, options )
|
|||
|
}
|
|||
|
if ( calendarItem.highlight && calendar.disabled( calendarItem.highlight ) ) {
|
|||
|
calendar.set( 'highlight', calendarItem.highlight, options )
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
return calendar
|
|||
|
} //DatePicker.prototype.set
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Get a datepicker item object.
|
|||
|
*/
|
|||
|
DatePicker.prototype.get = function( type ) {
|
|||
|
return this.item[ type ]
|
|||
|
} //DatePicker.prototype.get
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create a picker date object.
|
|||
|
*/
|
|||
|
DatePicker.prototype.create = function( type, value, options ) {
|
|||
|
|
|||
|
var isInfiniteValue,
|
|||
|
calendar = this
|
|||
|
|
|||
|
// If there’s no value, use the type as the value.
|
|||
|
value = value === undefined ? type : value
|
|||
|
|
|||
|
|
|||
|
// If it’s infinity, update the value.
|
|||
|
if ( value == -Infinity || value == Infinity ) {
|
|||
|
isInfiniteValue = value
|
|||
|
}
|
|||
|
|
|||
|
// If it’s an object, use the native date object.
|
|||
|
else if ( $.isPlainObject( value ) && _.isInteger( value.pick ) ) {
|
|||
|
value = value.obj
|
|||
|
}
|
|||
|
|
|||
|
// If it’s an array, convert it into a date and make sure
|
|||
|
// that it’s a valid date – otherwise default to today.
|
|||
|
else if ( $.isArray( value ) ) {
|
|||
|
value = new Date( value[ 0 ], value[ 1 ], value[ 2 ] )
|
|||
|
value = _.isDate( value ) ? value : calendar.create().obj
|
|||
|
}
|
|||
|
|
|||
|
// If it’s a number or date object, make a normalized date.
|
|||
|
else if ( _.isInteger( value ) || _.isDate( value ) ) {
|
|||
|
value = calendar.normalize( new Date( value ), options )
|
|||
|
}
|
|||
|
|
|||
|
// If it’s a literal true or any other case, set it to now.
|
|||
|
else /*if ( value === true )*/ {
|
|||
|
value = calendar.now( type, value, options )
|
|||
|
}
|
|||
|
|
|||
|
// Return the compiled object.
|
|||
|
return {
|
|||
|
year: isInfiniteValue || value.getFullYear(),
|
|||
|
month: isInfiniteValue || value.getMonth(),
|
|||
|
date: isInfiniteValue || value.getDate(),
|
|||
|
day: isInfiniteValue || value.getDay(),
|
|||
|
obj: isInfiniteValue || value,
|
|||
|
pick: isInfiniteValue || value.getTime()
|
|||
|
}
|
|||
|
} //DatePicker.prototype.create
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create a range limit object using an array, date object,
|
|||
|
* literal “true”, or integer relative to another time.
|
|||
|
*/
|
|||
|
DatePicker.prototype.createRange = function( from, to ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
createDate = function( date ) {
|
|||
|
if ( date === true || $.isArray( date ) || _.isDate( date ) ) {
|
|||
|
return calendar.create( date )
|
|||
|
}
|
|||
|
return date
|
|||
|
}
|
|||
|
|
|||
|
// Create objects if possible.
|
|||
|
if ( !_.isInteger( from ) ) {
|
|||
|
from = createDate( from )
|
|||
|
}
|
|||
|
if ( !_.isInteger( to ) ) {
|
|||
|
to = createDate( to )
|
|||
|
}
|
|||
|
|
|||
|
// Create relative dates.
|
|||
|
if ( _.isInteger( from ) && $.isPlainObject( to ) ) {
|
|||
|
from = [ to.year, to.month, to.date + from ];
|
|||
|
}
|
|||
|
else if ( _.isInteger( to ) && $.isPlainObject( from ) ) {
|
|||
|
to = [ from.year, from.month, from.date + to ];
|
|||
|
}
|
|||
|
|
|||
|
return {
|
|||
|
from: createDate( from ),
|
|||
|
to: createDate( to )
|
|||
|
}
|
|||
|
} //DatePicker.prototype.createRange
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if a date unit falls within a date range object.
|
|||
|
*/
|
|||
|
DatePicker.prototype.withinRange = function( range, dateUnit ) {
|
|||
|
range = this.createRange(range.from, range.to)
|
|||
|
return dateUnit.pick >= range.from.pick && dateUnit.pick <= range.to.pick
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if two date range objects overlap.
|
|||
|
*/
|
|||
|
DatePicker.prototype.overlapRanges = function( one, two ) {
|
|||
|
|
|||
|
var calendar = this
|
|||
|
|
|||
|
// Convert the ranges into comparable dates.
|
|||
|
one = calendar.createRange( one.from, one.to )
|
|||
|
two = calendar.createRange( two.from, two.to )
|
|||
|
|
|||
|
return calendar.withinRange( one, two.from ) || calendar.withinRange( one, two.to ) ||
|
|||
|
calendar.withinRange( two, one.from ) || calendar.withinRange( two, one.to )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Get the date today.
|
|||
|
*/
|
|||
|
DatePicker.prototype.now = function( type, value, options ) {
|
|||
|
value = new Date()
|
|||
|
if ( options && options.rel ) {
|
|||
|
value.setDate( value.getDate() + options.rel )
|
|||
|
}
|
|||
|
return this.normalize( value, options )
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Navigate to next/prev month.
|
|||
|
*/
|
|||
|
DatePicker.prototype.navigate = function( type, value, options ) {
|
|||
|
|
|||
|
var targetDateObject,
|
|||
|
targetYear,
|
|||
|
targetMonth,
|
|||
|
targetDate,
|
|||
|
isTargetArray = $.isArray( value ),
|
|||
|
isTargetObject = $.isPlainObject( value ),
|
|||
|
viewsetObject = this.item.view/*,
|
|||
|
safety = 100*/
|
|||
|
|
|||
|
|
|||
|
if ( isTargetArray || isTargetObject ) {
|
|||
|
|
|||
|
if ( isTargetObject ) {
|
|||
|
targetYear = value.year
|
|||
|
targetMonth = value.month
|
|||
|
targetDate = value.date
|
|||
|
}
|
|||
|
else {
|
|||
|
targetYear = +value[0]
|
|||
|
targetMonth = +value[1]
|
|||
|
targetDate = +value[2]
|
|||
|
}
|
|||
|
|
|||
|
// If we’re navigating months but the view is in a different
|
|||
|
// month, navigate to the view’s year and month.
|
|||
|
if ( options && options.nav && viewsetObject && viewsetObject.month !== targetMonth ) {
|
|||
|
targetYear = viewsetObject.year
|
|||
|
targetMonth = viewsetObject.month
|
|||
|
}
|
|||
|
|
|||
|
// Figure out the expected target year and month.
|
|||
|
targetDateObject = new Date( targetYear, targetMonth + ( options && options.nav ? options.nav : 0 ), 1 )
|
|||
|
targetYear = targetDateObject.getFullYear()
|
|||
|
targetMonth = targetDateObject.getMonth()
|
|||
|
|
|||
|
// If the month we’re going to doesn’t have enough days,
|
|||
|
// keep decreasing the date until we reach the month’s last date.
|
|||
|
while ( /*safety &&*/ new Date( targetYear, targetMonth, targetDate ).getMonth() !== targetMonth ) {
|
|||
|
targetDate -= 1
|
|||
|
/*safety -= 1
|
|||
|
if ( !safety ) {
|
|||
|
throw 'Fell into an infinite loop while navigating to ' + new Date( targetYear, targetMonth, targetDate ) + '.'
|
|||
|
}*/
|
|||
|
}
|
|||
|
|
|||
|
value = [ targetYear, targetMonth, targetDate ]
|
|||
|
}
|
|||
|
|
|||
|
return value
|
|||
|
} //DatePicker.prototype.navigate
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Normalize a date by setting the hours to midnight.
|
|||
|
*/
|
|||
|
DatePicker.prototype.normalize = function( value/*, options*/ ) {
|
|||
|
value.setHours( 0, 0, 0, 0 )
|
|||
|
return value
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Measure the range of dates.
|
|||
|
*/
|
|||
|
DatePicker.prototype.measure = function( type, value/*, options*/ ) {
|
|||
|
|
|||
|
var calendar = this
|
|||
|
|
|||
|
// If it’s anything false-y, remove the limits.
|
|||
|
if ( !value ) {
|
|||
|
value = type == 'min' ? -Infinity : Infinity
|
|||
|
}
|
|||
|
|
|||
|
// If it’s a string, parse it.
|
|||
|
else if ( typeof value == 'string' ) {
|
|||
|
value = calendar.parse( type, value )
|
|||
|
}
|
|||
|
|
|||
|
// If it's an integer, get a date relative to today.
|
|||
|
else if ( _.isInteger( value ) ) {
|
|||
|
value = calendar.now( type, value, { rel: value } )
|
|||
|
}
|
|||
|
|
|||
|
return value
|
|||
|
} ///DatePicker.prototype.measure
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create a viewset object based on navigation.
|
|||
|
*/
|
|||
|
DatePicker.prototype.viewset = function( type, dateObject/*, options*/ ) {
|
|||
|
return this.create([ dateObject.year, dateObject.month, 1 ])
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Validate a date as enabled and shift if needed.
|
|||
|
*/
|
|||
|
DatePicker.prototype.validate = function( type, dateObject, options ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
|
|||
|
// Keep a reference to the original date.
|
|||
|
originalDateObject = dateObject,
|
|||
|
|
|||
|
// Make sure we have an interval.
|
|||
|
interval = options && options.interval ? options.interval : 1,
|
|||
|
|
|||
|
// Check if the calendar enabled dates are inverted.
|
|||
|
isFlippedBase = calendar.item.enable === -1,
|
|||
|
|
|||
|
// Check if we have any enabled dates after/before now.
|
|||
|
hasEnabledBeforeTarget, hasEnabledAfterTarget,
|
|||
|
|
|||
|
// The min & max limits.
|
|||
|
minLimitObject = calendar.item.min,
|
|||
|
maxLimitObject = calendar.item.max,
|
|||
|
|
|||
|
// Check if we’ve reached the limit during shifting.
|
|||
|
reachedMin, reachedMax,
|
|||
|
|
|||
|
// Check if the calendar is inverted and at least one weekday is enabled.
|
|||
|
hasEnabledWeekdays = isFlippedBase && calendar.item.disable.filter( function( value ) {
|
|||
|
|
|||
|
// If there’s a date, check where it is relative to the target.
|
|||
|
if ( $.isArray( value ) ) {
|
|||
|
var dateTime = calendar.create( value ).pick
|
|||
|
if ( dateTime < dateObject.pick ) hasEnabledBeforeTarget = true
|
|||
|
else if ( dateTime > dateObject.pick ) hasEnabledAfterTarget = true
|
|||
|
}
|
|||
|
|
|||
|
// Return only integers for enabled weekdays.
|
|||
|
return _.isInteger( value )
|
|||
|
}).length/*,
|
|||
|
|
|||
|
safety = 100*/
|
|||
|
|
|||
|
|
|||
|
|
|||
|
// Cases to validate for:
|
|||
|
// [1] Not inverted and date disabled.
|
|||
|
// [2] Inverted and some dates enabled.
|
|||
|
// [3] Not inverted and out of range.
|
|||
|
//
|
|||
|
// Cases to **not** validate for:
|
|||
|
// • Navigating months.
|
|||
|
// • Not inverted and date enabled.
|
|||
|
// • Inverted and all dates disabled.
|
|||
|
// • ..and anything else.
|
|||
|
if ( !options || !options.nav ) if (
|
|||
|
/* 1 */ ( !isFlippedBase && calendar.disabled( dateObject ) ) ||
|
|||
|
/* 2 */ ( isFlippedBase && calendar.disabled( dateObject ) && ( hasEnabledWeekdays || hasEnabledBeforeTarget || hasEnabledAfterTarget ) ) ||
|
|||
|
/* 3 */ ( !isFlippedBase && (dateObject.pick <= minLimitObject.pick || dateObject.pick >= maxLimitObject.pick) )
|
|||
|
) {
|
|||
|
|
|||
|
|
|||
|
// When inverted, flip the direction if there aren’t any enabled weekdays
|
|||
|
// and there are no enabled dates in the direction of the interval.
|
|||
|
if ( isFlippedBase && !hasEnabledWeekdays && ( ( !hasEnabledAfterTarget && interval > 0 ) || ( !hasEnabledBeforeTarget && interval < 0 ) ) ) {
|
|||
|
interval *= -1
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Keep looping until we reach an enabled date.
|
|||
|
while ( /*safety &&*/ calendar.disabled( dateObject ) ) {
|
|||
|
|
|||
|
/*safety -= 1
|
|||
|
if ( !safety ) {
|
|||
|
throw 'Fell into an infinite loop while validating ' + dateObject.obj + '.'
|
|||
|
}*/
|
|||
|
|
|||
|
|
|||
|
// If we’ve looped into the next/prev month with a large interval, return to the original date and flatten the interval.
|
|||
|
if ( Math.abs( interval ) > 1 && ( dateObject.month < originalDateObject.month || dateObject.month > originalDateObject.month ) ) {
|
|||
|
dateObject = originalDateObject
|
|||
|
interval = interval > 0 ? 1 : -1
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// If we’ve reached the min/max limit, reverse the direction, flatten the interval and set it to the limit.
|
|||
|
if ( dateObject.pick <= minLimitObject.pick ) {
|
|||
|
reachedMin = true
|
|||
|
interval = 1
|
|||
|
dateObject = calendar.create([
|
|||
|
minLimitObject.year,
|
|||
|
minLimitObject.month,
|
|||
|
minLimitObject.date + (dateObject.pick === minLimitObject.pick ? 0 : -1)
|
|||
|
])
|
|||
|
}
|
|||
|
else if ( dateObject.pick >= maxLimitObject.pick ) {
|
|||
|
reachedMax = true
|
|||
|
interval = -1
|
|||
|
dateObject = calendar.create([
|
|||
|
maxLimitObject.year,
|
|||
|
maxLimitObject.month,
|
|||
|
maxLimitObject.date + (dateObject.pick === maxLimitObject.pick ? 0 : 1)
|
|||
|
])
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// If we’ve reached both limits, just break out of the loop.
|
|||
|
if ( reachedMin && reachedMax ) {
|
|||
|
break
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Finally, create the shifted date using the interval and keep looping.
|
|||
|
dateObject = calendar.create([ dateObject.year, dateObject.month, dateObject.date + interval ])
|
|||
|
}
|
|||
|
|
|||
|
} //endif
|
|||
|
|
|||
|
|
|||
|
// Return the date object settled on.
|
|||
|
return dateObject
|
|||
|
} //DatePicker.prototype.validate
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if a date is disabled.
|
|||
|
*/
|
|||
|
DatePicker.prototype.disabled = function( dateToVerify ) {
|
|||
|
|
|||
|
var
|
|||
|
calendar = this,
|
|||
|
|
|||
|
// Filter through the disabled dates to check if this is one.
|
|||
|
isDisabledMatch = calendar.item.disable.filter( function( dateToDisable ) {
|
|||
|
|
|||
|
// If the date is a number, match the weekday with 0index and `firstDay` check.
|
|||
|
if ( _.isInteger( dateToDisable ) ) {
|
|||
|
return dateToVerify.day === ( calendar.settings.firstDay ? dateToDisable : dateToDisable - 1 ) % 7
|
|||
|
}
|
|||
|
|
|||
|
// If it’s an array or a native JS date, create and match the exact date.
|
|||
|
if ( $.isArray( dateToDisable ) || _.isDate( dateToDisable ) ) {
|
|||
|
return dateToVerify.pick === calendar.create( dateToDisable ).pick
|
|||
|
}
|
|||
|
|
|||
|
// If it’s an object, match a date within the “from” and “to” range.
|
|||
|
if ( $.isPlainObject( dateToDisable ) ) {
|
|||
|
return calendar.withinRange( dateToDisable, dateToVerify )
|
|||
|
}
|
|||
|
})
|
|||
|
|
|||
|
// If this date matches a disabled date, confirm it’s not inverted.
|
|||
|
isDisabledMatch = isDisabledMatch.length && !isDisabledMatch.filter(function( dateToDisable ) {
|
|||
|
return $.isArray( dateToDisable ) && dateToDisable[3] == 'inverted' ||
|
|||
|
$.isPlainObject( dateToDisable ) && dateToDisable.inverted
|
|||
|
}).length
|
|||
|
|
|||
|
// Check the calendar “enabled” flag and respectively flip the
|
|||
|
// disabled state. Then also check if it’s beyond the min/max limits.
|
|||
|
return calendar.item.enable === -1 ? !isDisabledMatch : isDisabledMatch ||
|
|||
|
dateToVerify.pick < calendar.item.min.pick ||
|
|||
|
dateToVerify.pick > calendar.item.max.pick
|
|||
|
|
|||
|
} //DatePicker.prototype.disabled
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Parse a string into a usable type.
|
|||
|
*/
|
|||
|
DatePicker.prototype.parse = function( type, value, options ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
parsingObject = {}
|
|||
|
|
|||
|
// If it’s already parsed, we’re good.
|
|||
|
if ( !value || typeof value != 'string' ) {
|
|||
|
return value
|
|||
|
}
|
|||
|
|
|||
|
// We need a `.format` to parse the value with.
|
|||
|
if ( !( options && options.format ) ) {
|
|||
|
options = options || {}
|
|||
|
options.format = calendar.settings.format
|
|||
|
}
|
|||
|
|
|||
|
// Convert the format into an array and then map through it.
|
|||
|
calendar.formats.toArray( options.format ).map( function( label ) {
|
|||
|
|
|||
|
var
|
|||
|
// Grab the formatting label.
|
|||
|
formattingLabel = calendar.formats[ label ],
|
|||
|
|
|||
|
// The format length is from the formatting label function or the
|
|||
|
// label length without the escaping exclamation (!) mark.
|
|||
|
formatLength = formattingLabel ? _.trigger( formattingLabel, calendar, [ value, parsingObject ] ) : label.replace( /^!/, '' ).length
|
|||
|
|
|||
|
// If there's a format label, split the value up to the format length.
|
|||
|
// Then add it to the parsing object with appropriate label.
|
|||
|
if ( formattingLabel ) {
|
|||
|
parsingObject[ label ] = value.substr( 0, formatLength )
|
|||
|
}
|
|||
|
|
|||
|
// Update the value as the substring from format length to end.
|
|||
|
value = value.substr( formatLength )
|
|||
|
})
|
|||
|
|
|||
|
// Compensate for month 0index.
|
|||
|
return [
|
|||
|
parsingObject.yyyy || parsingObject.yy,
|
|||
|
+( parsingObject.mm || parsingObject.m ) - 1,
|
|||
|
parsingObject.dd || parsingObject.d
|
|||
|
]
|
|||
|
} //DatePicker.prototype.parse
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Various formats to display the object in.
|
|||
|
*/
|
|||
|
DatePicker.prototype.formats = (function() {
|
|||
|
|
|||
|
// Return the length of the first word in a collection.
|
|||
|
function getWordLengthFromCollection( string, collection, dateObject ) {
|
|||
|
|
|||
|
// Grab the first word from the string.
|
|||
|
var word = string.match( /\w+/ )[ 0 ]
|
|||
|
|
|||
|
// If there's no month index, add it to the date object
|
|||
|
if ( !dateObject.mm && !dateObject.m ) {
|
|||
|
dateObject.m = collection.indexOf( word ) + 1
|
|||
|
}
|
|||
|
|
|||
|
// Return the length of the word.
|
|||
|
return word.length
|
|||
|
}
|
|||
|
|
|||
|
// Get the length of the first word in a string.
|
|||
|
function getFirstWordLength( string ) {
|
|||
|
return string.match( /\w+/ )[ 0 ].length
|
|||
|
}
|
|||
|
|
|||
|
return {
|
|||
|
|
|||
|
d: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's string, then get the digits length.
|
|||
|
// Otherwise return the selected date.
|
|||
|
return string ? _.digits( string ) : dateObject.date
|
|||
|
},
|
|||
|
dd: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then the length is always 2.
|
|||
|
// Otherwise return the selected date with a leading zero.
|
|||
|
return string ? 2 : _.lead( dateObject.date )
|
|||
|
},
|
|||
|
ddd: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then get the length of the first word.
|
|||
|
// Otherwise return the short selected weekday.
|
|||
|
return string ? getFirstWordLength( string ) : this.settings.weekdaysShort[ dateObject.day ]
|
|||
|
},
|
|||
|
dddd: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then get the length of the first word.
|
|||
|
// Otherwise return the full selected weekday.
|
|||
|
return string ? getFirstWordLength( string ) : this.settings.weekdaysFull[ dateObject.day ]
|
|||
|
},
|
|||
|
m: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then get the length of the digits
|
|||
|
// Otherwise return the selected month with 0index compensation.
|
|||
|
return string ? _.digits( string ) : dateObject.month + 1
|
|||
|
},
|
|||
|
mm: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then the length is always 2.
|
|||
|
// Otherwise return the selected month with 0index and leading zero.
|
|||
|
return string ? 2 : _.lead( dateObject.month + 1 )
|
|||
|
},
|
|||
|
mmm: function( string, dateObject ) {
|
|||
|
|
|||
|
var collection = this.settings.monthsShort
|
|||
|
|
|||
|
// If there's a string, get length of the relevant month from the short
|
|||
|
// months collection. Otherwise return the selected month from that collection.
|
|||
|
return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
|
|||
|
},
|
|||
|
mmmm: function( string, dateObject ) {
|
|||
|
|
|||
|
var collection = this.settings.monthsFull
|
|||
|
|
|||
|
// If there's a string, get length of the relevant month from the full
|
|||
|
// months collection. Otherwise return the selected month from that collection.
|
|||
|
return string ? getWordLengthFromCollection( string, collection, dateObject ) : collection[ dateObject.month ]
|
|||
|
},
|
|||
|
yy: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then the length is always 2.
|
|||
|
// Otherwise return the selected year by slicing out the first 2 digits.
|
|||
|
return string ? 2 : ( '' + dateObject.year ).slice( 2 )
|
|||
|
},
|
|||
|
yyyy: function( string, dateObject ) {
|
|||
|
|
|||
|
// If there's a string, then the length is always 4.
|
|||
|
// Otherwise return the selected year.
|
|||
|
return string ? 4 : dateObject.year
|
|||
|
},
|
|||
|
|
|||
|
// Create an array by splitting the formatting string passed.
|
|||
|
toArray: function( formatString ) { return formatString.split( /(d{1,4}|m{1,4}|y{4}|yy|!.)/g ) },
|
|||
|
|
|||
|
// Format an object into a string using the formatting options.
|
|||
|
toString: function ( formatString, itemObject ) {
|
|||
|
var calendar = this
|
|||
|
return calendar.formats.toArray( formatString ).map( function( label ) {
|
|||
|
return _.trigger( calendar.formats[ label ], calendar, [ 0, itemObject ] ) || label.replace( /^!/, '' )
|
|||
|
}).join( '' )
|
|||
|
}
|
|||
|
}
|
|||
|
})() //DatePicker.prototype.formats
|
|||
|
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if two date units are the exact.
|
|||
|
*/
|
|||
|
DatePicker.prototype.isDateExact = function( one, two ) {
|
|||
|
|
|||
|
var calendar = this
|
|||
|
|
|||
|
// When we’re working with weekdays, do a direct comparison.
|
|||
|
if (
|
|||
|
( _.isInteger( one ) && _.isInteger( two ) ) ||
|
|||
|
( typeof one == 'boolean' && typeof two == 'boolean' )
|
|||
|
) {
|
|||
|
return one === two
|
|||
|
}
|
|||
|
|
|||
|
// When we’re working with date representations, compare the “pick” value.
|
|||
|
if (
|
|||
|
( _.isDate( one ) || $.isArray( one ) ) &&
|
|||
|
( _.isDate( two ) || $.isArray( two ) )
|
|||
|
) {
|
|||
|
return calendar.create( one ).pick === calendar.create( two ).pick
|
|||
|
}
|
|||
|
|
|||
|
// When we’re working with range objects, compare the “from” and “to”.
|
|||
|
if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
|
|||
|
return calendar.isDateExact( one.from, two.from ) && calendar.isDateExact( one.to, two.to )
|
|||
|
}
|
|||
|
|
|||
|
return false
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Check if two date units overlap.
|
|||
|
*/
|
|||
|
DatePicker.prototype.isDateOverlap = function( one, two ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
firstDay = calendar.settings.firstDay ? 1 : 0
|
|||
|
|
|||
|
// When we’re working with a weekday index, compare the days.
|
|||
|
if ( _.isInteger( one ) && ( _.isDate( two ) || $.isArray( two ) ) ) {
|
|||
|
one = one % 7 + firstDay
|
|||
|
return one === calendar.create( two ).day + 1
|
|||
|
}
|
|||
|
if ( _.isInteger( two ) && ( _.isDate( one ) || $.isArray( one ) ) ) {
|
|||
|
two = two % 7 + firstDay
|
|||
|
return two === calendar.create( one ).day + 1
|
|||
|
}
|
|||
|
|
|||
|
// When we’re working with range objects, check if the ranges overlap.
|
|||
|
if ( $.isPlainObject( one ) && $.isPlainObject( two ) ) {
|
|||
|
return calendar.overlapRanges( one, two )
|
|||
|
}
|
|||
|
|
|||
|
return false
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Flip the “enabled” state.
|
|||
|
*/
|
|||
|
DatePicker.prototype.flipEnable = function(val) {
|
|||
|
var itemObject = this.item
|
|||
|
itemObject.enable = val || (itemObject.enable == -1 ? 1 : -1)
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Mark a collection of dates as “disabled”.
|
|||
|
*/
|
|||
|
DatePicker.prototype.deactivate = function( type, datesToDisable ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
disabledItems = calendar.item.disable.slice(0)
|
|||
|
|
|||
|
|
|||
|
// If we’re flipping, that’s all we need to do.
|
|||
|
if ( datesToDisable == 'flip' ) {
|
|||
|
calendar.flipEnable()
|
|||
|
}
|
|||
|
|
|||
|
else if ( datesToDisable === false ) {
|
|||
|
calendar.flipEnable(1)
|
|||
|
disabledItems = []
|
|||
|
}
|
|||
|
|
|||
|
else if ( datesToDisable === true ) {
|
|||
|
calendar.flipEnable(-1)
|
|||
|
disabledItems = []
|
|||
|
}
|
|||
|
|
|||
|
// Otherwise go through the dates to disable.
|
|||
|
else {
|
|||
|
|
|||
|
datesToDisable.map(function( unitToDisable ) {
|
|||
|
|
|||
|
var matchFound
|
|||
|
|
|||
|
// When we have disabled items, check for matches.
|
|||
|
// If something is matched, immediately break out.
|
|||
|
for ( var index = 0; index < disabledItems.length; index += 1 ) {
|
|||
|
if ( calendar.isDateExact( unitToDisable, disabledItems[index] ) ) {
|
|||
|
matchFound = true
|
|||
|
break
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// If nothing was found, add the validated unit to the collection.
|
|||
|
if ( !matchFound ) {
|
|||
|
if (
|
|||
|
_.isInteger( unitToDisable ) ||
|
|||
|
_.isDate( unitToDisable ) ||
|
|||
|
$.isArray( unitToDisable ) ||
|
|||
|
( $.isPlainObject( unitToDisable ) && unitToDisable.from && unitToDisable.to )
|
|||
|
) {
|
|||
|
disabledItems.push( unitToDisable )
|
|||
|
}
|
|||
|
}
|
|||
|
})
|
|||
|
}
|
|||
|
|
|||
|
// Return the updated collection.
|
|||
|
return disabledItems
|
|||
|
} //DatePicker.prototype.deactivate
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Mark a collection of dates as “enabled”.
|
|||
|
*/
|
|||
|
DatePicker.prototype.activate = function( type, datesToEnable ) {
|
|||
|
|
|||
|
var calendar = this,
|
|||
|
disabledItems = calendar.item.disable,
|
|||
|
disabledItemsCount = disabledItems.length
|
|||
|
|
|||
|
// If we’re flipping, that’s all we need to do.
|
|||
|
if ( datesToEnable == 'flip' ) {
|
|||
|
calendar.flipEnable()
|
|||
|
}
|
|||
|
|
|||
|
else if ( datesToEnable === true ) {
|
|||
|
calendar.flipEnable(1)
|
|||
|
disabledItems = []
|
|||
|
}
|
|||
|
|
|||
|
else if ( datesToEnable === false ) {
|
|||
|
calendar.flipEnable(-1)
|
|||
|
disabledItems = []
|
|||
|
}
|
|||
|
|
|||
|
// Otherwise go through the disabled dates.
|
|||
|
else {
|
|||
|
|
|||
|
datesToEnable.map(function( unitToEnable ) {
|
|||
|
|
|||
|
var matchFound,
|
|||
|
disabledUnit,
|
|||
|
index,
|
|||
|
isExactRange
|
|||
|
|
|||
|
// Go through the disabled items and try to find a match.
|
|||
|
for ( index = 0; index < disabledItemsCount; index += 1 ) {
|
|||
|
|
|||
|
disabledUnit = disabledItems[index]
|
|||
|
|
|||
|
// When an exact match is found, remove it from the collection.
|
|||
|
if ( calendar.isDateExact( disabledUnit, unitToEnable ) ) {
|
|||
|
matchFound = disabledItems[index] = null
|
|||
|
isExactRange = true
|
|||
|
break
|
|||
|
}
|
|||
|
|
|||
|
// When an overlapped match is found, add the “inverted” state to it.
|
|||
|
else if ( calendar.isDateOverlap( disabledUnit, unitToEnable ) ) {
|
|||
|
if ( $.isPlainObject( unitToEnable ) ) {
|
|||
|
unitToEnable.inverted = true
|
|||
|
matchFound = unitToEnable
|
|||
|
}
|
|||
|
else if ( $.isArray( unitToEnable ) ) {
|
|||
|
matchFound = unitToEnable
|
|||
|
if ( !matchFound[3] ) matchFound.push( 'inverted' )
|
|||
|
}
|
|||
|
else if ( _.isDate( unitToEnable ) ) {
|
|||
|
matchFound = [ unitToEnable.getFullYear(), unitToEnable.getMonth(), unitToEnable.getDate(), 'inverted' ]
|
|||
|
}
|
|||
|
break
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// If a match was found, remove a previous duplicate entry.
|
|||
|
if ( matchFound ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
|
|||
|
if ( calendar.isDateExact( disabledItems[index], unitToEnable ) ) {
|
|||
|
disabledItems[index] = null
|
|||
|
break
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// In the event that we’re dealing with an exact range of dates,
|
|||
|
// make sure there are no “inverted” dates because of it.
|
|||
|
if ( isExactRange ) for ( index = 0; index < disabledItemsCount; index += 1 ) {
|
|||
|
if ( calendar.isDateOverlap( disabledItems[index], unitToEnable ) ) {
|
|||
|
disabledItems[index] = null
|
|||
|
break
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// If something is still matched, add it into the collection.
|
|||
|
if ( matchFound ) {
|
|||
|
disabledItems.push( matchFound )
|
|||
|
}
|
|||
|
})
|
|||
|
}
|
|||
|
|
|||
|
// Return the updated collection.
|
|||
|
return disabledItems.filter(function( val ) { return val != null })
|
|||
|
} //DatePicker.prototype.activate
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Create a string for the nodes in the picker.
|
|||
|
*/
|
|||
|
DatePicker.prototype.nodes = function( isOpen ) {
|
|||
|
|
|||
|
var
|
|||
|
calendar = this,
|
|||
|
settings = calendar.settings,
|
|||
|
calendarItem = calendar.item,
|
|||
|
nowObject = calendarItem.now,
|
|||
|
selectedObject = calendarItem.select,
|
|||
|
highlightedObject = calendarItem.highlight,
|
|||
|
viewsetObject = calendarItem.view,
|
|||
|
disabledCollection = calendarItem.disable,
|
|||
|
minLimitObject = calendarItem.min,
|
|||
|
maxLimitObject = calendarItem.max,
|
|||
|
|
|||
|
|
|||
|
// Create the calendar table head using a copy of weekday labels collection.
|
|||
|
// * We do a copy so we don't mutate the original array.
|
|||
|
tableHead = (function( collection, fullCollection ) {
|
|||
|
|
|||
|
// If the first day should be Monday, move Sunday to the end.
|
|||
|
if ( settings.firstDay ) {
|
|||
|
collection.push( collection.shift() )
|
|||
|
fullCollection.push( fullCollection.shift() )
|
|||
|
}
|
|||
|
|
|||
|
// Create and return the table head group.
|
|||
|
return _.node(
|
|||
|
'thead',
|
|||
|
_.node(
|
|||
|
'tr',
|
|||
|
_.group({
|
|||
|
min: 0,
|
|||
|
max: DAYS_IN_WEEK - 1,
|
|||
|
i: 1,
|
|||
|
node: 'th',
|
|||
|
item: function( counter ) {
|
|||
|
return [
|
|||
|
collection[ counter ],
|
|||
|
settings.klass.weekdays,
|
|||
|
'scope=col title="' + fullCollection[ counter ] + '"'
|
|||
|
]
|
|||
|
}
|
|||
|
})
|
|||
|
)
|
|||
|
) //endreturn
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
})( ( settings.showWeekdaysFull ? settings.weekdaysFull : settings.weekdaysLetter ).slice( 0 ), settings.weekdaysFull.slice( 0 ) ), //tableHead
|
|||
|
|
|||
|
|
|||
|
// Create the nav for next/prev month.
|
|||
|
createMonthNav = function( next ) {
|
|||
|
|
|||
|
// Otherwise, return the created month tag.
|
|||
|
return _.node(
|
|||
|
'div',
|
|||
|
' ',
|
|||
|
settings.klass[ 'nav' + ( next ? 'Next' : 'Prev' ) ] + (
|
|||
|
|
|||
|
// If the focused month is outside the range, disabled the button.
|
|||
|
( next && viewsetObject.year >= maxLimitObject.year && viewsetObject.month >= maxLimitObject.month ) ||
|
|||
|
( !next && viewsetObject.year <= minLimitObject.year && viewsetObject.month <= minLimitObject.month ) ?
|
|||
|
' ' + settings.klass.navDisabled : ''
|
|||
|
),
|
|||
|
'data-nav=' + ( next || -1 ) + ' ' +
|
|||
|
_.ariaAttr({
|
|||
|
role: 'button',
|
|||
|
controls: calendar.$node[0].id + '_table'
|
|||
|
}) + ' ' +
|
|||
|
'title="' + (next ? settings.labelMonthNext : settings.labelMonthPrev ) + '"'
|
|||
|
) //endreturn
|
|||
|
}, //createMonthNav
|
|||
|
|
|||
|
|
|||
|
// Create the month label.
|
|||
|
//Materialize modified
|
|||
|
createMonthLabel = function(override) {
|
|||
|
|
|||
|
var monthsCollection = settings.showMonthsShort ? settings.monthsShort : settings.monthsFull
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
if (override == "short_months") {
|
|||
|
monthsCollection = settings.monthsShort;
|
|||
|
}
|
|||
|
|
|||
|
// If there are months to select, add a dropdown menu.
|
|||
|
if ( settings.selectMonths && override == undefined) {
|
|||
|
|
|||
|
return _.node( 'select',
|
|||
|
_.group({
|
|||
|
min: 0,
|
|||
|
max: 11,
|
|||
|
i: 1,
|
|||
|
node: 'option',
|
|||
|
item: function( loopedMonth ) {
|
|||
|
|
|||
|
return [
|
|||
|
|
|||
|
// The looped month and no classes.
|
|||
|
monthsCollection[ loopedMonth ], 0,
|
|||
|
|
|||
|
// Set the value and selected index.
|
|||
|
'value=' + loopedMonth +
|
|||
|
( viewsetObject.month == loopedMonth ? ' selected' : '' ) +
|
|||
|
(
|
|||
|
(
|
|||
|
( viewsetObject.year == minLimitObject.year && loopedMonth < minLimitObject.month ) ||
|
|||
|
( viewsetObject.year == maxLimitObject.year && loopedMonth > maxLimitObject.month )
|
|||
|
) ?
|
|||
|
' disabled' : ''
|
|||
|
)
|
|||
|
]
|
|||
|
}
|
|||
|
}),
|
|||
|
settings.klass.selectMonth + ' browser-default',
|
|||
|
( isOpen ? '' : 'disabled' ) + ' ' +
|
|||
|
_.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
|
|||
|
'title="' + settings.labelMonthSelect + '"'
|
|||
|
)
|
|||
|
}
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
if (override == "short_months")
|
|||
|
if (selectedObject != null)
|
|||
|
return _.node( 'div', monthsCollection[ selectedObject.month ] );
|
|||
|
else return _.node( 'div', monthsCollection[ viewsetObject.month ] );
|
|||
|
|
|||
|
// If there's a need for a month selector
|
|||
|
return _.node( 'div', monthsCollection[ viewsetObject.month ], settings.klass.month )
|
|||
|
}, //createMonthLabel
|
|||
|
|
|||
|
|
|||
|
// Create the year label.
|
|||
|
// Materialize modified
|
|||
|
createYearLabel = function(override) {
|
|||
|
|
|||
|
var focusedYear = viewsetObject.year,
|
|||
|
|
|||
|
// If years selector is set to a literal "true", set it to 5. Otherwise
|
|||
|
// divide in half to get half before and half after focused year.
|
|||
|
numberYears = settings.selectYears === true ? 5 : ~~( settings.selectYears / 2 )
|
|||
|
|
|||
|
// If there are years to select, add a dropdown menu.
|
|||
|
if ( numberYears ) {
|
|||
|
|
|||
|
var
|
|||
|
minYear = minLimitObject.year,
|
|||
|
maxYear = maxLimitObject.year,
|
|||
|
lowestYear = focusedYear - numberYears,
|
|||
|
highestYear = focusedYear + numberYears
|
|||
|
|
|||
|
// If the min year is greater than the lowest year, increase the highest year
|
|||
|
// by the difference and set the lowest year to the min year.
|
|||
|
if ( minYear > lowestYear ) {
|
|||
|
highestYear += minYear - lowestYear
|
|||
|
lowestYear = minYear
|
|||
|
}
|
|||
|
|
|||
|
// If the max year is less than the highest year, decrease the lowest year
|
|||
|
// by the lower of the two: available and needed years. Then set the
|
|||
|
// highest year to the max year.
|
|||
|
if ( maxYear < highestYear ) {
|
|||
|
|
|||
|
var availableYears = lowestYear - minYear,
|
|||
|
neededYears = highestYear - maxYear
|
|||
|
|
|||
|
lowestYear -= availableYears > neededYears ? neededYears : availableYears
|
|||
|
highestYear = maxYear
|
|||
|
}
|
|||
|
|
|||
|
if ( settings.selectYears && override == undefined ) {
|
|||
|
return _.node( 'select',
|
|||
|
_.group({
|
|||
|
min: lowestYear,
|
|||
|
max: highestYear,
|
|||
|
i: 1,
|
|||
|
node: 'option',
|
|||
|
item: function( loopedYear ) {
|
|||
|
return [
|
|||
|
|
|||
|
// The looped year and no classes.
|
|||
|
loopedYear, 0,
|
|||
|
|
|||
|
// Set the value and selected index.
|
|||
|
'value=' + loopedYear + ( focusedYear == loopedYear ? ' selected' : '' )
|
|||
|
]
|
|||
|
}
|
|||
|
}),
|
|||
|
settings.klass.selectYear + ' browser-default',
|
|||
|
( isOpen ? '' : 'disabled' ) + ' ' + _.ariaAttr({ controls: calendar.$node[0].id + '_table' }) + ' ' +
|
|||
|
'title="' + settings.labelYearSelect + '"'
|
|||
|
)
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
if (override == "raw")
|
|||
|
return _.node( 'div', focusedYear )
|
|||
|
|
|||
|
// Otherwise just return the year focused
|
|||
|
return _.node( 'div', focusedYear, settings.klass.year )
|
|||
|
} //createYearLabel
|
|||
|
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
createDayLabel = function() {
|
|||
|
if (selectedObject != null)
|
|||
|
return _.node( 'div', selectedObject.date)
|
|||
|
else return _.node( 'div', nowObject.date)
|
|||
|
}
|
|||
|
createWeekdayLabel = function() {
|
|||
|
var display_day;
|
|||
|
|
|||
|
if (selectedObject != null)
|
|||
|
display_day = selectedObject.day;
|
|||
|
else
|
|||
|
display_day = nowObject.day;
|
|||
|
var weekday = settings.weekdaysFull[ display_day ]
|
|||
|
return weekday
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Create and return the entire calendar.
|
|||
|
return _.node(
|
|||
|
// Date presentation View
|
|||
|
'div',
|
|||
|
_.node(
|
|||
|
'div',
|
|||
|
createWeekdayLabel(),
|
|||
|
"picker__weekday-display"
|
|||
|
)+
|
|||
|
_.node(
|
|||
|
// Div for short Month
|
|||
|
'div',
|
|||
|
createMonthLabel("short_months"),
|
|||
|
settings.klass.month_display
|
|||
|
)+
|
|||
|
_.node(
|
|||
|
// Div for Day
|
|||
|
'div',
|
|||
|
createDayLabel() ,
|
|||
|
settings.klass.day_display
|
|||
|
)+
|
|||
|
_.node(
|
|||
|
// Div for Year
|
|||
|
'div',
|
|||
|
createYearLabel("raw") ,
|
|||
|
settings.klass.year_display
|
|||
|
),
|
|||
|
settings.klass.date_display
|
|||
|
)+
|
|||
|
// Calendar container
|
|||
|
_.node('div',
|
|||
|
_.node('div',
|
|||
|
( settings.selectYears ? createMonthLabel() + createYearLabel() : createMonthLabel() + createYearLabel() ) +
|
|||
|
createMonthNav() + createMonthNav( 1 ),
|
|||
|
settings.klass.header
|
|||
|
) + _.node(
|
|||
|
'table',
|
|||
|
tableHead +
|
|||
|
_.node(
|
|||
|
'tbody',
|
|||
|
_.group({
|
|||
|
min: 0,
|
|||
|
max: WEEKS_IN_CALENDAR - 1,
|
|||
|
i: 1,
|
|||
|
node: 'tr',
|
|||
|
item: function( rowCounter ) {
|
|||
|
|
|||
|
// If Monday is the first day and the month starts on Sunday, shift the date back a week.
|
|||
|
var shiftDateBy = settings.firstDay && calendar.create([ viewsetObject.year, viewsetObject.month, 1 ]).day === 0 ? -7 : 0
|
|||
|
|
|||
|
return [
|
|||
|
_.group({
|
|||
|
min: DAYS_IN_WEEK * rowCounter - viewsetObject.day + shiftDateBy + 1, // Add 1 for weekday 0index
|
|||
|
max: function() {
|
|||
|
return this.min + DAYS_IN_WEEK - 1
|
|||
|
},
|
|||
|
i: 1,
|
|||
|
node: 'td',
|
|||
|
item: function( targetDate ) {
|
|||
|
|
|||
|
// Convert the time date from a relative date to a target date.
|
|||
|
targetDate = calendar.create([ viewsetObject.year, viewsetObject.month, targetDate + ( settings.firstDay ? 1 : 0 ) ])
|
|||
|
|
|||
|
var isSelected = selectedObject && selectedObject.pick == targetDate.pick,
|
|||
|
isHighlighted = highlightedObject && highlightedObject.pick == targetDate.pick,
|
|||
|
isDisabled = disabledCollection && calendar.disabled( targetDate ) || targetDate.pick < minLimitObject.pick || targetDate.pick > maxLimitObject.pick,
|
|||
|
formattedDate = _.trigger( calendar.formats.toString, calendar, [ settings.format, targetDate ] )
|
|||
|
|
|||
|
return [
|
|||
|
_.node(
|
|||
|
'div',
|
|||
|
targetDate.date,
|
|||
|
(function( klasses ) {
|
|||
|
|
|||
|
// Add the `infocus` or `outfocus` classes based on month in view.
|
|||
|
klasses.push( viewsetObject.month == targetDate.month ? settings.klass.infocus : settings.klass.outfocus )
|
|||
|
|
|||
|
// Add the `today` class if needed.
|
|||
|
if ( nowObject.pick == targetDate.pick ) {
|
|||
|
klasses.push( settings.klass.now )
|
|||
|
}
|
|||
|
|
|||
|
// Add the `selected` class if something's selected and the time matches.
|
|||
|
if ( isSelected ) {
|
|||
|
klasses.push( settings.klass.selected )
|
|||
|
}
|
|||
|
|
|||
|
// Add the `highlighted` class if something's highlighted and the time matches.
|
|||
|
if ( isHighlighted ) {
|
|||
|
klasses.push( settings.klass.highlighted )
|
|||
|
}
|
|||
|
|
|||
|
// Add the `disabled` class if something's disabled and the object matches.
|
|||
|
if ( isDisabled ) {
|
|||
|
klasses.push( settings.klass.disabled )
|
|||
|
}
|
|||
|
|
|||
|
return klasses.join( ' ' )
|
|||
|
})([ settings.klass.day ]),
|
|||
|
'data-pick=' + targetDate.pick + ' ' + _.ariaAttr({
|
|||
|
role: 'gridcell',
|
|||
|
label: formattedDate,
|
|||
|
selected: isSelected && calendar.$node.val() === formattedDate ? true : null,
|
|||
|
activedescendant: isHighlighted ? true : null,
|
|||
|
disabled: isDisabled ? true : null
|
|||
|
})
|
|||
|
),
|
|||
|
'',
|
|||
|
_.ariaAttr({ role: 'presentation' })
|
|||
|
] //endreturn
|
|||
|
}
|
|||
|
})
|
|||
|
] //endreturn
|
|||
|
}
|
|||
|
})
|
|||
|
),
|
|||
|
settings.klass.table,
|
|||
|
'id="' + calendar.$node[0].id + '_table' + '" ' + _.ariaAttr({
|
|||
|
role: 'grid',
|
|||
|
controls: calendar.$node[0].id,
|
|||
|
readonly: true
|
|||
|
})
|
|||
|
)
|
|||
|
, settings.klass.calendar_container) // end calendar
|
|||
|
|
|||
|
+
|
|||
|
|
|||
|
// * For Firefox forms to submit, make sure to set the buttons’ `type` attributes as “button”.
|
|||
|
_.node(
|
|||
|
'div',
|
|||
|
_.node( 'button', settings.today, "btn-flat picker__today",
|
|||
|
'type=button data-pick=' + nowObject.pick +
|
|||
|
( isOpen && !calendar.disabled(nowObject) ? '' : ' disabled' ) + ' ' +
|
|||
|
_.ariaAttr({ controls: calendar.$node[0].id }) ) +
|
|||
|
_.node( 'button', settings.clear, "btn-flat picker__clear",
|
|||
|
'type=button data-clear=1' +
|
|||
|
( isOpen ? '' : ' disabled' ) + ' ' +
|
|||
|
_.ariaAttr({ controls: calendar.$node[0].id }) ) +
|
|||
|
_.node('button', settings.close, "btn-flat picker__close",
|
|||
|
'type=button data-close=true ' +
|
|||
|
( isOpen ? '' : ' disabled' ) + ' ' +
|
|||
|
_.ariaAttr({ controls: calendar.$node[0].id }) ),
|
|||
|
settings.klass.footer
|
|||
|
) //endreturn
|
|||
|
} //DatePicker.prototype.nodes
|
|||
|
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* The date picker defaults.
|
|||
|
*/
|
|||
|
DatePicker.defaults = (function( prefix ) {
|
|||
|
|
|||
|
return {
|
|||
|
|
|||
|
// The title label to use for the month nav buttons
|
|||
|
labelMonthNext: 'Next month',
|
|||
|
labelMonthPrev: 'Previous month',
|
|||
|
|
|||
|
// The title label to use for the dropdown selectors
|
|||
|
labelMonthSelect: 'Select a month',
|
|||
|
labelYearSelect: 'Select a year',
|
|||
|
|
|||
|
// Months and weekdays
|
|||
|
monthsFull: [ 'January', 'February', 'March', 'April', 'May', 'June', 'July', 'August', 'September', 'October', 'November', 'December' ],
|
|||
|
monthsShort: [ 'Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec' ],
|
|||
|
weekdaysFull: [ 'Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday' ],
|
|||
|
weekdaysShort: [ 'Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat' ],
|
|||
|
|
|||
|
// Materialize modified
|
|||
|
weekdaysLetter: [ 'S', 'M', 'T', 'W', 'T', 'F', 'S' ],
|
|||
|
|
|||
|
// Today and clear
|
|||
|
today: 'Today',
|
|||
|
clear: 'Clear',
|
|||
|
close: 'Close',
|
|||
|
|
|||
|
// The format to show on the `input` element
|
|||
|
format: 'd mmmm, yyyy',
|
|||
|
|
|||
|
// Classes
|
|||
|
klass: {
|
|||
|
|
|||
|
table: prefix + 'table',
|
|||
|
|
|||
|
header: prefix + 'header',
|
|||
|
|
|||
|
|
|||
|
// Materialize Added klasses
|
|||
|
date_display: prefix + 'date-display',
|
|||
|
day_display: prefix + 'day-display',
|
|||
|
month_display: prefix + 'month-display',
|
|||
|
year_display: prefix + 'year-display',
|
|||
|
calendar_container: prefix + 'calendar-container',
|
|||
|
// end
|
|||
|
|
|||
|
|
|||
|
|
|||
|
navPrev: prefix + 'nav--prev',
|
|||
|
navNext: prefix + 'nav--next',
|
|||
|
navDisabled: prefix + 'nav--disabled',
|
|||
|
|
|||
|
month: prefix + 'month',
|
|||
|
year: prefix + 'year',
|
|||
|
|
|||
|
selectMonth: prefix + 'select--month',
|
|||
|
selectYear: prefix + 'select--year',
|
|||
|
|
|||
|
weekdays: prefix + 'weekday',
|
|||
|
|
|||
|
day: prefix + 'day',
|
|||
|
disabled: prefix + 'day--disabled',
|
|||
|
selected: prefix + 'day--selected',
|
|||
|
highlighted: prefix + 'day--highlighted',
|
|||
|
now: prefix + 'day--today',
|
|||
|
infocus: prefix + 'day--infocus',
|
|||
|
outfocus: prefix + 'day--outfocus',
|
|||
|
|
|||
|
footer: prefix + 'footer',
|
|||
|
|
|||
|
buttonClear: prefix + 'button--clear',
|
|||
|
buttonToday: prefix + 'button--today',
|
|||
|
buttonClose: prefix + 'button--close'
|
|||
|
}
|
|||
|
}
|
|||
|
})( Picker.klasses().picker + '__' )
|
|||
|
|
|||
|
|
|||
|
|
|||
|
|
|||
|
|
|||
|
/**
|
|||
|
* Extend the picker to add the date picker.
|
|||
|
*/
|
|||
|
Picker.extend( 'pickadate', DatePicker )
|
|||
|
|
|||
|
|
|||
|
}));
|
|||
|
|
|||
|
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
$.fn.characterCounter = function(){
|
|||
|
return this.each(function(){
|
|||
|
var $input = $(this);
|
|||
|
var $counterElement = $input.parent().find('span[class="character-counter"]');
|
|||
|
|
|||
|
// character counter has already been added appended to the parent container
|
|||
|
if ($counterElement.length) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
var itHasLengthAttribute = $input.attr('data-length') !== undefined;
|
|||
|
|
|||
|
if(itHasLengthAttribute){
|
|||
|
$input.on('input', updateCounter);
|
|||
|
$input.on('focus', updateCounter);
|
|||
|
$input.on('blur', removeCounterElement);
|
|||
|
|
|||
|
addCounterElement($input);
|
|||
|
}
|
|||
|
|
|||
|
});
|
|||
|
};
|
|||
|
|
|||
|
function updateCounter(){
|
|||
|
var maxLength = +$(this).attr('data-length'),
|
|||
|
actualLength = +$(this).val().length,
|
|||
|
isValidLength = actualLength <= maxLength;
|
|||
|
|
|||
|
$(this).parent().find('span[class="character-counter"]')
|
|||
|
.html( actualLength + '/' + maxLength);
|
|||
|
|
|||
|
addInputStyle(isValidLength, $(this));
|
|||
|
}
|
|||
|
|
|||
|
function addCounterElement($input) {
|
|||
|
var $counterElement = $input.parent().find('span[class="character-counter"]');
|
|||
|
|
|||
|
if ($counterElement.length) {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
$counterElement = $('<span/>')
|
|||
|
.addClass('character-counter')
|
|||
|
.css('float','right')
|
|||
|
.css('font-size','12px')
|
|||
|
.css('height', 1);
|
|||
|
|
|||
|
$input.parent().append($counterElement);
|
|||
|
}
|
|||
|
|
|||
|
function removeCounterElement(){
|
|||
|
$(this).parent().find('span[class="character-counter"]').html('');
|
|||
|
}
|
|||
|
|
|||
|
function addInputStyle(isValidLength, $input){
|
|||
|
var inputHasInvalidClass = $input.hasClass('invalid');
|
|||
|
if (isValidLength && inputHasInvalidClass) {
|
|||
|
$input.removeClass('invalid');
|
|||
|
}
|
|||
|
else if(!isValidLength && !inputHasInvalidClass){
|
|||
|
$input.removeClass('valid');
|
|||
|
$input.addClass('invalid');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
$(document).ready(function(){
|
|||
|
$('input, textarea').characterCounter();
|
|||
|
});
|
|||
|
|
|||
|
}( jQuery ));
|
|||
|
;(function ($) {
|
|||
|
|
|||
|
var methods = {
|
|||
|
|
|||
|
init : function(options) {
|
|||
|
var defaults = {
|
|||
|
duration: 200, // ms
|
|||
|
dist: -100, // zoom scale TODO: make this more intuitive as an option
|
|||
|
shift: 0, // spacing for center image
|
|||
|
padding: 0, // Padding between non center items
|
|||
|
fullWidth: false, // Change to full width styles
|
|||
|
indicators: false, // Toggle indicators
|
|||
|
noWrap: false, // Don't wrap around and cycle through items.
|
|||
|
onCycleTo: null // Callback for when a new slide is cycled to.
|
|||
|
};
|
|||
|
options = $.extend(defaults, options);
|
|||
|
|
|||
|
return this.each(function() {
|
|||
|
|
|||
|
var images, item_width, item_height, offset, center, pressed, dim, count,
|
|||
|
reference, referenceY, amplitude, target, velocity,
|
|||
|
xform, frame, timestamp, ticker, dragged, vertical_dragged;
|
|||
|
var $indicators = $('<ul class="indicators"></ul>');
|
|||
|
|
|||
|
|
|||
|
// Initialize
|
|||
|
var view = $(this);
|
|||
|
var showIndicators = view.attr('data-indicators') || options.indicators;
|
|||
|
|
|||
|
// Don't double initialize.
|
|||
|
if (view.hasClass('initialized')) {
|
|||
|
// Redraw carousel.
|
|||
|
$(this).trigger('carouselNext', [0.000001]);
|
|||
|
return true;
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// Options
|
|||
|
if (options.fullWidth) {
|
|||
|
options.dist = 0;
|
|||
|
var firstImage = view.find('.carousel-item img').first();
|
|||
|
if (firstImage.length) {
|
|||
|
imageHeight = firstImage.on('load', function(){
|
|||
|
view.css('height', $(this).height());
|
|||
|
});
|
|||
|
} else {
|
|||
|
imageHeight = view.find('.carousel-item').first().height();
|
|||
|
view.css('height', imageHeight);
|
|||
|
}
|
|||
|
|
|||
|
// Offset fixed items when indicators.
|
|||
|
if (showIndicators) {
|
|||
|
view.find('.carousel-fixed-item').addClass('with-indicators');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
view.addClass('initialized');
|
|||
|
pressed = false;
|
|||
|
offset = target = 0;
|
|||
|
images = [];
|
|||
|
item_width = view.find('.carousel-item').first().innerWidth();
|
|||
|
item_height = view.find('.carousel-item').first().innerHeight();
|
|||
|
dim = item_width * 2 + options.padding;
|
|||
|
|
|||
|
view.find('.carousel-item').each(function (i) {
|
|||
|
images.push($(this)[0]);
|
|||
|
if (showIndicators) {
|
|||
|
var $indicator = $('<li class="indicator-item"></li>');
|
|||
|
|
|||
|
// Add active to first by default.
|
|||
|
if (i === 0) {
|
|||
|
$indicator.addClass('active');
|
|||
|
}
|
|||
|
|
|||
|
// Handle clicks on indicators.
|
|||
|
$indicator.click(function (e) {
|
|||
|
e.stopPropagation();
|
|||
|
|
|||
|
var index = $(this).index();
|
|||
|
cycleTo(index);
|
|||
|
});
|
|||
|
$indicators.append($indicator);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
if (showIndicators) {
|
|||
|
view.append($indicators);
|
|||
|
}
|
|||
|
count = images.length;
|
|||
|
|
|||
|
|
|||
|
function setupEvents() {
|
|||
|
if (typeof window.ontouchstart !== 'undefined') {
|
|||
|
view[0].addEventListener('touchstart', tap);
|
|||
|
view[0].addEventListener('touchmove', drag);
|
|||
|
view[0].addEventListener('touchend', release);
|
|||
|
}
|
|||
|
view[0].addEventListener('mousedown', tap);
|
|||
|
view[0].addEventListener('mousemove', drag);
|
|||
|
view[0].addEventListener('mouseup', release);
|
|||
|
view[0].addEventListener('mouseleave', release);
|
|||
|
view[0].addEventListener('click', click);
|
|||
|
}
|
|||
|
|
|||
|
function xpos(e) {
|
|||
|
// touch event
|
|||
|
if (e.targetTouches && (e.targetTouches.length >= 1)) {
|
|||
|
return e.targetTouches[0].clientX;
|
|||
|
}
|
|||
|
|
|||
|
// mouse event
|
|||
|
return e.clientX;
|
|||
|
}
|
|||
|
|
|||
|
function ypos(e) {
|
|||
|
// touch event
|
|||
|
if (e.targetTouches && (e.targetTouches.length >= 1)) {
|
|||
|
return e.targetTouches[0].clientY;
|
|||
|
}
|
|||
|
|
|||
|
// mouse event
|
|||
|
return e.clientY;
|
|||
|
}
|
|||
|
|
|||
|
function wrap(x) {
|
|||
|
return (x >= count) ? (x % count) : (x < 0) ? wrap(count + (x % count)) : x;
|
|||
|
}
|
|||
|
|
|||
|
function scroll(x) {
|
|||
|
var i, half, delta, dir, tween, el, alignment, xTranslation;
|
|||
|
var lastCenter = center;
|
|||
|
|
|||
|
offset = (typeof x === 'number') ? x : offset;
|
|||
|
center = Math.floor((offset + dim / 2) / dim);
|
|||
|
delta = offset - center * dim;
|
|||
|
dir = (delta < 0) ? 1 : -1;
|
|||
|
tween = -dir * delta * 2 / dim;
|
|||
|
half = count >> 1;
|
|||
|
|
|||
|
if (!options.fullWidth) {
|
|||
|
alignment = 'translateX(' + (view[0].clientWidth - item_width) / 2 + 'px) ';
|
|||
|
alignment += 'translateY(' + (view[0].clientHeight - item_height) / 2 + 'px)';
|
|||
|
} else {
|
|||
|
alignment = 'translateX(0)';
|
|||
|
}
|
|||
|
|
|||
|
// Set indicator active
|
|||
|
if (showIndicators) {
|
|||
|
var diff = (center % count);
|
|||
|
var activeIndicator = $indicators.find('.indicator-item.active');
|
|||
|
if (activeIndicator.index() !== diff) {
|
|||
|
activeIndicator.removeClass('active');
|
|||
|
$indicators.find('.indicator-item').eq(diff).addClass('active');
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// center
|
|||
|
// Don't show wrapped items.
|
|||
|
if (!options.noWrap || (center >= 0 && center < count)) {
|
|||
|
el = images[wrap(center)];
|
|||
|
|
|||
|
// Add active class to center item.
|
|||
|
if (!$(el).hasClass('active')) {
|
|||
|
view.find('.carousel-item').removeClass('active');
|
|||
|
$(el).addClass('active');
|
|||
|
}
|
|||
|
el.style[xform] = alignment +
|
|||
|
' translateX(' + (-delta / 2) + 'px)' +
|
|||
|
' translateX(' + (dir * options.shift * tween * i) + 'px)' +
|
|||
|
' translateZ(' + (options.dist * tween) + 'px)';
|
|||
|
el.style.zIndex = 0;
|
|||
|
if (options.fullWidth) { tweenedOpacity = 1; }
|
|||
|
else { tweenedOpacity = 1 - 0.2 * tween; }
|
|||
|
el.style.opacity = tweenedOpacity;
|
|||
|
el.style.display = 'block';
|
|||
|
}
|
|||
|
|
|||
|
for (i = 1; i <= half; ++i) {
|
|||
|
// right side
|
|||
|
if (options.fullWidth) {
|
|||
|
zTranslation = options.dist;
|
|||
|
tweenedOpacity = (i === half && delta < 0) ? 1 - tween : 1;
|
|||
|
} else {
|
|||
|
zTranslation = options.dist * (i * 2 + tween * dir);
|
|||
|
tweenedOpacity = 1 - 0.2 * (i * 2 + tween * dir);
|
|||
|
}
|
|||
|
// Don't show wrapped items.
|
|||
|
if (!options.noWrap || center + i < count) {
|
|||
|
el = images[wrap(center + i)];
|
|||
|
el.style[xform] = alignment +
|
|||
|
' translateX(' + (options.shift + (dim * i - delta) / 2) + 'px)' +
|
|||
|
' translateZ(' + zTranslation + 'px)';
|
|||
|
el.style.zIndex = -i;
|
|||
|
el.style.opacity = tweenedOpacity;
|
|||
|
el.style.display = 'block';
|
|||
|
}
|
|||
|
|
|||
|
|
|||
|
// left side
|
|||
|
if (options.fullWidth) {
|
|||
|
zTranslation = options.dist;
|
|||
|
tweenedOpacity = (i === half && delta > 0) ? 1 - tween : 1;
|
|||
|
} else {
|
|||
|
zTranslation = options.dist * (i * 2 - tween * dir);
|
|||
|
tweenedOpacity = 1 - 0.2 * (i * 2 - tween * dir);
|
|||
|
}
|
|||
|
// Don't show wrapped items.
|
|||
|
if (!options.noWrap || center - i >= 0) {
|
|||
|
el = images[wrap(center - i)];
|
|||
|
el.style[xform] = alignment +
|
|||
|
' translateX(' + (-options.shift + (-dim * i - delta) / 2) + 'px)' +
|
|||
|
' translateZ(' + zTranslation + 'px)';
|
|||
|
el.style.zIndex = -i;
|
|||
|
el.style.opacity = tweenedOpacity;
|
|||
|
el.style.display = 'block';
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// center
|
|||
|
// Don't show wrapped items.
|
|||
|
if (!options.noWrap || (center >= 0 && center < count)) {
|
|||
|
el = images[wrap(center)];
|
|||
|
el.style[xform] = alignment +
|
|||
|
' translateX(' + (-delta / 2) + 'px)' +
|
|||
|
' translateX(' + (dir * options.shift * tween) + 'px)' +
|
|||
|
' translateZ(' + (options.dist * tween) + 'px)';
|
|||
|
el.style.zIndex = 0;
|
|||
|
if (options.fullWidth) { tweenedOpacity = 1; }
|
|||
|
else { tweenedOpacity = 1 - 0.2 * tween; }
|
|||
|
el.style.opacity = tweenedOpacity;
|
|||
|
el.style.display = 'block';
|
|||
|
}
|
|||
|
|
|||
|
// onCycleTo callback
|
|||
|
if (lastCenter !== center &&
|
|||
|
typeof(options.onCycleTo) === "function") {
|
|||
|
var $curr_item = view.find('.carousel-item').eq(wrap(center));
|
|||
|
options.onCycleTo.call(this, $curr_item, dragged);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
function track() {
|
|||
|
var now, elapsed, delta, v;
|
|||
|
|
|||
|
now = Date.now();
|
|||
|
elapsed = now - timestamp;
|
|||
|
timestamp = now;
|
|||
|
delta = offset - frame;
|
|||
|
frame = offset;
|
|||
|
|
|||
|
v = 1000 * delta / (1 + elapsed);
|
|||
|
velocity = 0.8 * v + 0.2 * velocity;
|
|||
|
}
|
|||
|
|
|||
|
function autoScroll() {
|
|||
|
var elapsed, delta;
|
|||
|
|
|||
|
if (amplitude) {
|
|||
|
elapsed = Date.now() - timestamp;
|
|||
|
delta = amplitude * Math.exp(-elapsed / options.duration);
|
|||
|
if (delta > 2 || delta < -2) {
|
|||
|
scroll(target - delta);
|
|||
|
requestAnimationFrame(autoScroll);
|
|||
|
} else {
|
|||
|
scroll(target);
|
|||
|
}
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
function click(e) {
|
|||
|
// Disable clicks if carousel was dragged.
|
|||
|
if (dragged) {
|
|||
|
e.preventDefault();
|
|||
|
e.stopPropagation();
|
|||
|
return false;
|
|||
|
|
|||
|
} else if (!options.fullWidth) {
|
|||
|
var clickedIndex = $(e.target).closest('.carousel-item').index();
|
|||
|
var diff = (center % count) - clickedIndex;
|
|||
|
|
|||
|
// Disable clicks if carousel was shifted by click
|
|||
|
if (diff !== 0) {
|
|||
|
e.preventDefault();
|
|||
|
e.stopPropagation();
|
|||
|
}
|
|||
|
cycleTo(clickedIndex);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
function cycleTo(n) {
|
|||
|
var diff = (center % count) - n;
|
|||
|
|
|||
|
// Account for wraparound.
|
|||
|
if (!options.noWrap) {
|
|||
|
if (diff < 0) {
|
|||
|
if (Math.abs(diff + count) < Math.abs(diff)) { diff += count; }
|
|||
|
|
|||
|
} else if (diff > 0) {
|
|||
|
if (Math.abs(diff - count) < diff) { diff -= count; }
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
// Call prev or next accordingly.
|
|||
|
if (diff < 0) {
|
|||
|
view.trigger('carouselNext', [Math.abs(diff)]);
|
|||
|
|
|||
|
} else if (diff > 0) {
|
|||
|
view.trigger('carouselPrev', [diff]);
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
function tap(e) {
|
|||
|
pressed = true;
|
|||
|
dragged = false;
|
|||
|
vertical_dragged = false;
|
|||
|
reference = xpos(e);
|
|||
|
referenceY = ypos(e);
|
|||
|
|
|||
|
velocity = amplitude = 0;
|
|||
|
frame = offset;
|
|||
|
timestamp = Date.now();
|
|||
|
clearInterval(ticker);
|
|||
|
ticker = setInterval(track, 100);
|
|||
|
|
|||
|
}
|
|||
|
|
|||
|
function drag(e) {
|
|||
|
var x, delta, deltaY;
|
|||
|
if (pressed) {
|
|||
|
x = xpos(e);
|
|||
|
y = ypos(e);
|
|||
|
delta = reference - x;
|
|||
|
deltaY = Math.abs(referenceY - y);
|
|||
|
if (deltaY < 30 && !vertical_dragged) {
|
|||
|
// If vertical scrolling don't allow dragging.
|
|||
|
if (delta > 2 || delta < -2) {
|
|||
|
dragged = true;
|
|||
|
reference = x;
|
|||
|
scroll(offset + delta);
|
|||
|
}
|
|||
|
|
|||
|
} else if (dragged) {
|
|||
|
// If dragging don't allow vertical scroll.
|
|||
|
e.preventDefault();
|
|||
|
e.stopPropagation();
|
|||
|
return false;
|
|||
|
|
|||
|
} else {
|
|||
|
// Vertical scrolling.
|
|||
|
vertical_dragged = true;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
if (dragged) {
|
|||
|
// If dragging don't allow vertical scroll.
|
|||
|
e.preventDefault();
|
|||
|
e.stopPropagation();
|
|||
|
return false;
|
|||
|
}
|
|||
|
}
|
|||
|
|
|||
|
function release(e) {
|
|||
|
if (pressed) {
|
|||
|
pressed = false;
|
|||
|
} else {
|
|||
|
return;
|
|||
|
}
|
|||
|
|
|||
|
clearInterval(ticker);
|
|||
|
target = offset;
|
|||
|
if (velocity > 10 || velocity < -10) {
|
|||
|
amplitude = 0.9 * velocity;
|
|||
|
target = offset + amplitude;
|
|||
|
}
|
|||
|
target = Math.round(target / dim) * dim;
|
|||
|
|
|||
|
// No wrap of items.
|
|||
|
if (options.noWrap) {
|
|||
|
if (target >= dim * (count - 1)) {
|
|||
|
target = dim * (count - 1);
|
|||
|
} else if (target < 0) {
|
|||
|
target = 0;
|
|||
|
}
|
|||
|
}
|
|||
|
amplitude = target - offset;
|
|||
|
timestamp = Date.now();
|
|||
|
requestAnimationFrame(autoScroll);
|
|||
|
|
|||
|
if (dragged) {
|
|||
|
e.preventDefault();
|
|||
|
e.stopPropagation();
|
|||
|
}
|
|||
|
return false;
|
|||
|
}
|
|||
|
|
|||
|
xform = 'transform';
|
|||
|
['webkit', 'Moz', 'O', 'ms'].every(function (prefix) {
|
|||
|
var e = prefix + 'Transform';
|
|||
|
if (typeof document.body.style[e] !== 'undefined') {
|
|||
|
xform = e;
|
|||
|
return false;
|
|||
|
}
|
|||
|
return true;
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
$(window).on('resize.carousel', function() {
|
|||
|
if (options.fullWidth) {
|
|||
|
item_width = view.find('.carousel-item').first().innerWidth();
|
|||
|
item_height = view.find('.carousel-item').first().innerHeight();
|
|||
|
dim = item_width * 2 + options.padding;
|
|||
|
offset = center * 2 * item_width;
|
|||
|
target = offset;
|
|||
|
} else {
|
|||
|
scroll();
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
setupEvents();
|
|||
|
scroll(offset);
|
|||
|
|
|||
|
$(this).on('carouselNext', function(e, n) {
|
|||
|
if (n === undefined) {
|
|||
|
n = 1;
|
|||
|
}
|
|||
|
target = (dim * Math.round(offset / dim)) + (dim * n);
|
|||
|
if (offset !== target) {
|
|||
|
amplitude = target - offset;
|
|||
|
timestamp = Date.now();
|
|||
|
requestAnimationFrame(autoScroll);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$(this).on('carouselPrev', function(e, n) {
|
|||
|
if (n === undefined) {
|
|||
|
n = 1;
|
|||
|
}
|
|||
|
target = (dim * Math.round(offset / dim)) - (dim * n);
|
|||
|
if (offset !== target) {
|
|||
|
amplitude = target - offset;
|
|||
|
timestamp = Date.now();
|
|||
|
requestAnimationFrame(autoScroll);
|
|||
|
}
|
|||
|
});
|
|||
|
|
|||
|
$(this).on('carouselSet', function(e, n) {
|
|||
|
if (n === undefined) {
|
|||
|
n = 0;
|
|||
|
}
|
|||
|
cycleTo(n);
|
|||
|
});
|
|||
|
|
|||
|
});
|
|||
|
|
|||
|
|
|||
|
|
|||
|
},
|
|||
|
next : function(n) {
|
|||
|
$(this).trigger('carouselNext', [n]);
|
|||
|
},
|
|||
|
prev : function(n) {
|
|||
|
$(this).trigger('carouselPrev', [n]);
|
|||
|
},
|
|||
|
set : function(n) {
|
|||
|
$(this).trigger('carouselSet', [n]);
|
|||
|
}
|
|||
|
};
|
|||
|
|
|||
|
|
|||
|
$.fn.carousel = function(methodOrOptions) {
|
|||
|
if ( methods[methodOrOptions] ) {
|
|||
|
return methods[ methodOrOptions ].apply( this, Array.prototype.slice.call( arguments, 1 ));
|
|||
|
} else if ( typeof methodOrOptions === 'object' || ! methodOrOptions ) {
|
|||
|
// Default to "init"
|
|||
|
return methods.init.apply( this, arguments );
|
|||
|
} else {
|
|||
|
$.error( 'Method ' + methodOrOptions + ' does not exist on jQuery.carousel' );
|
|||
|
}
|
|||
|
}; // Plugin end
|
|||
|
}( jQuery ));
|